Au(III) Cyclometallated Compounds with 2-Arylpyridines and Their Derivatives or Analogues: 34 Years (1989–2022) of NMR and Single Crystal X-ray Studies
1
Faculty of Chemistry, Nicolaus Copernicus University, 7 Gagarina, 87100 Toruń, Poland
2
Nikolaev Institute of Inorganic Chemistry of the Russian Academy of Sciences, 3 Acad. Lavrentiev Ave., 630090 Novosibirsk, Russia
*
Author to whom correspondence should be addressed.
Inorganics 2023, 11(3), 100; https://doi.org/10.3390/inorganics11030100
Submission received: 16 December 2022
/
Revised: 17 February 2023
/
Accepted: 23 February 2023
/
Published: 28 February 2023
(This article belongs to the Special Issue Metal Complexes with N-donor Ligands)
Abstract
:A review paper on Au(III) cyclometallated compounds with 2-arylpyridines (2-phenylpyridine, 2-benzylpyridine, 2-benzoylpyridine, 2-phenoxypyridine, 2-phenylsulfanylpyridine, 2-anilinopyridine, 2-(naphth-2-yl)pyridine, 2-(9,9-dialkylfluoren-2-yl)pyridines, 2-(dibenzofuran-4-yl)pyridine, and their derivatives) and their analogues (2-arylquinolines, 1- and 3-arylisoquinolines, 7,8-benzoquinoline), with 113 references. A total of 554 species, containing κ2-N(1),C(6′)*-Au(III), or analogous moiety (i.e., chelated by nitrogen of the pyridine-like ring and the deprotonated ortho- carbon of the phenyl-like ring) and, thus, possessing a character intermediate between metal complexes and organometallics, studied in the years 1989–2022 by NMR spectroscopy and/or single crystal X-ray diffraction (207 X-ray structures), are described. The compounds for which biological or catalytic activity and the luminescence properties were studied are also quoted.
1. Introduction
The compound 2-Phenylpyridine (2ppy) is aza aromatic, which is known to coordinate transition metal ions in two alternative ways: as a monodentate N(1)-donor or a bidentate N(1),C(6′)*-chelating agent 2ppy* (2ppy* = monoanionic form of 2ppy, deprotonated in the phenyl side group at the ortho-carbon C(6′)*). In the latter case, it may form Au(III)-2ppy* cycloaurated compounds, which can be regarded as either complexes or organometallics (due to the presence of both gold–nitrogen and gold–carbon bonds), usually upon the presence of some other auxiliary ligands (inorganic and/or organic), which complete the square-planar (d8) coordination sphere. The same κ2-N(1),C(6′) coordination mode is also observed for 2ppy* derivatives containing substituents in the pyridine and/or in the phenyl ring (denoted as 2PPY*) and results in a large variety of Au(III)-2PPY* species. They are presented, together with the numbering of both aromatic rings, in a general form in Scheme 1 (L1, L2, and L1L2 denote mono- and bidentate auxiliary ligands, respectively).
The same κ2-N(1),C(6′) coordination of Au(III) is observed for such analogues of 2ppy* as 2-benzylpyridine*, 2-benzoylpyridine*, 2-phenoxypyridine*, 2-phenylsulfanylpyridine*, and 2-anilinopyridine* (Scheme 2), while the similar κ2-N(1),C(3′) one for 2-(naphth-2-yl)pyridine*, 2-(9,9-dialkylfluoren-2-yl)pyridines* and 2-(dibenzofuran-4-yl)pyridine* (Scheme 3), including their derivatives, substituted in any places of the parent heterocycles. These analogues of 2PPY*, generally named here as 2-arylpyridines* (denoted as 2ArPY*), yield many Au(III)-2ArPY* species.
Analogous Au(III) chelation is also known for analogues of 2ArPY* containing pyridine-like ring (PY#, e.g., quinoline or isoquinoline) and aryl ring (Ar), linked by a single bond (in 2-arylquinolines* and 1- or 3-arylisoquinolines*) or fused (in 7,8-benzoquinoline*), together with their derivatives (denoted as ArPY#*). The coordination mode is generally similar, although the numbering of atoms may differ for various ring systems (usually nitrogen N(1) or N(2) in the PY# moiety and the deprotonated ortho-carbon C(6′) or C(10) in the Ar moiety; Scheme 4)—resulting in some Au(III)-ArPY#* species.
It must be underlined that the concerned bidentate coordination mode of 2ppy*, 2PPY*, 2ArPY*, and ArPY#* is also widely observed for many other transition metal ions; however, this review is focused on the Au(III) compounds only.
Its main aim is the summary of NMR and X-ray structural data. However, many concerned species exhibit biological (anti-tumour and/or anti-microbial) and catalytic activity, as well as luminescence (both fluorescence and phosphorescence), which allows for some practical applications; these properties were also described, at least in the most important cases.
The increasing interest in this class of Au(III) compounds can be illustrated by the numbers of molecules for which the single crystal X-ray structures were published (totally 207) every year, as presented in Scheme 5:
The year-to-year fluctuations can be eliminated by calculating the numbers of molecules with the published X-ray structures for each 5-year period, as follows: 1995–1999: 8, 2000–2004: 14, 2005–2009: 8, 2010–2014: 45, 2015–2020: 79, from 2020: already 53 (in three years). This tendency clearly exhibits the growth of research intensity on the concerned compounds.
Generally, the data contained in this paper can be found in some databases, such as Reaxys or CCDC. However, their collection in one reviewing article allows the researchers to compare them and to deduce some general conclusions. In fact, it was the principal purpose of this review.
2. Reviewed Data
2.1. Au(III)-2PPY* Compounds
2.1.1. Au(III)-2PPY* Dihalides
The simplest representative of this class of chemicals is [Au(2-phenylpyridine*)Cl2] (i.e., [Au(2ppy*)Cl2]), described for the first time in 1989 by Constable et al. [1]. It is widely used as a precursor for the synthesis of some other Au(III)-2ppy* compounds; thus, the number of articles where it appears is really large, and the most noteworthy papers are those in which its NMR characterization was given [1,2,3,4,5,6,7,8,9,10], together with the single crystal X-ray structure (IJAQEP) [3]. Surprisingly, despite numerous reports about this dichloride [Au(2ppy*)Cl2] species, there are no literature data on its analogues with some other halogens (F, Br, I)—although they are available for similar Au(III)-2PPY* (2PPY* ≠ 2ppy*) dihalides.
Among the dihalides having the general formula [Au(2PPY*)XY] (X, Y = F, Cl, Br, I), including [Au(2PPY*)X2], and particularly, the most popular [Au(2PPY*)Cl2] one, 43 (not counting [Au(2ppy*)Cl2]) were reported and characterised by NMR spectroscopy and/or by single crystal X-ray diffraction [2,5,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24].
A total of 3 of them contained 2ppy* derivatives, substituted only in the pyridine ring (R1 = 3-methyl-, 4-n-propyl-, 5-n-butyl-) [2,10,11], while 25 had 2ppy* derivatives with substituent(s) exclusively in the phenyl ring (R2 = 2-, 3- and 4-methyl-; 3-n-butyl; 4-tert-butyl-; 2- and 4-fluoro-; 2,4-difluoro-; 4-chloro-; 3- and 4- trifluoromethyl-; 3- and 4-methoxy-; 4-n-butoxy-; 3,5-dimethoxy-; 2- and 4-trifluoromethoxy-; 4-formyl-; 2-, 3- and 4-phenyl; 4-(9-bromo)-n-nonoxy)-; 4-(9-trimethylammonium-n-nonoxy)-; 4-(9-(4-methylphenylsulfonoxy)-n-nonoxy-) [5,8,9,10,11,12,13,14,15,16,17,18,19,20]. Then, 15 possessed 2ppy* derivatives substituted in both the pyridine and the phenyl ring (3-methyl-2-(2-fluorophenyl)pyridine*, 3-methyl-2-(3,4,5-trimethoxyphenyl)pyridine*, 5-carboxy-2-(4-carboxyphenyl)pyridine*, 5-ethoxycarbonyl-2-(4-ethoxycarbonylphenyl)pyridine*, 4-dimethylamino-2-(2,3,4-trifluorophenyl)pyridine*, 4-dimethylamino-2-(3-trifluoromethylphenyl)pyridine*, 4-dimethylamino-2-(4-trifluoromethoxyphenyl)pyridine*) [21,22,23,24].
All these [Au(2PPY*)XY] dihalides (Scheme 1 left, for L1 = X and L2 = Y) are listed in Table 1 (the 2PPY* ligands are presented as 2ppy* derivatives, variously substituted in the pyridine ring (by R1) and/or in the phenyl ring (by R2), so having the general formula/name of a-R1-2-(b-R2-phenyl)pyridine* (a = 3–6, b = 2–5)), together with the main solvents used upon the NMR studies and the CCDC reference codes for the respective single crystal X-ray structures; moreover, the biological (BIO) and catalytic (CAT) activity, as well as luminescence properties (LUM), are indicated. The same notations will be used in all other tables.
Among these [Au(2PPY*)XY] compounds, [Au(2-(4-tert-butylphenyl)pyridine*)Cl2] is biologically active, revealing anti-tumour properties (against breast or lung cancer and leukemia) [25,26]. Some other [Au(2PPY*)Cl2] dichloride species have catalytic properties (in reactions between alkynes, carbonyl compounds, and amines or imines—yielding amines, allenes, or oxazoles [16,17]—as well as between propargyl esters and styrene—yielding cyclopropane derivatives [22]).
2.1.2. Au(III)-2ppy* Compounds with Auxiliary Ligands Other Than Halides
In addition to [Au(2ppy*)Cl2], 92 Au(III)-2ppy* compounds with various auxiliary ligands (both organic and inorganic, but not halides), having the general formula [Au(2ppy*)L1L2] (in case of L1 = L2, i.e., identical L ligands: [Au(2ppy*)L2]) or [Au(2ppy*)(L1L2)] (in case of symmetrical LL ligands: [Au(2ppy*)(LL)]), as shown in Scheme 1 (left or right, respectively; for R1 = R2 = H), were reported and characterised by NMR spectroscopy and/or by single crystal X-ray diffraction [2,3,5,6,7,8,11,15,19,27,28,29,30,31,32,33,34,35,36,37,38,39,40,41,42,43,44,45,46,47,48,49,50]. They are listed (except for [Au(2ppy*)Cl2], shown in Table 1) in Table 2. In case when the sum of electric charges at auxiliary ligand(s) was different from −2 (0 or −1), the concerned Au(III)-2ppy* compound was cationic (+2 or +1 charge), and the relevant anion presented in a separate column Counterion; otherwise (the sum of electric charges at auxiliary ligand(s) being −2), the Au(III)-2ppy* molecule was electrically neutral.
Many these Au(III)-2ppy* compounds are biologically active, revealing anti-tumour properties (against various breast, cervix, colon, liver, lung, and ovarian cancers, as well as glioblastoma, leukemia, and melanoma) [3,8,9,11,28,31,33,43,51]. Some others have catalytic properties (in the hydration of alkynes to enoles [7] and photo-oxidation of benzylic amines to imines [42]). Then, a large number reveals luminescence, with lifetimes of either >10 µs [15,19,37,39,42] or <10 µs [15,27,38,41].
2.1.3. Au(III)-2PPY* Compounds with Auxiliary Ligands Other Than Halides
In addition to [Au(2PPY*)XY] (including [Au(2PPY*)X2]) and [Au(2ppy*)L1L2], including [Au(2ppy*)L2]) or [Au(2ppy*)(L1L2)], including [Au(2ppy*)(LL)]) compounds, 209 Au(III)-2PPY* species with various auxiliary ligands (other than halides)), having the general formulae [Au(2PPY*)L1L2] (in particular, [Au(2PPY*)L2]; L1, L2, L ≠ F, Cl, Br, I) or [Au(2PPY*)(L1L2)] (in particular, [Au(2PPY*)(LL)]) were reported and characterised by NMR spectroscopy and/or by single crystal X-ray diffraction [2,5,8,11,12,14,15,18,19,21,22,23,24,25,26,27,31,37,47,52,53,54,55,56,57,58,59,60,61,62,63,64,65,66,67,68,69,70,71,72,73,74,75,76]; this is the most general case presented in Scheme 1 (for 2PPY* ≠ 2ppy* and L1, L2 ≠ F, Cl, Br, I). They are listed (except for [Au(2PPY*)XY], [Au(2ppy*)L1L2] and [Au(2ppy*)(L1L2)], already shown in Table 1 and Table 2) in Table 3.
A total of 5 of them contained 2ppy* derivatives, substituted only in the pyridine ring (R1 = 3-methyl-, 5-n-butyl-, 4-tert-butyl-, 3,5-dimethyl-) [2,11], while 137—only in the phenyl ring (2- and 4-methyl-; 3-ethyl-; 3- and 4-n-butyl; 4-tert-butyl-; 3,5-dimethyl-; 4-fluoro-; 2,4- and 3,5-difluoro-; 3-, 4- and 5-trifluoromethyl; 4-methoxy-; 4-n-butoxy-; 2- and 4-trifluoromethoxy-; 4-formyl; 4-nitro-; 4-phenyl-; 3,5-bis(pentafluorophenyl)-), with a predominance of the 2-(4-methylphenyl)pyridine* ligand (95 species) [5,8,11,12,14,15,18,19,25,26,27,31,37,47,51,52,53,54,55,56,57,58,59,60,61,62,63,64,65,66].
Then, 67 had 2ppy* derivatives with substituents in both the pyridine and the phenyl ring (2,6-bis(4-tert-butylphenyl)pyridine*; 3-methyl-2-(2-fluorophenyl)pyridine*; 4- and 5-methyl-2-(4-methoxyphenyl)pyridine*; 6-methyl-2-(4-methylphenyl)pyridine*; 5-tert-butyl-2-(4-tert-butylphenyl)pyridine*; 4-trifluoromethyl-2-(4-methylphenyl)pyridine*; 5-trifluoromethyl-2-(4-methoxyphenyl)pyridine*; 5-trifluoromethyl-2-(2-diphenylaminophenyl)pyridine*; 3-, 4-, and 6-methoxy-2-(4-methylphenyl)pyridine*; 5-carboxy-2-(4-carboxyphenyl)pyridine*; 5-ethoxycarbonyl-(2-(4-ethoxycarbonylphenyl)pyridine*; 4-dimethylamino-2-(2,3,4-trifluorophenyl)pyridine*; 4-dimethylamino-2-(3-trifluoromethylphenyl)pyridine*; 4-dimethylamino-2-(4-trifluoromethoxyphenyl)pyridine*; 3-nitro-2-(4-methylphenyl)pyridine*) [21,22,23,24,37,53,67,68,69,70,71,72,73,74,75,76]. Among these ligands, 2,6-bis(4-tert-butylphenyl)pyridine* is especially interesting because 2,6-bis(4-tert-butylphenyl)pyridine can chelate transition metal ions, not only in the bidentate way (κ2-N(1),C(6′)*), but also in the tridentate mode (κ3-N(1),C(6′)*,C(6”)*)—forming Au(III)-(2,6-bis(4-tert-butylphenyl)pyridine**) pincer compounds (2,6-bis(4-tert-butylphenyl)pyridine** = dianionic form of 2,6-bis(4-tert-butylphenyl)pyridine, deprotonated in both phenyl groups at the ortho- carbons C(6′)* and C(6”)*); however, such molecules were not included in this review.
Table 3.
NMR and/or X-ray studied [Au(2PPY*)L1L2] (in particular, [Au(2PPY*)L2]) or [Au(2PPY*)(L1L2)] (in particular, [Au(2PPY*)(LL)]) compounds (2PPY* = a-R1-2-(b-R2-phenyl)pyridine*, other than 2ppy*, where R1 and R2 are substituents in the pyridine ring and the phenyl ring, respectively, a = 3–6, b = 2–5; L1, L2, L—monodentate ligands other than F, Cl, Br, I; L1L2, LL—bidentate ligands).
Table 3.
NMR and/or X-ray studied [Au(2PPY*)L1L2] (in particular, [Au(2PPY*)L2]) or [Au(2PPY*)(L1L2)] (in particular, [Au(2PPY*)(LL)]) compounds (2PPY* = a-R1-2-(b-R2-phenyl)pyridine*, other than 2ppy*, where R1 and R2 are substituents in the pyridine ring and the phenyl ring, respectively, a = 3–6, b = 2–5; L1, L2, L—monodentate ligands other than F, Cl, Br, I; L1L2, LL—bidentate ligands).
| R1 | R2 | L1 | L2 | L1L2 | Counterion | NMR Solvent | X-ray (CCDC) | Geometry | Activity $ |
|---|---|---|---|---|---|---|---|---|---|
| 3-methyl | H | 3-carboxy-2-thiolatepropionate | DMSO-d6 [2] | ||||||
| 3-methyl | H | pyridine | acetate | ClO4− | MAXQEH [2] | trans(N,N) | |||
| 5-n-butyl | H | diethylaminocarbodithioate | PF6− | DMSO-d6 [11] | BIO1 [11] | ||||
| 4-tert-butyl | H | acetate | acetate | CDCl3 DMSO-d6 [2] | |||||
| 3,5-dimethyl | H | acetate | acetate | CDCl3 [2] | |||||
| H | 2-methyl | phenyl | Br | JOTROB [12] | trans(C,N) | ||||
| H | 4-methyl | CN | CN | DMSO-d6 [27] | LUM2 [27] | ||||
| H | 4-methyl | methyl | methyl | CDCl3 CD2Cl2 [52,53] | QICNUN [52] | ||||
| H | 4-methyl | methyl | Cl | CD2Cl2 [54] | |||||
| H | 4-methyl | methyl | Br | CD2Cl2 [52,53] | |||||
| H | 4-methyl | ethyl | Br | CD2Cl2 [52] | |||||
| H | 4-methyl | allyl-η3 | (CF3SO2)2N− | CD2Cl2 [55] | ROVXUY [55] | ||||
| H | 4-methyl | allyl | Br | CD2Cl2 [53,55] | ROVYAF [55] | trans(C,N) | |||
| H | 4-methyl | allyl | trideuteroacetonitrile | (CF3SO2)2N− | CD3CN [55] | ||||
| H | 4-methyl | ethynyl | ethynyl | CD2Cl2 [56] | LUWJUL [56] | ||||
| H | 4-methyl | n-butylethynyl | n-butylethynyl | CD2Cl2 [56] | |||||
| H | 4-methyl | n-butylethynyl | Br | CD2Cl2 [56] | |||||
| H | 4-methyl | n-hexane-1,6-diethynyl | CD2Cl2 [56] | ||||||
| H | 4-methyl | thiacyclopentane | methyl | CF3SO3− | CD2Cl2 [54] | ||||
| H | 4-methyl | 1,4,7-trithiacyclononane-κ3-S,S,S | 2PF6− | CD3NO2 [5] | MOCFIV [5] | ||||
| H | 4-methyl | acetate | acetate | CDCl3 CD2Cl2 [31,53] | BIO1 [31] | ||||
| H | 4-methyl | acetate | methyl | CD2Cl2 [54] | IDAJII [54] a | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 CD3CN C6D6 CD3COOD CF3COOD [52,53,57] | QICPAV [52] | ||||
| H | 4-methyl | trifluoroacetate | hydroxymethyl | CD2Cl2 [58] | |||||
| H | 4-methyl | trifluoroacetate | methoxyl | CD2Cl2 CD3OD [58] | |||||
| H | 4-methyl | trifluoroacetate | methoxyethyl | CD2Cl2 CD3OD [58] | YIDHIF [58] | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | formylmethyl | CD2Cl2 [59] | QEFVUV [59] | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | acetate | CD2Cl2 [58] | |||||
| H | 4-methyl | trifluoroacetate | CH3OCH(CH(CH3)2)CH2− | CD2Cl2 [58] | YIDGIE [58] | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | CH3OC(CH3)(CH2CH3)CH2− | CD2Cl2 [58] | |||||
| H | 4-methyl | trifluoroacetate | CH3OC((CH3)2)CH(CH3)− | CD2Cl2 [58] | YIDHEB [58] | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | CH3OCH(CH2CH2CH2CH3)CH2− | CD2Cl2 [58] | YIDHAX [58] | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | CH3OCH(CH2CH2CH3)CH(CH3)− | CD2Cl2 [58] | YIDGOK [58] | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | CH3OCH(CH3)CH(CH2CH2CH3)− | CD2Cl2 [58] | YIDGAW [58] | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | CH3OCH(C6H5)CH2− | CD2Cl2 [58] | YIDGUQ [58] a | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | CH3CH2OCH2CH2− | CD2Cl2 CD3CD2OD [58] | |||||
| H | 4-methyl | trifluoroacetate | (CH3)2CHOCH2CH2− | CD2Cl2 [58] | |||||
| H | 4-methyl | trifluoroacetate | (CH3)3COCH2CH2− | CD2Cl2 [58] | |||||
| H | 4-methyl | trifluoroacetate | CH3COOCH2CH2− | CD2Cl2 CD3COOD [58] | YIDGEA [58] | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | CF3COOCH2CH2− | CD2Cl2 CF3COOD [57] | FUWXIG [57] | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | CF3CH2OCH2CH2− | CD2Cl2 CF3CD2OD [57] | FUWXOM [57] | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | CF3COOCH(CH(CH3)2)CH2− | CD2Cl2 [58] | YIDFUP [58] b | trans(C,N) | |||
| H | 4-methyl | trifluoroacetate | CF3COOCH(CH2CH2CH2CH3)CH2− | CD2Cl2 CF3COOD [58] | |||||
| H | 4-methyl | trifluoroacetate | CF3COOCH=CH− | CD2Cl2 [59] | QEFWAC [59] c | trans(C,N) | |||
| H | 4-methyl | trifluorosulfonate | methyl | CD2Cl2 [54] | IDAJOO [54] | trans(C,N) | |||
| H | 4-methyl | HNC(CH3)OCH2CH2− 1 | CF3COO− | CD2Cl2 CD3CN [60] | IPISEH [60] | trans(C,N) | |||
| H | 4-methyl | 1,1-dimethylbiguanidate | Cl− | DMSO-d6 [8] | BIO1 [8] | ||||
| H | 4-methyl | acetonitrile | methyl | BF4− | CD3CN [60] | IPISAD [60] | trans(C,N) | ||
| H | 4-methyl | trimethylsilylethynyl | trimethylsilylethynyl | CD2Cl2 [37,56] | LUWJEV [56] a | LUM1 [37] | |||
| H | 4-methyl | trimethylsilylethynyl | Br | CD2Cl2 [56] | |||||
| H | 4-methyl | trimethylsilylethynyl | ethynyl | CD2Cl2 [56] | LUWJIZ [56] | trans(HCC,N) | |||
| H | 4-methyl | oxybis(n-propylborinate) | CDCl3 [47] | ||||||
| H | 4-methyl | phenyl | phenyl | CD2Cl2 [14,52] | |||||
| H | 4-methyl | phenyl | Br | CD2Cl2 [52,53] | |||||
| H | 4-methyl | 2-methylphenyl | 2-methylphenyl | CD2Cl2 [14] | FONRIL [14] | ||||
| H | 4-methyl | 3-methylphenyl | 3-methylphenyl | CD2Cl2 [14] | |||||
| H | 4-methyl | phenylethynyl | phenylethynyl | CD2Cl2 [56] | LUWJOF [56] | ||||
| H | 4-methyl | phenylethynyl | Br | CD2Cl2 [56] | LUWKAS [56] | trans(C,N) | |||
| H | 4-methyl | phenylethynyl | ethynyl | CD2Cl2 [56] | LUWKIA [56] | trans(C6H5CC,N) | |||
| H | 4-methyl | phenylethynyl | trifluoroacetate | CD2Cl2 [56] | |||||
| H | 4-methyl | phenylethynyl | trimethylsilylethynyl | CD2Cl2 [56] | |||||
| H | 4-methyl | 4-n-butylphenylethynyl | 4-n-butylphenylethynyl | CD2Cl2 [37] | LUM1 [37] | ||||
| H | 4-methyl | naphth-2-yl | naphth-2-yl | CD2Cl2 [14] | |||||
| H | 4-methyl | naphth-1-yl | Cl | CD2Cl2 [14] | FONSAE [14] | trans(C,N) | |||
| H | 4-methyl | anthracen-2-yl | anthracen-2-yl | C6D6 [14] | |||||
| H | 4-methyl | 4-fluorophenyl | 4-fluorophenyl | CD2Cl2 [14] | FOPCAQ [14] | ||||
| H | 4-methyl | 4-fluorophenyl | Cl | CDCl3 [14] | FONRUX [14] | trans(C,N) | |||
| H | 4-methyl | 2,4-difluorophenyl | 2,4-difluorophenyl | CD2Cl2 [14] | |||||
| H | 4-methyl | 2,5-difluoro-3,6-dibromophenyl | 2,5-difluoro-3,6-dibromophenyl | CD2Cl2 [61] | |||||
| H | 4-methyl | 4-trifluoromethylphenyl | 4-trifluoromethylphenyl | CD2Cl2 [14] | FOPCEU [14] a | ||||
| H | 4-methyl | 4-chlorophenylethynyl | 4-chlorophenylethynyl | CD2Cl2 [61] | |||||
| H | 4-methyl | 4-methoxyphenyl | 4-methoxyphenyl | CD2Cl2 [14] | |||||
| H | 4-methyl | 4-methoxyphenylethynyl | 4-methoxyphenylethynyl | CDCl3 [37] | AJOXAZ [37] | LUM1 [37] | |||
| H | 4-methyl | 4-isopropoxyphenyl | 4-isopropoxyphenyl | C6D6 [14] | FONROR [14] | ||||
| H | 4-methyl | 4-formylbenzene-1,2-diolate | DMSO-d6 [62] | ||||||
| H | 4-methyl | 4-benzoxyphenyl | 4-benzoxyphenyl | CD2Cl2 [14] | |||||
| H | 4-methyl | 4-acetylphenyl | 4-acetylphenyl | CD2Cl2 [14] | |||||
| H | 4-methyl | acetophen-2,8-diyl | CD2Cl2 [14] | FONSEI [14] a | trans(CCH2,N) | ||||
| H | 4-methyl | anthracene-9,10-dione-1,2-diolate | DMSO-d6 solid phase [62] | ||||||
| H | 4-methyl | 3-ethoksycarbonylphenyl | 3-ethoksycarbonylphenyl | CD2Cl2 [14] | |||||
| H | 4-methyl | 2-thiolatebenzoate | ICUMEY [51] | trans(S,N) | BIO1 [51] | ||||
| H | 4-methyl | 1-phenylbiguanidate | Cl− | DMSO-d6 [8] | BIO1 [8] | ||||
| H | 4-methyl | L-phenylalaninate | Cl− | CDCl3 [31] | BIO1 [31] | ||||
| H | 4-methyl | L-methioninate | Cl− | CDCl3 [31] | BIO1 [31] | ||||
| H | 4-methyl | 3-nitrophenyl | 3-nitrophenyl | CD2Cl2 [14] | FOPCIY [14] | ||||
| H | 4-methyl | ethylene-1,2-bis(4-methylphenylsulfonylazanide) | unknown [63] | BIO1, BIO2 [63] | |||||
| H | 4-methyl | benzene-1,2-bis(acetylazanide) | unknown [63] | BIO1, BIO2 [63] | |||||
| H | 4-methyl | benzene-1,2-bis(4-methylphenylsulfonylazanide) | unknown [63] | BIO1, BIO2 [63] | |||||
| H | 4-methyl | sulfonebis(cyanomethyl) | BIO1 [64] | ||||||
| H | 4-methyl | sulfonebis(benzoylmethyl) | unknown [64] | BIO1 [64] | |||||
| H | 4-methyl | 1-benzothiophen-2-yl | 1-benzothiophen-2-yl | CD2Cl2 [14] | FONREH [14] | ||||
| H | 4-methyl | triphenylphosphine | methyl | CF3SO3− | CD2Cl2 [54] | IDAJUU [54] | trans(C,N) | ||
| H | 4-methyl | 1,2-bis(diphenylphosphino)benzene 2A | 2Cl− | CDCl3 [9] | BIO1 [9] | ||||
| H | 4-methyl | oxybis(phenylborinate) | CDCl3 [47,65] | CAT [65] | |||||
| H | 4-methyl | oxybis(naphth-1-ylborinate) | CDCl3 [47] | ||||||
| H | 4-methyl | oxybis(4-tert-butylphenylborinate) | CDCl3 [47] | ||||||
| H | 4-methyl | oxybis(4-vinylphenylborinate) | CDCl3 [47] | FUXGIQ [47] a | |||||
| H | 4-methyl | oxybis(4-isopropoxyphenylborinate) | CDCl3 [47] | FUXGAI [47] | |||||
| H | 4-methyl | oxybis(4-acetylphenylborinate) | CDCl3 [47] | FUXGOW [47] a | |||||
| H | 4-methyl | oxybis(thiophen-3-ylborinate) | CDCl3 [47] | ||||||
| H | 4-methyl | oxybis(ferrocenylborinate) | CDCl3 [47] | FUXGEM [47] d | |||||
| H | 3-ethyl | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | |||||
| H | 3-n-butyl | diethylaminocarbodithioate | PF6− | DMSO-d6 [11] | BIO1 [11] | ||||
| H | 4-n-butyl | diethylaminocarbodithioate | PF6− | DMSO-d6 [11] | BIO1 [11] | ||||
| H | 4-n-butyl | di(n-butyl)aminocarbodithioate | PF6− | DMSO-d6 [11] | BIO1 [11] | ||||
| H | 4-tert-butyl | dimethylaminocarbodithioate | PF6− | DMSO-d6 [26] | BIO1 [26] | ||||
| H | 4-tert-butyl | diethylaminocarbodithioate | PF6− | DMSO-d6 [26] | NIKHIB [26] e | BIO1 [26] | |||
| H | 4-tert-butyl | di(n-butyl)aminocarbodithioate | SbF6− | CD3CN [26] | BIO1 [26] | ||||
| H | 4-tert-butyl | (n-but-1,4-diyl)aminocarbodithioate | PF6− | CD2Cl2 [26] | BIO1 [26] | ||||
| H | 4-tert-butyl | N-(ethoxycarbonylmethyl)methylaminocarbodithioate | PF6− | DMSO-d6 [26] | BIO1 [26] | ||||
| H | 4-tert-butyl | 4-methoxyphenylethynyl | 4-methoxyphenylethynyl | CD2Cl2 [37] | LUM1 [37] | ||||
| H | 4-tert-butyl | benzene-1-olate-2-acetylazanide | CD2Cl2 [25] | BIO1 [25] | |||||
| H | 4-tert-butyl | benzene-1,2-bis(acetylazanide) | CD2Cl2 [25] | BIO1 [25] | |||||
| H | 4-tert-butyl | benzene-1-olate-2-(N-(acridin-9-yl))azanide | CD2Cl2 [25] | KIGPEY [25] a | trans(N,N) | BIO1 [25] | |||
| H | 4-tert-butyl | benzene-1-azanide-2-(N-(acridin-9-yl)azanide | CD2Cl2 [25] | KIGPIC [25] a | trans(NH,N) | BIO1 [25] | |||
| H | 4-tert-butyl | ortho-bis(dicarboranyl) | CD2Cl2 [66] | WUCKUD [66] a | |||||
| H | 3,5-dimethyl | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | JAZJED [53] | ||||
| H | 4-fluoro | 4-fluorophenyl | 4-fluorophenyl | CDCl3 [14] | |||||
| H | 4-fluoro | 3-ethoksycarbonylphenyl | 3-ethoksycarbonylphenyl | CDCl3 [14] | |||||
| H | 2,4-difluoro | phenylethynyl | phenylethynyl | CD2Cl2 [15] | LUM2 [15] | ||||
| H | 2,4-difluoro | methylenebis(3-n-butyl-1H-imidazol-1-yl-2-ylidene) | 2PF6− | CD3CN [19] | LUM1 [19] | ||||
| H | 2,4-difluoro | methylenebis(3-(3-sulfonate-n-propyl)-1H-imidazol-1-yl-2-ylidene) | D2O [19] | LUM1 [19] | |||||
| H | 3,5-difluoro | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | JAYZAO [53] | ||||
| H | 3-trifluoromethyl | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [18] | MIZHIP [18] | LUM2 [18] | |||
| H | 3-trifluoromethyl | pentafluorophenyl | Cl | CD2Cl2 [18] | MIZHEL [18] | trans(Cl,N) | LUM2 [18] | ||
| H | 3-trifluoromethyl | pentafluorophenyl | 4-fluorophenylethynyl | DMF-d7 [18] | MIZJAJ [18] | trans(CC,N) | LUM2 [18] | ||
| H | 3-trifluoromethyl | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | |||||
| H | 3-trifluoromethyl | 4-bis(2,4,6-trimethylphenyl)boranylphenylethynyl | pentafluorophenyl | DMSO-d6 [18] | MIYYAX [18] | trans(CC,N) | LUM2 [18] | ||
| H | 4-trifluoromethyl | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | JAZJAZ [53] | ||||
| H | 4-trifluoromethyl | diethylaminocarbodithioate | PF6− | DMSO-d6 [11] | BIO1 [11] | ||||
| H | 5-trifluoromethyl | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | |||||
| H | 4-methoxy | 4-methoxyphenylethynyl | 4-methoxyphenylethynyl | CD2Cl2 [37] | LUM1 [37] | ||||
| H | 4-methoxy | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | |||||
| H | 4-n-butoxy | diethylaminocarbodithioate | PF6− | DMSO-d6 [11] | BIO1 [11] | ||||
| H | 2-trifluoromethoxy | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [18] | MIYYEB [18] a | LUM2 [18] | |||
| H | 2-trifluoromethoxy | pentafluorophenyl | Cl | CD2Cl2 [18] | MIYXOK [18] | trans(Cl,N) | LUM2 [18] | ||
| H | 4-trifluoromethoxy | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [18] | MIZHOV [18] a | LUM2 [18] | |||
| H | 4-trifluoromethoxy | pentafluorophenyl | Cl | CD2Cl2 [18] | MIYXUQ [18] | trans(Cl,N) | LUM2 [18] | ||
| H | 4-formyl | 1,2-bis(diphenylphosphino)benzene 2B | 2Cl− | CDCl3 [9] | BIO1 [9] | ||||
| H | 4-nitro | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | JAZJON [53] | ||||
| H | 4-phenyl | methylenebis(3-n-butyl-1H-imidazol-1-yl-2-ylidene) | 2PF6− | CD3CN [19] | LUM1 [19] | ||||
| H | 3,5-bis(pentafluorophenyl) | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | JAZCOG [53] | ||||
| 5-tert-butyl | 4-tert-butyl | diethylaminocarbodithioate | BIO1 [26] | ||||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | norbornane-2-ol-3-yl | SbF6− | CD2Cl2 [67] | PEZQUI [67] | trans(C,N) | |||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | diethyl ether | Cl | H2N(B(C6F5)3)2− | CD2Cl2 [68] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | diethyl ether | methyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | diethyl ether | 2-methylallyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | diethyl ether | phenyl | H2N(B(C6F5)3)2− | CD2Cl2 [68] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | diethyl ether | 4-tert-butylphenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | diethyl ether | 4-fluorophenyl | H2N(B(C6F5)3)2− | CD2Cl2 [68] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | diethyl ether | pentafluorophenyl | H2N(B(C6F5)3)2− | CD2Cl2 [68] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | diethyl ether | 4-trifluoromethylphenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | diethyl ether | 4-chlorophenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | diethyl ether | 4-methoxyphenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | diethyl ether | 4-nitrophenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | dimethyl thioether | phenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | dimethyl thioether | 4-tert-butylphenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | dimethyl thioether | 4-fluorophenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | dimethyl thioether | pentafluorophenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | dimethyl thioether | 4-trifluoromethylphenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | dimethyl thioether | 4-chlorophenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | dimethyl thioether | 4-methoxyphenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | dimethyl thioether | 4-nitrophenyl | H2N(B(C6F5)3)2− | CD2Cl2 [69] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | methyl | µ-H 3 | H2N(B(C6F5)3)2− | CD2Cl2 [70] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | pentafluorophenyl | µ-H 3 | H2N(B(C6F5)3)2− | CD2Cl2 [70] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | H | µ-H 4 | H2N(B(C6F5)3)2− | CD2Cl2 [70] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | methyl | µ-H 4 | H2N(B(C6F5)3)2− | CD2Cl2 [70] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | pentafluorophenyl | H | CD2Cl2 [71] | |||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | pentafluorophenyl | triethylsilane | H2N(B(C6F5)3)2− | CD2Cl2 [71] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | pentafluorophenyl | 4,4,5,5-tetramethyl-1,3,2-dioxaborolane | H2N(B(C6F5)3)2− | CD2Cl2 [71] | ||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | adamantane-1-µ-thiolate 5 | adamantane-1-µ-thiolate 5 | H2N(B(C6F5)3)2− | CD2Cl2 [72] | FIDBUS [72] f | |||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | (CH3)3CCOCHCH3− | SbF6− | CD2Cl2 [73] | KEKGEP [73] a | trans(C,N) | |||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | CH3COCHC(CH3)3− | SbF6− | CD2Cl2 [73] | |||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | trifluoroacetate | methyl | CD2Cl2 [74] | |||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | trifluoroacetate | ethyl | CD2Cl2 [74] | |||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | 4-fluorophenyl | trifluoroacetate | CD2Cl2 [74] | QEZYAX [74] | trans(C,N) | |||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | pentafluorophenyl | trifluoroacetate | CD2Cl2 [74] | |||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | thiophen-2-yl | trifluoroacetate | CD2Cl2 [74] | |||||
| 6-(4-tert-butylphenyl) | 4-tert-butyl | dibenzopyrrolate | diethyl ether | H2N(B(C6F5)3)2− | CD2Cl2 [72] | ||||
| 3-methyl | 2-fluoro | methyl | F | CD2Cl2 [21] | DAJRUE [21] | trans(C,N) | |||
| 3-methyl | 2-fluoro | methyl | Br | CD2Cl2 [21] | |||||
| 3-methyl | 2-fluoro | trifluoroacetate | trifluoroacetate | CD2Cl2 [21] | |||||
| 3-methyl | 2-fluoro | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [21] | DAJSAL [21] g | ||||
| 3-methyl | 2-fluoro | 3,5-bis(trifluoromethyl)phenyl | F | CD2Cl2 [21] | DAJROY [21] | trans(C,N) | |||
| 3-methyl | 2-fluoro | 3,5-bis(trifluoromethyl)phenyl | Br | CD2Cl2 [21] | DAJRIS [21] | trans(C,N) | |||
| 3-methyl | 2-fluoro | 3,5-bis(trifluoromethyl)phenyl | 2,4,6-trifluorophenyl | CD2Cl2 [21] | DAJSEP [21] | trans(C3,5-bis(trifluoromethyl)phenyl,N) | |||
| 4-methyl | 4-methoxy | 4-methoxyphenylethynyl | 4-methoxyphenylethynyl | CD2Cl2 [37] | AJOXIH [37] a | LUM1 [37] | |||
| 5-methyl | 4-methoxy | 4-methoxyphenylethynyl | 4-methoxyphenylethynyl | CD2Cl2 [37] | AJOXED [37] a | LUM1 [37] | |||
| 6-methyl | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | JAZBOF [53] | ||||
| 4-trifluoromethyl | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | JAYZOC [53] a | ||||
| 5-trifluoromethyl | 4-methoxy | 4-methoxyphenylethynyl | 4-methoxyphenylethynyl | CD2Cl2 [37] | LUM1 [37] | ||||
| 5-trifluoromethyl | 2-diphenylamino | phenylethynyl | phenylethynyl | CDCl3 [75] | WECYUB [75] | LUM2 [75] | |||
| 3-methoxy | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | JAZKAA [53] | ||||
| 4-methoxy | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | JAYZIW [53] | ||||
| 6-methoxy | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | JAYYOB [53] a | ||||
| 5-carboxy | 4-carboxy | trifluoroacetate | trifluoroacetate | CD3CN DMSO-d6 [22] | GALBAA [22] h | CAT [22] | |||
| 5-carboxy | 4-carboxy | trifluorocarboxylethyl | Cl | DMSO-d6 [23] | |||||
| 5-carboxy | 4-carboxy | trifluorocarboxylethyl | Br | DMSO-d6 [23] | |||||
| 5-carboxy | 4-carboxy | trifluorocarboxylethyl | trifluoroacetate | DMSO-d6 [23] | |||||
| 5-ethoxycarbonyl | 4-ethoxycarbonyl | N3 | N3 | PUXGUN [76] | |||||
| 5-ethoxycarbonyl | 4-ethoxycarbonyl | trifluoroacetate | trifluoroacetate | CD2Cl2 DMSO-d6 [22] | GALBEE [22] | CAT [22] | |||
| 5-ethoxycarbonyl | 4-ethoxycarbonyl | trifluorocarboxylethyl | Cl | CD2Cl2 DMSO-d6 [23] | |||||
| 5-ethoxycarbonyl | 4-ethoxycarbonyl | trifluorocarboxylethyl | Br | CD2Cl2 DMSO-d6 [23] | |||||
| 5-ethoxycarbonyl | 4-ethoxycarbonyl | trifluorocarboxylethyl | trifluoroacetate | DMSO-d6 [23] | |||||
| 4-dimethylamino | 2,3,4-trifluoro | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [24] | WASQOZ [24] | LUM2 [24] | |||
| 4-dimethylamino | 3-trifluoromethyl | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [24] | LUM2 [24] | ||||
| 4-dimethylamino | 3-trifluoromethyl | 4-fluorophenylethynyl | 4-fluorophenylethy+nyl | CD2Cl2 [24] | LUM2 [24] | ||||
| 4-dimethylamino | 4-trifluoromethoxy | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [24] | LUM2 [24] | ||||
| 3-nitro | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 [53] | JAZBIZ [53] a |
$ Types of activity: BIO—biological (BIO1—anti-tumour, BIO2—anti-microbial, i.e., anti-bacterial and/or anti-fungal); CAT—catalytic; LUM—luminescence (LUM1—with t > 10 µs; LUM2—with t < 10 µs). 1 This monoanionic HNC(CH3)OCH2CH2− ligand chelates Au(III) by imine =NH nitrogen and terminal CH2 carbon. 2A–2B It is unclear whether these compounds should be regarded as [Au(2PPY*)(1,2-bis(diphenylphosphino)benzene)]Cl2 (2PPY = 2-(4-methylphenyl)pyridine for 2A, 2-(4-formylphenyl)pyridine for 2B), or rather [Au(2PPY$)(1,2-bis(diphenylphosphino)benzene)Cl]Cl (2PPY$ = monoanionic form of 2PPY, deprotonated and binding monodentately by C(2′)). 3 These are dimeric compounds, in which both [Au(2,6-bis(4-tert-butylphenyl)pyridine*)R] (R = CH3, C6F5) moieties are linked by a hydride ligand, with formation of the Au-H-Au bridge. 4 These are dimeric compounds, in which the [Au(2,6-bis(4-tert-butylphenyl)pyridine*)R] (R = H, CH3) and [Au(2,6-bis(4-tert-butylphenyl)pyridine**)] moieties are linked by a hydride ligand, with formation of the Au-H-Au bridge. 5 This is a dimeric compound, in which both [Au(2,6-bis(4-tert-butylphenyl)pyridine*)] moieties are linked by two adamantane-1-thiolate ligands, with formation of two Au-S-Au bridges. a dichloromethane solvate. b chloroform solvate. c dichloromethane n-pentane solvate. d toluene solvate. e acetonitrile solvate. f dihydrate. g trihydrate. h trifluoroacetic acid solvate.
Many these Au(III)-2PPY* compounds are biologically active, revealing anti-tumour (against various breast, cervix, colon, liver, lung, mammary, and ovarian cancers, as well as glioblastoma, leukemia, and melanoma) [8,9,11,25,26,31,51,63,64], as well as anti-bacterial (against Escherichia coli, Bacillus subtilis, and Pseudomonas aeruginosa) and anti-fungal (against Candida albicans, Trichophyton mentagrophytes, and Cladosporium resinae) [63] properties. Some others have catalytic activity (in reactions between propargyl esters and styrene—yielding cyclopropane derivatives [22] and upon CO oxidation by air to CO2 [65]). Then, a number of these species exhibits luminescence, with lifetimes of either >10 µs [19,37] or <10 µs [15,18,24,27,75].
2.2. Au(III)-2ArPY* Compounds
2.2.1. Au(III)-2ArPY* Dihalides
A total of 68 Au(III) dihalides with 2-arylpyridines*, other than 2PPY* (denoted as 2ArPY*), having the general formula [Au(2ArPY*)X2] (X = F, Cl, Br, I), were reported and characterised by NMR spectroscopy and/or by single crystal X-ray diffraction [6,9,13,16,17,18,19,30,33,40,62,77,78,79,80,81,82,83,84,85,86,87,88,89,90]. They are listed in Table 4 (by definition, it does not include [Au(2PPY*)X2] species, shown in Table 1).
The contained 2ArPY* ligands are of two principal types: (A) containing a bridge (denoted as Z) between the pyridine and the phenyl ring (–CH2– in 2-benzylpyridine*, –CO– in 2-benzoylpyridine*, –O– in 2-phenoxypyridine*, –S– in 2-phenylsulfanylpyridine*, –NH– in 2-anilinopyridine*; Scheme 2) and (B) having the pyridine ring linked to any aryl (but not phenyl) ring system (naphth-2-yl, 9,9-dialkylfluoren-2-yl, dibenzofuran-4-yl; Scheme 3).
There are 61 [Au(2ArPY*)X2] molecules with 2ArPY* ligands of type A [9,13,16,17,18,30,33,40,62,77,78,79,80,81,82,83,84,85,86,87,88,89] (including 8 compounds having one or two substituents at the Z bridge, with this position being numbered as 1 of the aryl moiety: –CH2– (6 species with 2ArPY* = 2-(1-methylbenzyl)pyridine*, 2-(1,1-dimethylbenzyl)pyridine*, 2-(1-methoxybenzyl)pyridine*, 2-(1-phenylbenzyl)pyridine*, 2-(1-carboxymethoxyiminobenzyl)pyridine* and 2-(1-benzoxyiminobenzyl)pyridine*) [17,77,83,84], or –NH– (2 species with 2ArPY* = 2-(1-methylanilino)pyridine* and 2-(1-propionylanilino)pyridine*) [40,83,89]), as well as 7 [Au(2ArPY*)X2] molecules with 2ArPY* ligands of the type B [6,19,90].
Then, the [Au(2ArPY*)X2] compounds with 2ArPY* of type A can be divided for those containing unsubstituted pyridine and phenyl rings (16 species) [9,13,16,17,18,30,33,40,62,77,78,79,80,81,82,83,84,85,86,87,89], substituted pyridine rings and unsubstituted phenyl rings (32 species) [83,88], as well as unsubstituted pyridine rings and substituted phenyl rings (13 species) [17,83,89], whereas those with simultaneously substituted pyridine and phenyl rings are absent. Similarly, the [Au(2ArPY*)X2] compounds with 2ArPY* of the type B can be divided for these having no substituents in the pyridine and aryl ring (four species) [6,19,90], having substituents in the pyridine ring only (two species) [6,90] or in the aryl ring only (one species) [90], but not in both rings. Furthermore, if treating [Au(2ArPY*)X2] molecules with 2ArPY* of the types A and B together, 20 has no substituents in both ring systems [6,9,13,16,17,18,19,30,33,40,62,77,78,79,80,81,82,83,84,85,86,87,89,90], while 48 is substituted either in the pyridine ring (34 examples) [6,83,88,90] or in the aryl ring (14 examples) [17,83,89,90].
Table 4.
NMR and/or X-ray studied [Au(2ArPY*)X2] compounds (2ArPY* ≠ 2PPY*; X = F, Cl, Br, I); R1 and R2 are substituents in the pyridine ring and the aryl ring, respectively.
Table 4.
NMR and/or X-ray studied [Au(2ArPY*)X2] compounds (2ArPY* ≠ 2PPY*; X = F, Cl, Br, I); R1 and R2 are substituents in the pyridine ring and the aryl ring, respectively.
| Parent 2ArPY* Ring System | R1 | R2 | X | NMR Solvent | X-ray (CCDC) | Activity $ |
|---|---|---|---|---|---|---|
| 2ArPy* ligands of type A (Scheme 2) | ||||||
| 2-benzylpyridine* | H | H | Cl | CDCl3 CD2Cl2 CD3CN CD3COCD3 DMSO-d6 [9,13,18,33,62,77,78,79,80,81,82] | HOSHEE [16] | BIO1 [25,79,83] CAT [16,17] |
| 3-methyl | H | Cl | DMSO-d6 [83] | |||
| 4-methyl | H | Cl | DMSO-d6 [83] | |||
| 5-methyl | H | Cl | CD2Cl2 [83] | |||
| 6-methyl | H | Cl | DMSO-d6 [83] | |||
| 3-methoxy | H | Cl | DMSO-d6 [83] | |||
| 6-methoxy | H | Cl | CD2Cl2 [83] | |||
| 3-isopropoxy | H | Cl | CD2Cl2 [83] | |||
| 3-n-butoxy | H | Cl | CD2Cl2 [83] | |||
| 3-acetomethoxy | H | Cl | CD2Cl2 [83] | |||
| H | 2-methyl | Cl | CD2Cl2 [83] | |||
| H | 3-methyl | Cl | DMSO-d6 [83] | |||
| H | 4-methyl | Cl | DMSO-d6 [83] | |||
| H | 4-ethyl | Cl | DMSO-d6 [83] | |||
| H | 4-n-butyl | Cl | CD2Cl2 [83] | |||
| H | 4-tert-butyl | Cl | CDCl3 [17] | CAT [17] | ||
| H | 4-n-hexyl | Cl | CD2Cl2 [83] | |||
| H | 4-chloro | Cl | DMSO-d6 [83] | |||
| H | 2-methoxy | Cl | DMSO-d6 [83] | |||
| H | 4-phenyl | Cl | CD2Cl2 [83] | |||
| H | 4-benzyl | Cl | CD2Cl2 [83] | |||
| 2-(1-methylbenzyl)pyridine* | H | H | Cl | CDCl3 DMSO-d6 [77] | R/S 1 | CAT [17] |
| 2-(1,1-dimethylbenzyl)pyridine* | H | H | Cl | CD2Cl2 [77] | ZETYAY [77] | |
| 2-(1-methoxybenzyl)pyridine* | H | H | Cl | DMSO-d6 [17] | CAT [17] | |
| 2-(1-phenylbenzyl)pyridine* | H | H | Cl | DMSO-d6 [83] | ||
| 2-(1-carboxymethoxyiminobenzyl)pyridine* | H | H | Cl | DMSO-d6 [84] | ||
| 2-(1-benzoxyiminobenzyl)pyridine* | H | H | Cl | DMSO-d6 [17] | CAT [17] | |
| 2-benzoylpyridine* | H | H | Cl | CD2Cl2 CD3CN DMSO-d6 [9,17,18,33,81,83,84,85,86] | PUKYAV [85] | BIO1 [30] CAT [17] |
| H | H | Br | DMSO-d6 [30] | AZOKOS [30] | ||
| H | H | I | DMSO-d6 [30] | |||
| 2-phenoxypyridine* | H | H | Cl | DMSO-d6 [9,87] | FIJZIH [87] | BIO1 [83] CAT [17] |
| 4-methyl | H | Cl | DMSO-d6 [88] | |||
| 5-methyl | H | Cl | DMSO-d6 [88] | |||
| 6-methyl | H | Cl | CD2Cl2 [88] | |||
| 5-ethyl | H | Cl | DMSO-d6 [88] | |||
| 5-n-propyl | H | Cl | DMSO-d6 [88] | |||
| 5-n-butyl | H | Cl | CD2Cl2 [88] | |||
| 5-fluoro | H | Cl | DMSO-d6 [88] | |||
| 5-chloro | H | Cl | DMSO-d6 [88] | |||
| 5-bromo | H | Cl | DMSO-d6 [88] | |||
| 5-iodo | H | Cl | DMSO-d6 [88] | |||
| 5-methoxy | H | Cl | CD2Cl2 [83] | |||
| 5-methoxycarbonyl | H | Cl | CD2Cl2 [88] | |||
| 5-(2-methoxycarbonylethyl) | H | Cl | CDCl3 [88] | |||
| 5-(3-acetoxy-n-propyl) | H | Cl | CD2Cl2 [88] | |||
| 5-aminocarbonyl | H | Cl | DMSO-d6 [88] | |||
| 5-methylaminocarbonyl | H | Cl | DMSO-d6 [88] | |||
| 5-dimethylaminocarbonyl | H | Cl | DMSO-d6 [88] | |||
| 5-cyclopentylaminocarbonyl | H | Cl | DMSO-d6 [88] | KAGYIB [88] | ||
| 5-acetamido | H | Cl | DMSO-d6 [88] | |||
| 5-(3-cyano-n-propyl) | H | Cl | CDCl3 [88] | |||
| 5-phenyl | H | Cl | DMSO-d6 [88] | |||
| 5-benzyl | H | Cl | CD2Cl2 [83] | |||
| 5-benzamido | H | Cl | DMSO-d6 [88] | |||
| H | 4-tert-butyl | Cl | CDCl3 [17] | IFUQUX [17] | ||
| 2-phenylsulfanylpyridine* | H | H | Cl | DMSO-d6 [87] | FIKNOC [87] | BIO1 [83] |
| 2-anilinopyridine* | H | H | Cl | DMSO-d6 [9,18,87,89] | PUGMAF [89] | BIO1 [83] |
| H | H | Br | DMSO-d6 [89] | |||
| H | 4-methyl | Cl | DMSO-d6 [89] | |||
| 2-(1-methylanilino)pyridine* | H | H | Cl | DMSO-d6 [83,89] | ||
| 2-(1-propionylanilino)pyridine* | H | H | Cl | CDCl3 [40] | ||
| 2ArPy* ligands of type B (Scheme 3) | ||||||
| 2-(naphth-2-yl)pyridine* | H | H | Cl | DMSO-d6 [19] | ||
| 2-(9,9-dimethylfluoren-2-yl)pyridine* | H | H | Cl | DMSO-d6 [6,90] | ||
| 4-methyl | H | Cl | CD2Cl2 [90] | |||
| 4-dimethylamino | H | Cl | CD2Cl2 [6,90] | |||
| H | 7-trifluoromethyl | Cl | CD2Cl2 [90] | |||
| 2-(9,9-di(n-butyl)fluoren-2-yl)pyridine* | H | H | Cl | DMSO-d6 [19] | ||
| 2-(dibenzofuran-4-yl)pyridine* | H | H | Cl | DMSO-d6 [6] | ||
$ Types of activity: BIO—biological (BIO1—anti-tumour, BIO2—anti-microbial, i.e., anti-bacterial and/or anti-fungal); CAT—catalytic; LUM—luminescence (LUM1—with t > 10 µs, LUM2—with t < 10 µs). 1 This compound appears in two isomeric forms, i.e., enantiomers R/S.
A few [Au(2ArPY*)Cl2] compounds are biologically active, revealing anti-tumour properties (against various breast, colon, kidney, lung, mammary, ovarian, pancreas, and prostate and uterus cancers, as well as leukemia) [25,30,79,83]. Some others exhibit catalytic activity (in reactions between alkynes, carbonyl compounds, and amines or imines—yielding amines, allenes, or oxazoles) [16,17].
2.2.2. Au(III)-2ArPY* Compounds with Auxiliary Ligands Other Than Halides
In addition to [Au(2ArPY*)X2] dihalides, 108 Au(III)-2ArPY* compounds (2ArPY* ≠ 2PPY*) with various auxiliary ligands (other than halides), having the general formula [Au(2ArPY*)L1L2] (particularly [Au(2ArPY*)L2]) or [Au(2ArPY*)(L1L2)]) (particularly [Au(2ArPY*)(LL)]) were reported and characterised by NMR spectroscopy and/or by single crystal X-ray diffraction [6,9,14,18,19,25,30,31,33,39,40,45,51,62,63,64,75,77,79,82,85,87,89,90,91,92,93,94,95,96,97,98,99,100,101,102]. These species correspond to the most general case presented in Scheme 2 and Scheme 3 (for L1, L2 ≠ F, Cl, Br, I), being listed in Table 5 (by definition, it does not include the Au(III)-2ppy* and Au(III)-2PPY* molecules, shown in Table 2 and Table 3). A total of 88 molecules have 2ArPY* ligands of the type A [9,14,18,25,30,31,33,40,45,51,62,63,64,77,79,82,85,87,89,91,92,93,94,95,96,97,98,99,100,101], while 20 have 2ArPY* ligands of the type B [6,19,39,75,90,102].
As many as 97 Au(III)-2ArPY* compounds contain unsubstituted (or substituted only at the Z bridge) 2ArPY* ligands [6,9,14,18,19,25,30,31,33,39,40,45,51,62,63,64,77,79,82,85,87,89,90,91,92,93,94,95,96,97,98,99,100,101,102] (all 88 molecules with 2ArPY* of the type A [9,14,18,25,30,31,33,40,45,51,62,63,64,77,79,82,85,87,89,91,92,93,94,95,96,97,98,99,100,101], including the predominant 2-benzylpyridine*—52 species and 9 molecules of the type B [6,19,39,90,102]).
In contrast, there are only 11 Au(III)-2ArPY* compounds with substituent(s) in the 2ArPY* ring system (except for those at the Z bridge). All these molecules are with 2ArPY* ligands of the type B [6,75,90], and eight are substituted in the pyridine ring only [6,75,90]; 1—in the aryl ring only [90], and 2—in both rings [75].
Table 5.
NMR and/or X-ray studied [Au(2ArPY*)L1L2] (in particular, [Au(2ArPY*)L2]) or [Au(2ArPY*)(L1L2)]) (in particular, [Au(2ArPY*)(LL)]) compounds (2ArPY* ≠ 2PPY*; L1, L2, L—monodentate ligands other than F, Cl, Br, I; L1L2, LL—bidentate ligands); R1 and R2 are substituents in the pyridine ring and the aryl ring, respectively.
Table 5.
NMR and/or X-ray studied [Au(2ArPY*)L1L2] (in particular, [Au(2ArPY*)L2]) or [Au(2ArPY*)(L1L2)]) (in particular, [Au(2ArPY*)(LL)]) compounds (2ArPY* ≠ 2PPY*; L1, L2, L—monodentate ligands other than F, Cl, Br, I; L1L2, LL—bidentate ligands); R1 and R2 are substituents in the pyridine ring and the aryl ring, respectively.
| Parent 2ArPY* Ring System | R1 | R2 | L1 | L2 | L1L2 | Counterion | NMR Solvent | X-ray (CCDC) | Geometry | Activity $ |
|---|---|---|---|---|---|---|---|---|---|---|
| 2ArPy* ligands of type A (Scheme 2) | ||||||||||
| 2-benzylpyridine* | H | H | acetate | acetate | CDCl3 [31,91] | BIO1 [31] | ||||
| H | H | 1R,2R-cyclohexane-1,2-diamine | 2Cl− 2ClO4− 2BF4− | DMSO-d6 [92] DMSO-d6 [92] DMSO-d6 [92] | TOFDUQ [92] TOFFAY [92] a | BIO1 [92] | ||||
| H | H | dimethylaminocarbodithioate | PF6− | CD3CN [93] | RADKOA [93] | BIO1 [93] | ||||
| H | H | diethylaminocarbodithioate | PF6− | CD3CN [93] | RADLER [93] | BIO1 [93] | ||||
| H | H | azacyclohexane-1-carbodithioate | PF6− | CD3CN [93] | RADLAN [93] | BIO1 [93] | ||||
| H | H | 4-(4-bromophenyl)-1,4-diazacyclohexane-1-carbodithioate | PF6− | CD3CN [93] | BIO1 [93] | |||||
| H | H | 4-(4-methoxyphenyl)-1,4-diazacyclohexane-1-carbodithioate | PF6− | CD3CN [93] | RADKUG [93] b | BIO1 [93] | ||||
| H | H | 4-ethoxycarbonylazacyclohexane-1-carbodithioate | PF6− | DMSO-d6 [82] | OVIKOW [82] | BIO1 [82] | ||||
| H | H | 4-aminocarbonylazacyclohexane-1-carbodithioate | PF6− | DMSO-d6 [82] | OVILAJ [82] OVIKUC [82] c | BIO1 [82] | ||||
| H | H | 1,1-dimethylbiguanidate | PF6− | DMSO-d6 [33] | CEWGUK [33] | BIO1 [33] | ||||
| H | H | 1,2-bis(ethylimine)ethane-1,2-dithiolate | CDCl3 [94] | |||||||
| H | H | phenylethynyl | phenylethynyl | CD3COCD3 [95] | ||||||
| H | H | phenylethynyl | Cl | CD3COCD3 [95] | ECEGOM [95] ECEGOM 01 [95] | trans(C,N) | ||||
| H | H | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [18] | MIYXIE [18] | LUM2 [18] | ||||
| H | H | 4-trifluoromethylphenyl | 4-trifluoromethylphenyl | CDCl3 [14] | ||||||
| H | H | benzene-1,2-diolate | CDCl3 [96] | BIO1, BIO2 [96] | ||||||
| H | H | anthracene-9,10-dione-1,2-diolate | DMSO-d6 solid phase [62] | |||||||
| H | H | 1,1′-binaphthyl-2-one-2′-olate-1-yl | CDCl3 [45] | R/S 1 | ||||||
| H | H | 2-thiolatebenzoate | CDCl3 [51] | BIO1 [51] | ||||||
| H | H | 3-ethoksycarbonylphenyl | 3-ethoksycarbonylphenyl | CDCl3 [14] | ||||||
| H | H | benzene-1-olate-2-acetylazanide | CDCl3 [96] | BAZSEB [96] | trans(N,N) | BIO1, BIO2 [25,96] | ||||
| H | H | ethylene-1,2-bis(4-methylphenylsulfonylazanide) | unknown [63] | BIO1, BIO2 [63] | ||||||
| H | H | benzene-1,2-bis(acetylazanide) | unknown [63] | XEWBOR [63] | BIO1, BIO2 [63] | |||||
| H | H | benzene-1,2-bis(4-methylphenylsulfonylazanide) | unknown [63] | BIO1, BIO2 [63] | ||||||
| H | H | 1-acetamidobenzene-2-acetylazanide | Cl | XEWBUX [63] | trans(N,N) | |||||
| H | H | benzene-1-olate-2-(N-(acridin-9-yl))azanide | CD2Cl2 [25] | BIO1 [25] | ||||||
| H | H | isatinate | isatinate | CDCl3 [97] | BIO1, BIO2 [97] | |||||
| H | H | phtalimidate | phtalimidate | CDCl3 [97] | SEVDON [97] d | BIO1, BIO2 [97] | ||||
| H | H | saccharinate | saccharinate | CDCl3 [97] | SEVDUT [97] e | BIO1, BIO2 [97] | ||||
| H | H | L-phenylalaninate | Cl− | CDCl3 [31] | BIO1 [31] | |||||
| H | H | sulfonebis(cyanomethyl) | BIO1 [64] | |||||||
| H | H | sulfonebis(benzoylmethyl) | unknown [64] | BIO1 [64] | ||||||
| H | H | benzoylmethyl benzoyl(2-(tert-butylamino)ethyl) sulfone | unknown [64] | DEFGUR [64] | BIO1 [64] | |||||
| H | H | 4-methylphenylsulfonyliminocarbo(phenylazanide)thiolate | CDCl3 [98] | |||||||
| H | H | 4-nitrophenylazanide | acetate | CDCl3 [91] | ||||||
| H | H | thiophen-2-yl | thiophen-2-yl | CD2Cl2 [95] | ECEGAY [95] | |||||
| H | H | 2,5-bis(ethoxycarbonyl)thiophen-3,4-diolate | CDCl3 [96] | BIO1, BIO2 [96] | ||||||
| H | H | phenyliminocarbo(pyrrol-5-yl-1-ate)thiolate | CDCl3 [99] | |||||||
| H | H | phenyliminocarbo(2,4-dimethylpyrrol-5-yl-1-ate)thiolate | CDCl3 [99] | FUJHUQ [99] d | trans(S,N) | |||||
| H | H | phenyliminocarbo(2,4-dimethyl-3-ethylpyrrol-5-yl-1-ate)thiolate | CDCl3 [99] | |||||||
| H | H | 4-nitrophenyliminocarbo(pyrrol-5-yl-1-ate)thiolate | CDCl3 [99] | BIO1 [99] | ||||||
| H | H | 4-nitrophenyliminocarbo(2,4-dimethylpyrrol-5-yl-1-ate)thiolate | CDCl3 [99] | |||||||
| H | H | 4-nitrophenyliminocarbo(2,4-dimethyl-3-ethylpyrrol-5-yl-1-ate)thiolate | CDCl3 [99] | |||||||
| H | H | 2-(4-aminophenylsulfonamido)thiazol-3-yl | DMSO-d6 [97] | |||||||
| H | H | 2,2′-bipyridine | CD3CN [100] | |||||||
| H | H | 1,10-phenanthroline | CD3CN [100] | |||||||
| H | H | triphenylphosphine | Cl | BF4− Cl− | CDCl3 CD2Cl2 DMSO-d6 [77,85] | PUKYEZ [85] d | trans(P,N) | |||
| H | H | 1,2-bis(diphenylphosphino)ethane | 2BF4− | CD2Cl2 [77] | ||||||
| H | H | 1,2-bis(diphenylphosphino)benzene 2A | 2Cl− | CDCl3 [9] | USEDOO [9] 3A,f | BIO1 [9] | ||||
| H | H | 1,3,5-triazaphosphaadamantane | Cl | PF6− | CD3COCD3 [79] | QUMZIJ [79] g | trans(P,N) | BIO1 [79] | ||
| H | H | 1,2,3,4-tetraacetyl-6-thioglucose-6-yl | Cl | CD3COCD3 [79] | BIO1 [79] | |||||
| H | H | 1,2,3,4-tetraacetyl-6-thioglucose-6-yl | 1,2,3,4-tetraacetyl-6-thioglucose-6-yl | CD3COCD3 [79] | BIO1 [79] | |||||
| 2-(1-methylbenzyl)pyridine* | H | H | triphenylph osphine | Cl | BF4− | CDCl3 [77] | R/S 1 | |||
| H | H | 1,2-bis(diphenylphosphino)ethane | 2BF4− | CD2Cl2 [77] | R/S 1 | |||||
| 2-(1,1-dimethylbenzyl)pyridine* | H | H | triphenylphosphine | Cl | BF4− | CDCl3 [77] | ||||
| 2-benzoylpyridine* | H | H | 2-benzoylpyridine* | BF4− | DMSO-d6 [85] | |||||
| H | H | SCN | SCN | DMSO-d6 [30] | ||||||
| H | H | N3 | N3 | DMSO-d6 [30] | AZOLAF [30] | |||||
| H | H | n-pentane-2,4-dione-3-yl | Cl | CDCl3 [30] | ||||||
| H | H | dimethylaminocarbodithioate | PF6− | CD3CN [93] | BIO1 [93] | |||||
| H | H | diethylaminocarbodithioate | PF6− | CD3CN [93] | BIO1 [93] | |||||
| H | H | azacyclohexane-1-carbodithioate | PF6− | CD3CN [93] | RADLIV [93] | BIO1 [93] | ||||
| H | H | 4-(4-bromophenyl)-1,4-diazacyclohexane-1-carbodithioate | PF6− | CD3CN [93] | BIO1 [93] | |||||
| H | H | 4-(4-methoxyphenyl)-1,4-diazacyclohexane-1-carbodithioate | PF6− | CD3CN [93] | BIO1 [93] | |||||
| H | H | 1,1-dimethylbiguanidate | PF6− | DMSO-d6 [33] | BIO1 [33] | |||||
| H | H | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [18] | MIYXEA [18] | LUM2 [18] | ||||
| H | H | 1,1′-binaphthyl-2-one-2′-olate-1-yl | CDCl3 [45] | R/S 1 | ||||||
| H | H | 1,2-bis(diphenylphosphino)benzene 2B | 2Cl− | CDCl3 [9] | USEDII [9] 3B | BIO1 [9] | ||||
| 2-phenoxypyridine* | H | H | 4-fluorophenylethynyl | 4-fluorophenylethynyl | CDCl3 CD3CN [40] | |||||
| H | H | 1,1′-binaphthyl-2-one-2′-olate-1-yl | CDCl3 [45] | R/S 1 | ||||||
| H | H | 1,2-bis(diphenylphosphino)benzene 2C | 2Cl− | CDCl3 [9] | USEDEE [9] 3C,h | BIO1 [9] | ||||
| 2-anilinopyridine* | H | H | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [18] | MIZHUB [18] d | LUM2 [18] | |||
| H | H | benzene-1,2-diolate | CDCl3 [96] | BIO1, BIO2 [96] | ||||||
| H | H | 3,5-di(tert-butyl)benzene-1,2-diolate | BIO [96] | |||||||
| H | H | 2-thiolatebenzoate | CDCl3 [51] | BIO1 [51] | ||||||
| H | H | 3-ethoksycarbonylphenyl | 3-ethoksycarbonylphenyl | CDCl3 [14] | ||||||
| H | H | anthracene-9,10-dione-1,2-diolate | DMSO-d6 solid phase [62] | |||||||
| H | H | 1,1′-binaphthyl-2-one-2′-olate-1-yl | CDCl3 [45] | R/S 1 | ||||||
| H | H | sulfonebis(benzoylmethyl) | unknown [64] | BIO1 [64] | ||||||
| H | H | ethylene-1,2-bis(4-methylphenylsulfonylazanide) | unknown [63] | BIO1, BIO2 [63] | ||||||
| H | H | benzene-1,2-bis(acetylazanide) | BIO1, BIO2 [63] | |||||||
| H | H | benzene-1,2-bis(4-methylphenylsulfonylazanide) | unknown [63] | BIO1, BIO2 [63] | ||||||
| H | H | dimethyliminocarbo(phenylazanide)thiolate | B(C6H5)4− | DMSO-d6 [101] | MIRLIK [101] | trans(S,N) | ||||
| H | H | dicyclohexyliminocarbo(phenylazanide)thiolate | B(C6H5)4− | DMSO-d6 [101] | MIRLOQ [101] | trans(S,N) | ||||
| H | H | oxydiethyliminocarbo(phenylazanide)thiolate | B(C6H5)4− | DMSO-d6 [101] | ||||||
| H | H | triphenylphosphine | Cl | BF4− | DMSO-d6 [87] | FIKQAR [87] | trans(P,N) | |||
| H | H | tris(4-methylphenyl)phosphine | Cl | Cl− | CDCl3 [89] | |||||
| H | H | 1,2-bis(diphenylphosphino)benzene 2D | 2Cl− | CDCl3 [9] | USEDUU [9] 3D | BIO1 [9] | ||||
| 2ArPy* ligands of type B (Scheme 3) | ||||||||||
| 2-(naphth-2-yl)pyridine* | H | H | methylenebis(3-n-butyl-1H-imidazol-1-yl-2-ylidene) | 2PF6− | CD3CN [19] | LUM1 [19] | ||||
| 2-(9,9-dimethylfluoren-2-yl)pyridine* | H | H | bis(2-acetylidephenyl)acetylene | CD2Cl2 [39] | LUM1 [39] | |||||
| H | H | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [90] | MEDPOD [90] i | LUM1 [90] | ||||
| H | H | 3,3′-bis(trifluoromethyl)-5,5′-bipyrazolate | DMSO-d6 [6] | |||||||
| H | H | 1,1-dimethylmethylenebis(3-trifluoromethylpyrazol-5-ylate) | CD2Cl2 [6] | QOCBES [6] j | LUM1 [6] | |||||
| 4-methyl | H | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [90] | MEDPIX [90] k | LUM1 [90] | ||||
| 4-dimethylamino | H | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [90] | MEDPAP [90] | LUM1 [90] | ||||
| 4-dimethylamino | H | 1,1-dimethylmethylenebis(3-trifluoromethylpyrazol-5-ylate) | CD2Cl2 [6] | QOCBUI [6] | LUM1 [6] | |||||
| H | 7-trifluoromethyl | pentafluorophenyl | pentafluorophenyl | CD2Cl2 [90] | MEDPET [90] | LUM1 [90] | ||||
| 2-(9,9-di(n-butyl)fluoren-2-yl)pyridine* | H | H | methylenebis(3-n-butyl-1H-imidazol-1-yl-2-ylidene) | 2PF6− | CD3CN [19] | LUM1 [19] | ||||
| 2-(9,9-di(n-hexyl)fluoren-2-yl)pyridine* | 5-methyl | H | phenylethynyl | phenylethynyl | CDCl3 [75] | LUM1 [75] | ||||
| 5-methyl | H | 3,5-bis(trifluoro)phenylethynyl | 3,5-bis(trifluoro)phenylethynyl | CDCl3 [75] | LUM1 [75] | |||||
| 5-trifluoromethyl | H | 3,5-bis(trifluoro)phenylethynyl | 3,5-bis(trifluoro)phenylethynyl | CDCl3 [75] | LUM1 [75] | |||||
| 5-methyl | 7-(4-diphenylaminophenyl) | phenylethynyl | phenylethynyl | CDCl3 [75] | LUM1 [75] | |||||
| 5-trifluoromethyl | 7-(4-diphenylaminophenyl) | phenylethynyl | phenylethynyl | CDCl3 [75] | LUM1 [75] | |||||
| 2-(9,9-(1,1′-biphenyl-2,2′-diyl)fluoren-2-yl)pyridine* | 5-trifluoromethyl | H | 3,5-bis(trifluoro)phenylethynyl | 3,5-bis(trifluoro)phenylethynyl | CDCl3 [75] | LUM1 [75] | ||||
| 2-(9,9-bis(2-hydroxyethyl)fluoren-2-yl)pyridine* | H | H | phenylethynyl | phenylethynyl | DMSO-d6 [102] | |||||
| 2-(dibenzofuran-4-yl)pyridine* | H | H | bis(2-acetylidephenyl)acetylene | CD2Cl2 [39] | LUM1 [39] | |||||
| H | H | 1,1-dimethylmethylenebis(3-trifluoromethylpyrazol-5-ylate) | DMSO-d6 [6] | QOCBOC [6] | LUM1 [6] | |||||
| 4-dimethylamino | H | 1,1-dimethylmethylenebis(3-trifluoromethylpyrazol-5-ylate) | DMSO-d6 [6] | LUM1 [6] | ||||||
$ Types of activity: BIO—biological (BIO1—anti-tumour, BIO2—anti-microbial, i.e., anti-bacterial and/or anti-fungal); CAT—catalytic; LUM—luminescence (LUM1—with t > 10 µs, LUM2—with t < 10 µs). 1 This compound appears in two isomeric forms, i.e., enantiomers R/S. 2A–2D It is unclear whether in the solution these compounds should be regarded as [Au(2ArPY*)(1,2-bis(diphenylphosphino)benzene)]Cl2 (2ArPY = 2-benzylpyridine for 2A, 2-benzoylpyridine for 2B, 2-phenoxypyridine for 2C, 2-anilinopyridine for 2D) or rather [Au(2ArPY$)(1,2-bis(diphenylphosphino)benzene)Cl]Cl (2ArPY$ = monoanionic form of 2ArPY, deprotonated and binding monodentately by C(2′)). 3A–3D In the solid phase, the N(1),C(2′)-chelation is observed for 2A (USEDOO), while the monodentate C(2′) coordination for 2B-2D (USEDII, USEDEE, USEDUU). a 1/2 chloride, 1/2 tetrafluoroborate salt. b diethyl ether solvate. c acetonitrile solvate. d dichloromethane solvate. e dichloromethane diethyl ether solvate. f methanol solvate. g acetone solvate. h dimethylformamide solvate. i diethyl ether n-hexane solvate. j n-pentane solvate. k ethyl acetate solvate.
Many above Au(III)-2ArPY* compounds are biologically active, revealing anti-tumour (against various bowel, breast, colon, lung, and mammary and ovarian cancers, as well as leukemia) [9,25,31,33,51,63,64,79,82,92,93,96,97,99], as well as anti-bacterial (against Escherichia coli, Bacillus subtilis, and Pseudomonas aeruginosa) and anti-fungal (against Candida albicans, Trichophyton mentagrophytes, and Cladosporium resinae) [63,96,97] properties. To the best of our knowledge, the catalytic activity of these species seems to be unknown, while some of them reveal luminescence, with lifetimes of either >10 µs [6,19,39,75,90] or <10 µs [18].
2.3. Au(III)-ArPY#* Compounds
A total of 33 Au(III) compounds with analogues of 2-arylpyridines* (e.g., 2-phenylquinoline*, 1- or 3-phenylisoquinoline* and 7,8-benzoquinoline*) and their derivatives (generally denoted as ArPY#*), with various auxiliary ligands (including halides), having the general formula [Au(ArPY#*)L1L2] (particularly [Au(ArPY#*)L2], including [Au(ArPY#*)X2]) or [Au(ArPY#*)(L1L2)]) (particularly [Au(ArPY#*)(LL)]) were reported and characterised by NMR spectroscopy and/or by single crystal X-ray diffraction [2,5,9,10,15,19,27,37,39,41,45,75,102,103,104,105,106,107,108]. These species are presented in Scheme 4, being listed in Table 6 (by definition, it does not include the Au(III)-2ppy*, Au(III)-2PPY*, and Au(III)-ArPY#* molecules shown in Table 1, Table 2, Table 3, Table 4 and Table 5).
A total of 5 compounds are [Au(ArPY#*)X2] dihalides [2,5,9,10,15,19,104,105,106], while 28 molecules contain some other monodentate or bidentate ligands, revealing the general formula [Au(ArPY#*)L1L2] (including [Au(ArPY#*)L2]) or [Au(ArPY#*)(L1L2)]) (including [Au(ArPY#*)(LL)]) [2,9,15,19,27,37,39,41,45,75,102,103,105,106,107,108].
Taking into account the type of ArPy#* molecule, these are Au(III) species (their respective numbers in parentheses) with heterocycles based on 2-phenylquinoline* (4) [2,103], 1-phenyl-, 1-(naphth-2-yl)- or 1-(9,9-di(n-hexyl)fluoren-2-yl)isoquinoline* (9) [10,19,27,37,39,75], 3-phenyl- or 3-(9,9-bis(2-hydroxyethyl)fluoren-2-yl)isoquinoline* (6) [45,102,103], and 7,8-benzoquinoline* (14) [5,9,10,15,41,45,103,105,106,107,108] ring systems.
Table 6.
NMR and/or X-ray studied [Au(ArPY#*)L1L2] (in particular, [Au(ArPY#*)L2]) or [Au(ArPY#*)(L1L2)]) (in particular, [Au(ArPY#*)(LL)]) compounds (ArPY#* ≠ 2PPY*, 2ArPY*; L1, L2, L—monodentate ligands (including F, Cl, Br, I); LL—bidentate ligands); R1 and R2 are substituents in the pyridine-like ring and the aryl ring, respectively.
Table 6.
NMR and/or X-ray studied [Au(ArPY#*)L1L2] (in particular, [Au(ArPY#*)L2]) or [Au(ArPY#*)(L1L2)]) (in particular, [Au(ArPY#*)(LL)]) compounds (ArPY#* ≠ 2PPY*, 2ArPY*; L1, L2, L—monodentate ligands (including F, Cl, Br, I); LL—bidentate ligands); R1 and R2 are substituents in the pyridine-like ring and the aryl ring, respectively.
| Parent ArPY#* Ring System | R1 | R2 | L1 | L2 | L1L2 | Counterion | NMR Solvent | X-ray (CCDC) | Geometry | Activity $ |
|---|---|---|---|---|---|---|---|---|---|---|
| 2-phenylquinoline* | H | H | 2-phenylquinoline* | BF4− | DMSO-d6 [103] | ZINHUB [103] | trans(C,N) | CAT [103] | ||
| 4-methoxycarbonyl | H | Cl | Cl | CDCl3 [2] | ||||||
| 4-methoxycarbonyl | H | dimethylaminocarbodithioate | PF6− | DMSO-d6 [2] | ||||||
| 4-methoxycarbonyl | H | 2-(4-methoxycarbonylquinolin-2-yl)phenyl | Cl | MAXQUX [2] | trans(C,N) | |||||
| 1-phenylisoquinoline* | H | H | Cl | Cl | DMSO-d6 [10] | |||||
| H | H | CN | CN | CD2Cl2 [27] | DUZDAF [27] DUZDAF 01 [27] DUZDAF 02 [27] | LUM2 [27] | ||||
| H | H | bis(2-acetylidephenyl)acetylene | CD2Cl2 [39] | LUM1 [39] | ||||||
| H | H | 4-methoxyphenylethynyl | 4-methoxyphenylethynyl | CD2Cl2 [37] | LUM1 [37] | |||||
| H | 4-methoxy | 4-methoxyphenylethynyl | 4-methoxyphenylethynyl | CD2Cl2 [37] | AJOXON [37] a | LUM1 [37] | ||||
| 1-(naphth-2-yl)isoquinoline* | H | H | Cl | Cl | DMSO-d6 [19] | |||||
| H | H | methylenebis(3-n-butyl-1H-imidazol-1-yl-2-ylidene) | 2PF6− | CD3CN [19] | LUM1 [19] | |||||
| H | H | methylenebis(3-(3-sulfonate-n-propyl)-1H-imidazol-1-yl-2-ylidene) | D2O [19] | LUM1 [19] | ||||||
| 1-(9,9-di(n-hexyl)fluoren-2-yl)isoquinoline* | H | 7-(4-diphenylaminophenyl) | phenylethynyl | phenylethynyl | CDCl3 [75] | LUM1 [75] | ||||
| 3-phenylisoquinoline* | H | H | 3-phenylisoquinoline* | BF4− | DMSO-d6 [103] | CAT [103] | ||||
| H | H | 1,1′-binaphthyl-2-one-2′-olate-1-yl | CDCl3 [45] | R/S 1 | ||||||
| H | 4-tert-butyl | phenylethynyl | phenylethynyl | CDCl3 [102] | ||||||
| 3-(9,9-bis(2-hydroxyethyl)fluoren-2-yl)isoquinoline* | H | H | phenylethynyl | phenylethynyl | DMSO-d6 [102] | BIO1 [102] | ||||
| H | H | 4-methylphenylethynyl | 4-methylphenylethynyl | DMSO-d6 [102] | ||||||
| H | H | 4-fluorophenylethynyl | 4-fluorophenylethynyl | DMSO-d6 [102] | ||||||
| 7,8-benzoquinoline* | H | H | Cl | Cl | DMSO-d6 [5,9,10,15,104] | |||||
| H | H | I | I | CDCl3 [105,106] | EWIWUE [105] | |||||
| H | H | n-butyl | Cl | CDCl3 [106] | ||||||
| H | H | n-butyl | H2O | SbF6− | CD2Cl2 [106] | |||||
| H | H | trifluoroacetate | trifluoroacetate | CD3COCD3 [106,107] | CAT [107] | |||||
| H | H | phenyl | Br | CDCl3 [106] | ||||||
| H | H | 4-phenyl-n-butyl | Cl | CDCl3 [106] | FIBRUG [106] b | trans(C,N) | ||||
| H | H | 4-phenyl-n-butyl | H2O | SbF6− | FIBROA [106] | trans(C,N) | ||||
| H | H | phenylethynyl | phenylethynyl | CD2Cl2 [15] | IZOTAT [15] | LUM1 [15] | ||||
| H | H | 2,4,6-tris(trifluoromethyl)phenyl | Cl | CD2Cl2 [41] | GIVROU [41] | trans(C,N) | LUM2 [41] | |||
| H | H | 1,1′-binaphthyl-2-one-2′-olate-1-yl | CDCl3 [45] | R/S 1 | ||||||
| H | H | pyridine | I | SbF6− | CD3CN [105] | EWIXAL [105] | trans(I,N) | |||
| H | H | 1,2-(bis(pyridin-4-yl)sulfanyl)ethene-1,2-dithiolate | CD2Cl2 [108] | QUVXIR [108] | ||||||
| H | H | 1,2-bis(diphenylphosphino)benzene 2 | 2Cl− | CDCl3 [9] | BIO1 [9] |
$ Types of activity: BIO—biological (BIO1—anti-tumour, BIO2—anti-microbial, i.e., anti-bacterial and/or anti-fungal); CAT—catalytic; LUM—luminescence (LUM1—with t > 10 µs, LUM2—with t < 10 µs). 1 This compound appears in two isomeric forms, i.e., enantiomers R/S. 2 It is unclear whether this compound should be regarded as [Au(7,8-benzoquinoline*)(1,2-bis(diphenylphosphino)benzene)Cl]Cl (7,8-benzoquinoline$ = monoanionic form of 7,8-benzoquinoline, deprotonated and bound monodentately by C(10)). a dichloromethane solvate. b chloroform solvate.
Two of the above Au(III)-ArPY#* compounds are biologically active, revealing anti-tumour properties (against various breast, colon, liver, and lung and ovarian cancers, as well as melanoma) [9,102]. Some of the others have catalytic properties (in reactions between benzaldehyde, piperidine, and phenylacetylenes—yielding propargylamines—and between alkynyl alcohols and 1-methylindol—yielding substituted indols [103]—as well as upon hydroarylation reactions between diphenylacetylene and 1,3,5-trimethoxybenzene—yielding styrene derivatives [107]). Then, a number of these species exhibits luminescence, with lifetimes of either >10 µs [15,19,37,39,75] or <10 µs [27,41].
2.4. Discussion of Single Crystal X-ray Structures
Nearly all Au(III)-2PPY* (including Au(III)-2ppy*), Au(III)-2ArPY*, and Au(III)-ArPY#* compounds have coordination number 4 and square-planar geometry (the only exclusions are [Au(2-phenylpyridine*)(1,4,7-trithiacyclononane-κ3-S,S,S)]2+ and [Au(2-(4-methylphenyl)pyridine*)(1,4,7-trithiacyclononane-κ3-S,S,S)]2+ in their hexafluorophosphate salts—MOCFOB, MOCFIV [5]—which exhibit coordination number 5). Thus, in cases of L1 ≠ L2 or unsymmetrical L1L2 ligands, two geometric isomers are possible—differing in the position of both donor atoms versus the nitrogen of the pyridine (or pyridine-like) ring and the metallated carbon of the phenyl (or, more generally, aryl) ring.
In Table 1, Table 2, Table 3, Table 4, Table 5 and Table 6, it was indicated, for molecules with the known X-ray structures, which donor atom (or the whole donor moiety) of the auxiliary ligand(s) is trans to the nitrogen of the pyridine (or pyridine-like) ring (column Geometry).
The comparison of these X-ray structures exhibits that the molecules having various elements, as donor atoms of the auxiliary ligand(s) usually adopt the following geometries:
trans(N,N), instead of trans(O,N) (MAXQEH [2], KIGPEY [25], BAZSEB [96]) or trans(Cl,N) (XEWBUX [63]);
trans(S,N), instead of trans(O,N) (ILETIC [28], ICUMEY [51]), trans(Cl,N) (AZOKUY [30]) or trans(N,N) (ILETOI, ILETEY [28], LORCOM, LORCEC, LORCIG [34], FUJHUQ [99], MIRLIK, MIRLOQ [101]);
trans(I,N), instead of trans(Cl,N) (VUVKOP [23]), trans(N,N) (EWIXAL [105]) or trans(Br,N) (VUVLEG [23]);
trans(C,N), instead of trans(F,N) (DAJRUE, DAJROY [21]), trans(O,N) (BIGREP [29], XOLCEI [42], FONDIX, FONCIW [43], IDAJII, IDAJOO [54], FUWXIG, FUWXOM [57], YIDHIF, YIDGIE, YIDHEB, YIDHAX, YIDGOK, YIDGAW, YIDGUQ, YIDGEA, YIDFUP [58], QEFVUV, QEFWAC [59], PEZQUI [67], KEKGEP [73], QEZYAX [74], FIBROA [106]), trans(Cl,N) (MAXQUX [2], FONSAE, FONRUX [14], BIGRAL [29], IVAZAI [36], GIVRIO, GIVROU [41], ECEGOM, ECEGOM 01 [95], FIBRUG [106]), trans(N,N) (XOLCUY, XOLCIM, XOLCOS [42], IPISEH, IPISAD [60], ZINHUB [103]), trans(Br,N) (DAJRIS [21], JOTROB [12], ROVYAF [55], LUWKAS [56]), trans(I,N) (GIVSOV [41]), and trans(P,N) (XOLDAF, XOLDEJ [42], IDAJUU [54]);
trans(P,N), instead of trans(F,N) (IVAZEM [36]), trans(Cl,N) (QUNSIE [35], IVAYUB, IVAYOV [36], QUMZIJ [79], PUKYEZ [85], FIKQAR [87]), or trans(S,N) (MAXQIL [2]).
Hence, generally, less electronegative (less electron-acceptor) elements are preferred to be positioned trans to the pyridine (or pyridine-like) nitrogen. The exception is the pair of trans(C,N) and trans(P,N), as in the X-ray structures XOLDAF, XOLDEJ, and IDAJUU, and the former geometry is preferred [42,54], although carbon is more electronegative than phosphorus.
Even more important exclusions are the X-ray structures MIZHEL, MIYXOK, and MIYXUQ, where the trans(Cl,N) geometry was observed, instead of the seemingly more expected trans(C,N) one, upon the presence of the C6F5− and Cl− ligands [18]. However, it can be explained by the fact that, despite a large difference in the electronegativity of carbon and chlorine, in these molecules, there is a competition (in occupying trans to nitrogen position) of the pentafluorophenyl anion with the chloride one—while the former has extremely strong electron-acceptor properties, due to the presence of five fluorine atoms in the phenyl ring.
The most important structural parameters in the discussed Au(III) compounds are the Au–N and Au–C bond lengths, as well as the N–Au–C bond angles. They were usually given in original papers, but can also be deduced from the respective CIF files, which have been used as a primary source for this review. All these values, associated to the CCDC reference codes given in Table 1, Table 2, Table 3, Table 4, Table 5 and Table 6, together with indication which elements (donor atoms) of the auxiliary ligands, are in the trans position, with respect to the metallated N and C atoms, which are listed in Table 7.
In the majority of cases, the Au–N bonds are longer than those of Au–C, which is well-reflected by comparison of their mean bond lengths, averaged for 206 X-ray structures (among all 207; in case of FONREH the interatomic distances could not be deduced, due to the bad quality of data), after preliminary averaging of these parameters for each Au(III) species (when two or more slightly differing, crystallographically inequivalent molecules are present in the crystal lattice): 2.072 Å versus 2.028 Å. Similarly, the range of Au–N bond lengths (1.975–2.283 Å) also corresponds to higher values than that for Au–C (1.845–2.100 Å), despite their partial overlapping.
The N–Au–C bond angles vary within a 79.2–91.0° range, with a mean value of 82.5°.
It is interesting to compare the X-ray structures of the cyclometallated [Au(2PPY*)Cl2] and [Au(2ArPY*)Cl2] dichlorides with the respective [Au(2PPY)Cl3] and [Au(2ArPY)Cl3] trichloride complexes. Such pairs of X-ray structural data are available for Au(III) compounds with 2-phenylpyridine [3,109], 2-(2,4-difluorophenyl)pyridine [16], 2-(2-trifluoromethoxyphenyl)pyridine [18], 2-benzylpyridine [16], 2-benzoylpyridine [18,85], and 2-phenylsulfanylpyridine [87,110]. In this case, the comparable parameter is the Au–N bond length, with its values being listed in Table 8.
This comparison, however, does not reveal any clear relationship between the Au–N bond lengths in the respective dichloride and trichloride species. Their differences for the corresponding Au(III) compounds are of variable sign and small absolute magnitude, being statistically not significant. This is also exhibited by the overlapping of both ranges of this parameter: 2.01–2.06 Å for [Au(2PPY*)Cl2] and [Au(2ArPY*)Cl2] versus 2.03–2.06 Å for [Au(2PPY)Cl3] and [Au(2ArPY)Cl3], as well as by nearly the same mean values: 2.039 Å for [Au(2PPY*)Cl2] and [Au(2ArPY*)Cl2] versus 2.047 Å for [Au(2PPY)Cl3] and [Au(2ArPY)Cl3].
2.5. Discussion of 15N NMR Spectra
In addition to the routine 1H and/or 13C (and, optionally, 19F or 31P) NMR spectra, some Au(III)-2PPY* (including Au(III)-2ppy*), Au(III)-2ArPY*, and Au(III)-ArPY#* compounds were studied by 15N NMR [4,7,53,60,78,80,86,104]. Their 15N chemical shifts (with respect to neat nitromethane), together with 15N coordination shifts (i.e., differences from 15N chemical shifts for free ligands), are listed in Table 9.
In all cases, the Au(III) coordination of 2PPY* (including 2ppy*), 2ArPY*, or ArPY#* leads to a large decrease of the 15N NMR chemical shift of the metallated nitrogen (comparing to the parent heterocycle, measured preferably in the same solvent), reflecting a strong 15N shielding phenomenon and resulting in a significant low-frequency (i.e., upfield) shift of the 15N signal (thus, the Δ15Ncoord values are negative). The absolute magnitude of this effect is ca. 45–105 ppm.
In two reviews by Pazderski [112,113], the dependency was identified in that of square-planar Au(III) complexes or organometallics with aza aromatic ligands (such as azines, e.g., pyridine derivatives, etc.), and the absolute magnitude of the 15N NMR coordination shift (|Δ15Ncoord|) mainly reflected the type of a donor atom in the trans position, with respect to the Au(III)-bonded nitrogen. For example, in the two pairs of [AuIIILCl3] and trans-[AuIIIL2Cl2]+ species, the |Δ15Ncoord| parameter for the former compound (nitrogen trans to Cl) was smaller than for the latter one (nitrogen trans to N): 84.8 ppm versus 87.2 ppm for L = pyridine, and 78.1 ppm versus 91.0 ppm for L = 4-methylpyridine [112,113].
Such observations can also be performed for some of the presently reviewed Au(III) species, when compared to the compounds containing the same cycloaurated ligand. Based on the data collected in Table 9, such a comparison is possible for the series of [Au(2-(4-methylphenyl)pyridine*)L1L2] molecules with various L1 and L2 ligands (methyl, allyl, phenyl, acetate, trifluoroacetate, and bromide anions). Thus, for [Au(2-(4-methylphenyl)pyridine*)(acetate)2] and [Au(2-(4-methylphenyl)pyridine*)(trifluoroacetate)2] (nitrogen trans to O), the |Δ15Ncoord| parameter is much larger than for [Au(2-(4-methylphenyl)pyridine*)(methyl)2] (nitrogen trans to C): 89.5–90.7 ppm versus 56.1 ppm [53]. In this way, based on the 15N NMR spectra only, one could assume that, in all other “unsymmetrical” [Au(2-(4-methylphenyl)pyridine*)LBr] (L = methyl, allyl, phenyl) compounds, the nitrogen atoms are positioned trans to C, rather than trans to Br, because their |Δ15Ncoord| values (46.7–53.0 ppm) are rather small and close to that of [Au(2-(4-methylphenyl)pyridine*)(methyl)2] (56.1 ppm). In fact, the proposed trans(C,N) geometry for these three molecules was actually confirmed by the X-ray structure of [Au(2-(4-methylphenyl)pyridine*)(allyl)Br] (ROVYAF [55]), in accordance with the already mentioned preference to form trans(C,N), instead of trans(C,Br) isomers.
A more detailed discussion of this issue is difficult, due to the small number of X-ray structures, for which, the 15N NMR data were also reported. They are available only for the pair of [Au(2-(4-methylphenyl)pyridine*)L2] molecules (QICNUN for L = methyl and QICPAV for L = trifluoroacetate) [52], where the increase of |Δ15Ncoord| upon the CH3 → CF3COO ligand transition can be related to the shortening of the Au–N bond (2.130(3) Å → 1.991(6) Å; see Table 7). However, this is only one example, not allowing for general conclusions.
The analysis of the other 15N NMR data exhibits that relatively large |Δ15Ncoord| parameters are observed for all [Au(2PPY*)(CF3COO)2] (ca. 66–105 ppm; nitrogens trans to O) and [Au(ArPY#*)Cl2] (ca. 69–105 ppm; nitrogens trans to Cl) species, with no significant differences between both classes of molecules.
3. Applications
3.1. Biological Activity
A total of 105 reviewed compounds were studied, with respect to their biological activity [3,8,9,11,25,26,28,30,31,33,43,51,63,64,79,82,83,92,93,96,97,99,102]. Generally, all these reports concerned anti-tumour properties, but some also described anti-microbial (anti-bacterial and anti-fungal) action [63,96,97].
The anti-tumour properties of these Au(III) species against various types of cancer cells (usually of carcinoma or adenocarcinoma types, but also glioblastoma, leukemia, and melanoma), in a few cases with cytotoxic activity against some non-cancerous cells (analyzed for comparison), as well as their anti-microbial properties (indicated by footnote a), are summarized, in the order of references, in Table 10.
On the basis of their biological activity, the concerned Au(III) compounds can be applied in medicine, as they are potential anti-cancer, anti-bacterial, and anti-fungal drugs.
3.2. Catalytic Activity
A total of 30 reviewed compounds were exhibited to have catalytic activity [7,16,17,22,42,65,103,107]. Their application as catalysts is summarized, in the order of references, in Table 11.
On the basis of the above catalytic activity, the concerned Au(III) compounds are applied in organic syntheses.
3.3. Luminescence
A total of 88 reviewed compounds were studied in detail, with respect to their luminescence [6,15,18,19,24,27,37,38,39,41,42,75,90].
An important parameter for luminescence differentiation is the lifetime, i.e., the average time that a molecule remains in an excited state prior to returning to the ground state by emitting a photon. In this review, we have arbitrarily chosen the lifetime of 10 µs as a border between long- and short-living excited forms; the former corresponds to phosphorescence, while the latter corresponds to either phosphorescence or fluorescence (it is often difficult to distinguish both phenomena: although they have different mechanisms, their identification may be ambiguous, even taking into account the fact that phosphorescence lifetimes are principally longer than the fluorescence ones).
A total of 54 reviewed compounds exhibited luminescence with lifetimes above 10 µs [6,15,19,37,39,42,75,90], while 34 exhibited luminescence with lifetimes below 10 µs [15,18,24,27,38,41,75]. The detailed data describing their chemical character, together with the maximal quantum yields (for a given group of compounds, rounded to 1%), are summarized, in the order of references, in Table 12.
On the basis of the above luminescence properties, these Au(III) compounds can be applied in the production of organic light-emitting diodes (OLEDs).
4. Conclusions
A large numbers of reports (>100) described molecules (>500) and single crystal X-ray structures (>200) and indicated that the Au(III) compounds with 2-arylpyridines* and their derivatives or analogues are interesting from the chemical, spectroscopic, and structural viewpoints. The most popular Au(III)-2PPY* species are those with 2-phenylpyridine* and 2-(4-methylphenyl)pyridine*, while among Au(III)-2ArPY* molecules—those containing 2-benzylpyridine* ring system are the most popular.
All Au(III)-2PPY*, Au(III)-2ArPY*, and Au(III)-ArPY#* compounds exhibit a specific (N,C) coordination mode, alternative to classical monodentate complexation by nitrogen. Thus, these molecules contain both gold–nitrogen and gold–carbon bonds and can be regarded as either complexes or organometallics.
The coordination number 4 and the square-planar geometry are typical for Au(III) chemistry and allow, upon the presence of different monodentate (L1 ≠ L2) or unsymmetrical bidentate (L1L2) auxiliary ligands, for the appearance of geometric isomers differing in the position of various donor atoms versus the nitrogen of the pyridine (or pyridine-like) ring or the metallated carbon of the phenyl (or aryl) ring. There is an evident preference (with a few exceptions) to form such stereomers, in which the auxiliary ligands having less electron-acceptor properties (thus, usually containing less electronegative elements as donor atoms) are trans-positioned to the pyridine (or pyridine-like) nitrogen.
A total of 20 Au(III)-2PPY*, Au(III)-2ArPY*, and Au(III)-ArPY#* compounds were studied by 15N NMR. The comparison to analogous measurements for the corresponding 2PPY, 2ArPY, or ArPY# reveals a ca. 45–105 ppm decrease of the chemical shift of the pyridine nitrogen. This phenomenon reflects a strong 15N shielding effect at the Au(III)-bonded N atom.
About 200 Au(III)-2PPY*, Au(III)-2ArPY*, and Au(III)-ArPY#* compounds exhibit some specific activities, especially biological and/or catalytic, as well as luminescence properties. It opens the way for their application as anti-tumour or anti-microbial (anti-bacterial, anti-fungal) drugs and catalysts in organic syntheses, as well as materials for the production of organic light-emitting diodes. So, the wide application of these species is the reason for their intensive studies, as noted during the last few decades, as well as to write the present review.
Author Contributions
Conceptualization, L.P.; methodology, L.P.; software, L.P.; validation, L.P. and P.A.A.; formal analysis, L.P. and P.A.A.; investigation, L.P. and P.A.A.; resources, L.P. and P.A.A.; data curation, L.P. and P.A.A.; writing—original draft preparation, L.P.; writing—review and editing, L.P. and P.A.A.; visualization, L.P.; supervision, L.P.; project administration, L.P. All authors have read and agreed to the published version of the manuscript.
Funding
This research received no external funding.
Data Availability Statement
The data are available in the quoted papers.
Conflicts of Interest
The authors declare no conflict of interest.
References
- Constable, E.C.; Leese, T.A. Cycloaurated derivatives of 2-phenylpyridine. J. Organomet. Chem. 1989, 363, 419–424. [Google Scholar] [CrossRef]
- Parish, R.V.; Wright, J.P.; Pritchard, R.G. Mercury(II) and gold(III) derivatives of 2-phenylpyridines and 2-phenyl-4-(methylcarboxylato)quinoline. J. Organomet. Chem. 2000, 596, 165–176. [Google Scholar] [CrossRef]
- Fan, D.; Yang, C.T.; Ranford, J.D.; Lee, P.F.; Vittal, J.J. Chemical and biological studies of the dichloro(2-phenylpyridine)gold(III) complex and its derivatives. Dalton Trans. 2003, 2680–2685. [Google Scholar] [CrossRef]
- Pazderski, L.; Pawlak, T.; Sitkowski, J.; Kozerski, L.; Szlyk, E. 1H, 13C, 15N and 195Pt NMR studies of Au(III) and Pt(II) chloride organometallics with 2-phenylpyridine. Magn. Reson. Chem. 2009, 47, 932–941. [Google Scholar] [CrossRef] [PubMed]
- Janzen, D.E.; Doherty, S.R.; van Derveer, D.G.; Hinkle, L.M.; Benefield, D.A.; Vashi, H.M.; Grant, G.J. Cyclometallated gold(III) complexes with a trithiacrown ligand: Solventless Au(III) cyclometallation, intramolecular gold-sulfur interactions, and fluxional behavior in 1,4,7-trithiacyclononane Au(III) complexes. J. Organomet. Chem. 2014, 755, 47–57. [Google Scholar] [CrossRef]
- Malmberg, R.; Bachmann, M.; Blacque, O.; Venkatesan, K. Thermally Robust and Tuneable Phosphorescent Gold(III) Complexes Bearing (N^N)-Type Bidentate Ligands as Ancillary Chelates. Chem. Eur. J. 2019, 25, 3627–3636. [Google Scholar] [CrossRef] [PubMed]
- Segato, J.; Del Zotto, A.; Belpassi, L.; Belanzoni, P.; Zuccaccia, D. Hydration of alkynes catalyzed by [Au(X)(L)(ppy)]X in the green solvent γ-valerolactone under acidfree conditions: The importance of the preequilibrium step. Catal. Sci. Technol. 2020, 10, 7757–7767. [Google Scholar] [CrossRef]
- Kim, J.H.; Ofori, S.; Mertens, R.T.; Parkin, S.; Awuah, S.G. Water-Soluble Gold(III)–Metformin Complex Alters Mitochondrial Bioenergetics in Breast Cancer Cells. ChemMedChem 2021, 16, 3222–3230. [Google Scholar]
- Kim, J.H.; Ofori, S.; Parkin, S.; Vekaria, H.; Sullivan, P.G.; Awuah, S.G. Anticancer gold(III)-bisphosphine complex alters the mitochondrial electron transport chain to induce in vivo tumor inhibition. Chem. Sci. 2021, 12, 7467–7479. [Google Scholar] [CrossRef]
- Martín, J.; Gomez-Bengoa, E.; Genoux, A.; Nevado, C. Synthesis of Cyclometalated Gold(III) Complexes via Catalytic Rhodium to Gold(III) Transmetalation. Angew. Chem. Int. Ed. 2022, 61, e202116755. [Google Scholar] [CrossRef]
- Zhang, J.J.; Ng, K.M.; Lok, C.N.; Sun, R.W.Y.; Che, C.M. Deubiquitinases as potential anti-cancer targets for gold(III) complexes. Chem. Commun. 2013, 49, 5153–5155. [Google Scholar] [CrossRef] [PubMed]
- Wu, Q.; Du, C.; Huang, Y.; Liu, X.; Long, Z.; Song, F.; You, J. Stoichiometric to catalytic reactivity of the aryl cycloaurated species with arylboronic acids: Insight into the mechanism of gold-catalyzed oxidative C(sp2)–H arylation. Chem. Sci. 2015, 6, 288–293. [Google Scholar] [CrossRef] [PubMed] [Green Version]
- Shaw, A.P.; Tilset, M.; Heyn, R.H.; Jakobsen, S. Microwave methods for the synthesis of gold(III) complexes. J. Coord. Chem. 2011, 64, 38–47. [Google Scholar] [CrossRef]
- Maity, A.; Sulicz, A.N.; Deligonul, N.; Zeller, M.; Hunter, A.D.; Gray, T.G. Suzuki–Miyaura coupling of arylboronic acids to gold(III). Chem. Sci. 2015, 6, 981–986. [Google Scholar] [CrossRef] [Green Version]
- Garg, J.A.; Blacque, O.; Venkatesan, K. Syntheses and Photophysical Properties of Luminescent Mono-cyclometalated Gold(III) cis-Dialkynyl Complexes. Inorg. Chem. 2011, 50, 5430–5441. [Google Scholar] [CrossRef]
- von Wachenfeldt, H.; Polukeev, A.V.; Loganathan, N.; Paulsen, F.; Roese, P.; Garreau, M.; Wendt, O.F.; Stand, D. Cyclometallated gold(III) aryl-pyridine complexes as efficient catalysts for three-component synthesis of substituted oxazoles. Dalton Trans. 2015, 44, 5347–5353. [Google Scholar] [CrossRef] [Green Version]
- Kung, K.K.Y.; Lo, V.K.Y.; Ko, H.M.; Li, G.L.; Chan, P.Y.; Leung, K.C.; Zhou, Z.; Wang, M.Z.; Che, C.M.; Wong, M.K. Cyclometallated Gold(III) Complexes as Effective Catalysts for Synthesis of Propargylic Amines, Chiral Allenes and Isoxazoles. Adv. Synth. Catal. 2013, 355, 2055–2070. [Google Scholar] [CrossRef]
- Bachmann, M.; Fessler, R.; Blacque, O.; Venkatesan, K. Towards blue emitting monocyclometalated gold(III) complexes—Synthesis, characterization and photophysical investigations. Dalton Trans. 2019, 48, 7320–7330. [Google Scholar] [CrossRef]
- Hung, F.F.; To, W.P.; Zhang, J.J.; Ma, C.; Wong, W.Y.; Che, C.M. Water-Soluble Luminescent Cyclometalated Gold(III) Complexes with cis-Chelating Bis(N-Heterocyclic Carbene) Ligands: Synthesis and Photophysical Properties. Chem. Eur. J. 2014, 20, 8604–8614. [Google Scholar] [CrossRef]
- Jiang, J.J.; Chau, A.K.H.; Wong, M.K.; Leung, F.K.C. Controlled Supramolecular Assembly of Gold (III) Amphiphiles in Aqueous Media. Eur. J. Inorg. Chem. 2022, 2022, e202200281. [Google Scholar] [CrossRef]
- Kumar, R.; Linden, A.; Nevado, C. Evidence for Direct Transmetalation of AuIII−F with Boronic Acids. J. Am. Chem. Soc. 2016, 138, 13790–13793. [Google Scholar] [CrossRef] [PubMed]
- Levchenko, V.A.; Siah, H.S.M.; Oien-Odegaard, S.; Kaur, G.; Fiksdahl, A.; Tilset, M. Catalytic studies of cyclometalated gold(III) complexes and their related UiO-67 MOF. Mol. Catal. 2020, 492, 111009. [Google Scholar] [CrossRef]
- Levchenko, V.A.; Nova, A.; Oien-Odegaard, S.; Balcells, D.; Tilset, M. Synthesis, Characterization, and Reactivity of Cyclometalated Gold(III) Dihalide Complexes in Aqua Regia. Eur. J. Inorg. Chem. 2020, 2020, 3249–3258. [Google Scholar] [CrossRef]
- Bachmann, M.; Terreni, J.; Blacque, O.; Venkatesan, K. Rationally Designed Blue Triplet Emitting Gold(III) Complexes Based on a Phenylpyridine-Derived Framework. Chem. Eur. J. 2017, 23, 3837–3849. [Google Scholar] [CrossRef]
- Williams, M.R.M.; Bertrand, B.; Fernandez-Cestau, J.; Waller, Z.A.E.; O’Connell, M.A.; Searcey, M.; Bochmann, M. Acridine-decorated cyclometallated gold(III) complexes: Synthesis and anti-tumour investigations. Dalton Trans. 2018, 47, 13523–13534. [Google Scholar] [CrossRef] [Green Version]
- Williams, M.R.M.; Bertrand, B.; Hughes, D.L.; Waller, Z.A.E.; Schmidt, C.; Ott, I.; O’Connell, M.; Searcey, M.; Bochmann, M. Cyclometallated Au(III) dithiocarbamate complexes: Synthesis, anticancer evaluation and mechanistic studies. Metallomics 2018, 10, 1655–1666. [Google Scholar] [CrossRef] [Green Version]
- Szentkuti, A.; Garg, J.A.; Blacque, O.; Venkatesan, K. Monocyclometalated Gold(III) Complexes Bearing π-Accepting Cyanide Ligands: Syntheses, Structural, Photophysical, and Electrochemical Investigations. Inorg. Chem. 2015, 54, 10748–10760. [Google Scholar] [CrossRef]
- Fan, D.; Yang, C.T.; Ranford, J.D.; Vittal, J.J.; Lee, P.F. Synthesis, characterization, and biological activities of 2-phenylpyridine gold(III) complexes with thiolate ligands. Dalton Trans. 2003, 3376–3381. [Google Scholar] [CrossRef]
- Fan, D.; Melendez, E.; Ranford, J.D.; Lee, P.F.; Vittal, J.J. Study on carbon–hydrogen activation of ketones by Gold(III) complexes and the synthesis and characterization of two ketonylgold(III) complexes. J. Organomet. Chem. 2004, 689, 2969–2974. [Google Scholar] [CrossRef]
- Gukathasan, S.; Parkin, S.; Black, E.P.; Awuah, S.G. Tuning Cyclometalated Gold(III) for Cysteine Arylation and Ligand-Directed Bioconjugation. Inorg. Chem. 2021, 60, 14582–14593. [Google Scholar] [CrossRef]
- Abas, E.; Gomez-Bachiller, M.; Colom, E.; Pardina, E.; Rodríguez-Dieguez, A.; Grasa, L.; Laguna, M. Cyclometallated gold(III) complexes against colon cancer. X-ray structure of [Au(C,NPhenylpyridine)(OAc)2]. J. Organomet. Chem. 2020, 920, 121340. [Google Scholar] [CrossRef]
- Ivanov, M.A.; Puzyk, M.V.; Balashev, K.P. Spectral Properties of 2-Phenylpyridinate Complexes of Au(III) with Diimine Ligands. Optics Spectrosc. 2006, 100, 382–385. [Google Scholar] [CrossRef]
- Babak, M.V.; Chong, K.R.; Rapta, P.; Zannikou, M.; Tang, H.M.; Reichert, L.; Chang, M.R.; Kushnarev, V.; Heffeter, P.; Meier-Menches, S.M.; et al. Interfering with Metabolic Profile of Triple-Negative Breast Cancers Using Rationally Designed Metformin Prodrugs. Angew. Chem. Int. Ed. 2021, 60, 13405–13413. [Google Scholar] [CrossRef] [PubMed]
- Kuwamura, N.; Hayashida, K.; Tsuge, K.; Yoshinari, N.; Konno, T. A Drastic Difference in Photoluminescent Behavior between Cysteinato and Penicillaminato Gold(III) Complexes with a Phenylpyridinato Ligand. Chem. Lett. 2014, 43, 1846–1848. [Google Scholar] [CrossRef]
- Mayans, J.G.; Suppo, J.S.; Echavarren, A.M. Photoredox-Assisted Gold-Catalyzed Arylative Alkoxycyclization of 1,6-Enynes. Org. Lett. 2020, 22, 3045–3049. [Google Scholar] [CrossRef]
- Tlahuext-Aca, A.; Hopkinson, M.N.; Daniliuc, C.G.; Glorius, F. Oxidative Addition to Gold(I) by Photoredox Catalysis: Straightforward Access to Diverse (C,N)-Cyclometalated Gold(III) Complexes. Chem. Eur. J. 2016, 22, 11587–11592. [Google Scholar] [CrossRef] [PubMed]
- Au, V.K.M.; Wong, K.M.C.; Zhu, N.; Yam, V.W.W. Luminescent Cyclometalated Dialkynylgold(III) Complexes of 2-Phenylpyridine-Type Derivatives with Readily Tunable Emission Properties. Chem. Eur. J. 2011, 17, 130–142. [Google Scholar] [CrossRef]
- Garg, J.A.; Blacque, O.; Fox, T.; Venkatesan, K. Stable and Tunable Phosphorescent Neutral Cyclometalated Au(III) Diaryl Complexes. Inorg. Chem. 2010, 49, 11463–11472. [Google Scholar] [CrossRef]
- Malmberg, R.; Suter, D.; Blacque, O.; Venkatesan, K. Monocyclometalated (CN) Gold(III) Metallacycles: Tunable Emission and Singlet Oxygen (1O2) Generation Properties. Chem. Eur. J. 2021, 27, 14410–14417. [Google Scholar] [CrossRef]
- Ko, H.M.; Deng, J.R.; Cui, J.F.; Kung, K.K.Y.; Leung, Y.C.; Wong, M.K. Selective modification of alkyne-linked peptides and proteins by cyclometalated gold(III) (C^N) complex-mediated alkynylation. Bioorg. Med. Chem. 2020, 28, 115375. [Google Scholar] [CrossRef]
- Szentkuti, A.; Bachmann, M.; Garg, J.A.; Blacque, O.; Venkatesan, K. Monocyclometalated Gold(III) Monoaryl Complexes—A New Class of Triplet Phosphors with Highly Tunable and Efficient Emission Properties. Chem. Eur. J. 2014, 20, 2585–2596. [Google Scholar] [CrossRef] [PubMed]
- Zehnder, T.N.; Blacque, O.; Venkatesan, K. Luminescent monocyclometalated cationic gold(III) complexes: Synthesis, photophysical characterization and catalytic investigations. Dalton Trans. 2014, 43, 11959–11972. [Google Scholar] [CrossRef] [PubMed] [Green Version]
- Rubbiani, R.; Zehnder, T.N.; Mari, C.; Blacque, O.; Venkatesan, K.; Gasser, G. Anticancer Profile of a Series of Gold(III) (2-phenyl)pyridine Complexes. ChemMedChem 2014, 9, 2781–2790. [Google Scholar] [CrossRef] [PubMed]
- Jiang, J.J.; Cui, J.F.; Yang, B.; Ning, Y.; Lai, N.C.H.; Wong, M.K. Chiral Cyclometalated Oxazoline Gold(III) Complex-Catalyzed Asymmetric Carboalkoxylation of Alkynes. Org. Lett. 2019, 21, 6289–6294. [Google Scholar] [CrossRef] [PubMed]
- Cui, J.F.; Ko, H.M.; Shing, K.P.; Deng, J.R.; Lai, N.C.H.; Wong, M.K. C,O-Chelated BINOL/Gold(III) Complexes: Synthesis and Catalysis with Tunable Product Profiles. Angew. Chem. Int. Ed. 2017, 56, 3074–3079. [Google Scholar] [CrossRef]
- Mansour, M.A.; Lachicotte, R.J.; Gysling, H.J.; Eisenberg, R. Syntheses, Molecular Structures, and Spectroscopy of Gold(III) Dithiolate Complexes. Inorg. Chem. 1998, 37, 4625–4632. [Google Scholar] [CrossRef]
- Browne, A.R.; Deligonul, N.; Anderson, B.L.; Zeller, M.; Hunter, A.D.; Gray, T.G. Cyclometalated (boroxinato)gold(III) complexes from arrested transmetalation. Chem. Commun. 2015, 51, 15800–15803. [Google Scholar] [CrossRef]
- Kubo, K.; Nakano, M.; Tamura, H.; Matsubayashi, G.E.; Nakamoto, M. Preparation and oxidation of polarized Au(III) complexes having both the C-deprotonated-2-phenylpyridine (ppy) and a sulfur-rich dithiolate ligand and X-ray crystal structure of [Au(η2-C,N-ppy)-(η2-S,S-C8H4S8)]·0.5DMF. J. Organomet Chem. 2003, 669, 141–148. [Google Scholar] [CrossRef]
- Kubo, K.; Nakano, M.; Tamura, H.; Matsubayashi, G.E. X-ray Crystal Structure and Electrical Conductivity of [Au(ppy)(C8H4S8)]2[PF6] [ppy- = C-deprotonated 2-phenylpyridine(-); C8H4S82- = 2-{(4,5-ethylenedithio)-1,3-dithiol-2-ylidene}-1,3-dithiole-4,5-dithionate(2-)]. Eur. J. Inorg. Chem. 2003, 22, 4093–4098. [Google Scholar] [CrossRef]
- Kubo, K.; Nakao, A.; Ishii, Y.; Kato, R.; Matsubayashi, G.E. Structures and electrical conductivities of cation radical salts based on unsymmetrical [Au(III)(C-N)(S-S)] type dithiolate complexes. Synth. Met. 2005, 153, 425–428. [Google Scholar] [CrossRef]
- Henderson, W.; Nicholson, B.K.; Faville, S.J.; Fan, D.; Ranford, J.D. Gold(III) thiosalicylate complexes containing cycloaurated 2-arylpyridine, 2-anilinopyridine and 2-benzylpyridine ligands. J. Organomet. Chem. 2001, 631, 41–46. [Google Scholar] [CrossRef]
- Langseth, E.; Gorbitz, C.H.; Heyn, R.H.; Tilset, M. Versatile Methods for Preparation of New Cyclometalated Gold(III) Complexes. Organometallics 2012, 31, 6567–6571. [Google Scholar] [CrossRef] [Green Version]
- Hylland, K.T.; Schmidtke, I.L.; Wragg, D.S.; Nova, A.; Tilset, M. Synthesis of substituted (N,C) and (N,C,C) Au(III) complexes: The influence of sterics and electronics on cyclometalation reactions. Dalton Trans. 2022, 51, 5082–5097. [Google Scholar] [CrossRef]
- Venugopal, A.; Shaw, A.P.; Tornroos, K.W.; Heyn, R.H.; Tilset, M. Synthesis of a Coordinatively Labile Gold(III) Methyl Complex. Organometallics 2011, 30, 3250–3253. [Google Scholar] [CrossRef]
- Holmsen, M.S.M.; Nova, A.; Oien-Odegaard, S.; Heyn, R.H.; Tilset, M. A Highly Asymmetric Gold(III) η3-Allyl Complex. Angew. Chem. Int. Ed. 2020, 59, 1516–1520. [Google Scholar] [CrossRef] [PubMed] [Green Version]
- Witzel, S.; Holmsen, M.S.M.; Rudolph, M.; Dietl, M.C.; Oien-Odegaard, S.; Rominger, F.; Tilset, M.; Hashmi, A.S.K. Simple Mercury-Free Synthesis and Characterization of Symmetric and Unsymmetric Mono- and Dialkynyl (tpy)Au(III) Complexes. Organometallics 2020, 39, 2830–2837. [Google Scholar] [CrossRef]
- Langseth, E.; Nova, A.; Traseth, E.A.; Rise, F.; Oien, S.; Heyn, R.H.; Tilset, M. A Gold Exchange: A Mechanistic Study of a Reversible, Formal Ethylene Insertion into a Gold(III)−Oxygen Bond. J. Am. Chem. Soc. 2014, 136, 10104–10115. [Google Scholar] [CrossRef] [PubMed]
- Holmsen, M.S.M.; Ihlefeldt, F.S.; Oien-Odegaard, S.; Langseth, E.; Wencke, Y.; Heyn, R.H.; Tilset, M. Markovnikov at Gold: Nucleophilic Addition to Alkenes at Au(III). Organometallics 2018, 37, 1937–1947. [Google Scholar] [CrossRef]
- Holmsen, M.S.M.; Nova, A.; Balcells, D.; Langseth, E.; Oien-Odegaard, S.; Heyn, R.H.; Tilset, M.; Laurenczy, G. Trans-Mutation at Gold(III): A Mechanistic Study of a Catalytic Acetylene Functionalization via a Double Insertion Pathway. ACS Catal. 2017, 7, 5023–5034. [Google Scholar] [CrossRef] [Green Version]
- Holmsen, M.S.M.; Nova, A.; Balcells, D.; Langseth, E.; Oien-Odegaard, S.; Traseth, E.A.; Heyn, R.H.; Tilset, M. Small-molecule activation at Au(III): Metallacycle construction from ethylene, water, and acetonitrile. Dalton Trans. 2016, 45, 14719–14724. [Google Scholar] [CrossRef] [Green Version]
- Eppel, D.; Eryigit, A.; Rudolph, M.; Bruckner, M.; Rominger, F.; Asiri, A.M.; Hashmi, A.S.K. Mechanochemical Gold(III)-Carbon Bond Formation. Angew. Chem. Int. Ed. 2021, 60, 13636–13640. [Google Scholar] [CrossRef] [PubMed]
- Smith, T.S.; Lane, J.R.; Mucalo, M.R.; Henderson, W. Cycloaurated gold(III) complexes derived from the functionalised catecholate ligands alizarin and 3,4-dihydroxybenzaldehyde. Trans. Met. Chem. 2016, 41, 581–589. [Google Scholar] [CrossRef]
- Kilpin, K.J.; Henderson, W.; Nicholson, B.K. Organogold(III) complexes containing chelating bis(amidate) ligands: Synthesis, characterisation and biological activity. Polyhedron 2007, 26, 434–447. [Google Scholar] [CrossRef]
- Henderson, W.; Nicholson, B.K.; Wilkins, A.L. Facile syntheses of four-membered aurathietane dioxide [Au–CHR-SO2-CHR] ring systems, and the first isonitrile insertion reaction into a gold(III)–carbon bond. J. Organomet. Chem. 2005, 690, 4971–4977. [Google Scholar] [CrossRef]
- Dien, L.X.; Murayama, T.; Hung, N.T.; Truong, Q.D.; Chinh, H.D.; Yoshimura, M.; Haruta, M.; Ishida, T. Efficient non-volatile organogold complex for TiO2-supported gold cluster catalysts: Preparation and catalytic activity for CO oxidation. J. Catal. 2022, 408, 236–244. [Google Scholar] [CrossRef]
- Chambrier, I.; Hughes, D.L.; Jeans, R.J.; Welch, A.J.; Budzelaar, P.H.M.; Bochmann, M. Do Gold(III) Complexes Form Hydrogen Bonds? An Exploration of AuIII Dicarboranyl Chemistry. Chem. Eur. J. 2020, 26, 939–947. [Google Scholar] [CrossRef] [PubMed]
- Savjani, N.; Rosca, D.A.; Schormann, M.; Bochmann, M. Gold(III) Olefin Complexes. Angew. Chem. Int. Ed. 2013, 52, 874–877. [Google Scholar] [CrossRef]
- Rocchigiani, L.; Fernandez-Cestau, J.; Budzelaar, P.H.M.; Bochmann, M. Arene C–H activation by gold(III): Solvent-enabled proton shuttling, and observation of a pre-metallation Au–arene intermediate. Chem. Commun. 2017, 53, 4358–4361. [Google Scholar] [CrossRef] [Green Version]
- Rocchigiani, L.; Fernandez-Cestau, J.; Budzelaar, P.H.M.; Bochmann, M. Reductive Elimination Leading to C-C Bond Formation in Gold(III) Complexes: A Mechanistic and Computational Study. Chem. Eur. J. 2018, 24, 8893–8903. [Google Scholar] [CrossRef] [Green Version]
- Rocchigiani, L.; Fernandez-Cestau, J.; Chambrier, I.; Hrobarik, P.; Bochmann, M. Unlocking Structural Diversity in Gold(III) Hydrides: Unexpected Interplay of cis/trans-Influence on Stability, Insertion Chemistry, and NMR Chemical Shifts. J. Am. Chem. Soc. 2018, 140, 8287–8302. [Google Scholar] [CrossRef]
- Rocchigiani, L.; Budzelaar, P.H.M.; Bochmann, M. Heterolytic bond activation at gold: Evidence for gold(III) H–B, H–Si complexes, H–H and H–C cleavage. Chem. Sci. 2019, 10, 2633–2642. [Google Scholar] [CrossRef] [PubMed] [Green Version]
- Currie, L.; Rocchigiani, L.; Hughes, D.L.; Bochmann, M. Carbon–sulfur bond formation by reductive elimination of gold(III) thiolates. Dalton Trans. 2018, 47, 6333–6343. [Google Scholar] [CrossRef] [PubMed] [Green Version]
- Rocchigiani, L.; Fernandez-Cestau, J.; Agonigi, G.; Chambrier, I.; Budzelaar, P.H.M.; Bochmann, M. Gold(III) Alkyne Complexes: Bonding and Reaction Pathways. Angew. Chem. Int. Ed. 2017, 56, 13861–13865. [Google Scholar] [CrossRef] [PubMed] [Green Version]
- Smith, D.A.; Rosca, D.A.; Bochmann, M. Selective Au−C Cleavage in (C∧N∧C)Au(III) Aryl and Alkyl Pincer Complexes. Organometallics 2012, 31, 5998–6000. [Google Scholar] [CrossRef]
- Wong, B.Y.W.; Wong, H.L.; Wong, Y.C.; Au, V.K.M.; Chan, M.Y.; Yam, V.W.W. Multi-functional bis(alkynyl)gold(III) N^C complexes with distinct mechanochromic luminescence and electroluminescence properties. Chem. Sci. 2017, 8, 6936–6946. [Google Scholar] [CrossRef] [PubMed] [Green Version]
- Levchenko, V.; Oien-Odegaard, S.; Wragg, D.; Tilset, M. Crystal structure of (N^C) cyclometalated AuIII diazide at 100 K. Acta Cryst. E 2020, 76, 1725–1727. [Google Scholar] [CrossRef] [PubMed]
- Cinellu, M.A.; Zucca, A.; Stoccoro, S.; Minghetti, G.; Manassero, M.; Santoni, M. Synthesis and Characterization of Gold(III) Adducts and Cyclometallated Derivatives with 2-Substituted Pyridines. Crystal Structure of [Au{NC5H4(CMe2C2H4)-2}Cl2]. J. Chem. Soc. Dalton Trans. 1995, 2865–2872. [Google Scholar] [CrossRef]
- Niedzielska, D.; Pawlak, T.; Bozejewicz, M.; Wojtczak, A.; Pazderski, L.; Szlyk, E. Structural and spectroscopic studies of Au(III) and Pd(II) chloride complexes and organometallics with 2-benzylpyridine. J. Mol. Struct. 2013, 1032, 195–202. [Google Scholar] [CrossRef]
- Bertrand, B.; Spreckelmeyer, S.; Bodio, E.; Cocco, F.; Picquet, M.; Richard, P.; Le Gendre, P.; Orvig, C.; Cinellu, M.A.; Casini, A. Exploring the potential of gold(III) cyclometallated compounds as cytotoxic agents: Variations on the C^N theme. Dalton Trans. 2015, 44, 11911–11918. [Google Scholar] [CrossRef] [Green Version]
- De Paiva, R.E.F.; Du, Z.; Nakahata, D.H.; Lima, F.A.; Corbi, P.P.; Farrell, N.P. Gold-Catalyzed C–S Aryl-Group Transfer in Zinc Finger Proteins. Angew. Chem. Int. Ed. 2018, 57, 9305–9309. [Google Scholar] [CrossRef]
- Kim, J.H.; Mertens, R.T.; Agarwal, A.; Parkin, S.; Berger, G.; Awuah, S.G. Direct intramolecular carbon(sp2)–nitrogen(sp2) reductive elimination from gold(III). Dalton Trans. 2019, 48, 6273–6282. [Google Scholar] [CrossRef] [PubMed] [Green Version]
- Pettenuzzo, A.; Vezzu, K.; Di Paolo, M.L.; Fotopoulou, E.; Marchio, L.; Via, L.D.; Ronconi, L. Design, physico-chemical characterization and in vitro biological activity of organogold(III) glycoconjugates. Dalton Trans. 2021, 50, 8963–8979. [Google Scholar] [CrossRef] [PubMed]
- Zhu, Y.; Cameron, B.R.; Mosi, R.; Anastassov, V.; Cox, J.; Qin, L.; Santucci, Z.; Metz, M.; Skerlj, R.T.; Fricker, S.P. Inhibition of the cathepsin cysteine proteases B and K by square-planar cycloaurated gold(III) compounds and investigation of their anti-cancer activity. J. Inorg. Biochem. 2011, 105, 754–762. [Google Scholar] [CrossRef] [PubMed]
- Lin, Y.; Vong, K.; Matsuoka, K.; Tanaka, K. 2-Benzoylpyridine Ligand Complexation with Gold Critical for Propargyl Ester-Based Protein Labeling. Chem. Eur. J. 2018, 24, 10595–10600. [Google Scholar] [CrossRef]
- Fuchita, Y.; Ieda, H.; Tsunemune, Y.; Kinoshita-Nagaoka, J.; Kawano, H. Synthesis, structure and reactivity of a new six-membered cycloaurated complex of 2-benzoylpyridine [AuCl2(pcp-C1,N)] [pcp = 2-(2-pyridylcarbonyl)phenyl]. Comparison with the cycloaurated complex derived from 2-benzylpyridine. J. Chem. Soc. Dalton Trans. 1998, 791–796. [Google Scholar] [CrossRef]
- Niedzielska, D.; Pawlak, T.; Czubachowski, T.; Pazderski, L. 1H, 13C and 15N NMR studies of Au(III) and Pd(II) chloride complexes and organometallics with 2-acetylpyridine and 2-benzoylpyridine. J. Spectrosc. 2013, 2013, 982832. [Google Scholar] [CrossRef]
- Fuchita, Y.; Ieda, H.; Kayama, A.; Kinoshita-Nagaoka, J.; Kawano, H.; Kameda, S.; Mikuriya, M. Cycloauration of 2-substituted pyridine derivatives. Synthesis, structure and reactivity of six-membered cycloaurated complexes of 2-anilino-, 2-phenoxy- and 2-(phenylsulfanyl)-pyridine. J. Chem. Soc. Dalton Trans. 1998, 4095–4100. [Google Scholar] [CrossRef]
- Zhu, Y.; Cameron, B.R.; Skerlj, R.T. Cycloauration of substituted 2-phenoxypyridine derivatives and X-ray crystal structure of gold, dichloro-[2-[[5-[(cyclopentylamino)carbonyl]-2-pyridinyl-κN]oxy]phenyl-κC]-, (SP-4-3)-. J. Organomet. Chem. 2003, 677, 57–72. [Google Scholar] [CrossRef]
- Nonoyama, M.; Nakajima, K.; Nonoyama, K. Direct cycloauration of 2-anilinopyridine (Hanp) with tetrachloroaurate(III) and the X-ray crystal structure of [AuCl2(anp)]. Polyhedron 1997, 16, 4039–4044. [Google Scholar] [CrossRef]
- Bachmann, M.; Blacque, O.; Venkatesan, K. Harnessing White-Light Luminescence via Tunable Singlet-and Triplet-Derived Emissions Based on Gold(III) Complexes. Chem. Eur. J. 2017, 23, 9451–9456. [Google Scholar] [CrossRef]
- Cinellu, M.A.; Minghetti, G.; Pinna, M.V.; Stoccoro, S.; Zucca, A.; Manassero, M. Synthesis and Characterization of Mononuclear Amidogold(III) Complexes—Crystal Structure of [Au(N2C10H7(CMe2C6H4)-6](NHC6H3Me2-2,6)][PF6]—Oxidation of 4-Methylaniline to Azotoluene. Eur. J. Inorg. Chem. 2003, 2003, 2304–2310. [Google Scholar] [CrossRef]
- Gukathasan, S.; Parkin, S.; Awuah, S.G. Cyclometalated Gold(III) Complexes Bearing DACH Ligands. Inorg. Chem. 2019, 58, 9326–9340. [Google Scholar] [CrossRef]
- Mertens, R.T.; Parkin, S.; Awuah, S.G. Cancer cell-selective modulation of mitochondrial respiration and metabolism by potent organogold(III) dithiocarbamates. Chem. Sci. 2020, 11, 10465–10482. [Google Scholar] [CrossRef]
- Tang, H.; Saunders, G.C.; Henderson, W. Platinum(II), palladium(II), and gold(III) complexes of dianionic, secondary dithiooxamide ligands. J. Coord. Chem. 2019, 72, 2550–2561. [Google Scholar] [CrossRef]
- Bonsignore, R.; Thomas, S.R.; Rigoulet, M.; Jandl, C.; Pothig, A.; Bourissou, D.; Barone, G.; Casini, A. C-C Cross-Couplings from a Cyclometalated Au(III) C^N Complex: Mechanistic Insights and Synthetic Developments. Chem. Eur. J. 2021, 27, 14322–14334. [Google Scholar] [CrossRef] [PubMed]
- Goss, C.H.A.; Henderson, W.; Wilkins, A.L.; Evans, C. Synthesis, characterisation and biological activity of gold(III) catecholate and related complexes. J. Organomet. Chem. 2003, 679, 194–201. [Google Scholar] [CrossRef] [Green Version]
- Kilpin, K.J.; Henderson, W.; Nicholson, B.K. Synthesis, characterisation and biological activity of cycloaurated organogold(III) complexes with imidate ligands. Polyhedron 2007, 26, 204–213. [Google Scholar] [CrossRef]
- Risi, M.C.; Saunders, G.C.; Henderson, W. The coordination chemistry of sulfonyl-substituted thioureas towards the d8 metal centres platinum(II), palladium(II), nickel(II) and gold(III). Inorg. Chim. Acta 2021, 526, 120506. [Google Scholar] [CrossRef]
- Tang, H.; Saunders, G.C.; Ma, X.; Henderson, W. Pyrrole thioamide complexes of the d8 metals platinum(II), palladium(II) and gold(III). Inorg. Chim. Acta 2020, 502, 119282. [Google Scholar] [CrossRef]
- Finagenova, G.O.; Balashev, K.P. Mixed-Ligand Cyclometalated Pd(II) and Au(III) Complexes Based on 2-Benzylpyridine. Russ. J. Gen. Chem. 2008, 78, 682–684. [Google Scholar] [CrossRef]
- Smith, T.S.; Henderson, W.; Nicholson, B.K. Cycloaurated gold(III) complexes with monoanionic thiourea ligands. Inorg. Chim. Acta 2013, 408, 27–32. [Google Scholar] [CrossRef]
- Luo, Y.; Cao, B.; Zhong, M.; Liu, M.; Xiong, X.; Zou, T. Organogold(III) Complexes Display Conditional Photoactivities: Evolving From Photodynamic into Photoactivated Chemotherapy in Response to O2 Consumption for Robust Cancer Therapy. Angew. Chem. Int. Ed. 2022, 61, e202212689. [Google Scholar] [CrossRef]
- Ko, H.M.; Kung, K.K.Y.; Cui, J.F.; Wong, M.K. Bis-cyclometallated gold(III) complexes as efficient catalysts for synthesis of propargylamines and alkylated indoles. Chem. Commun. 2013, 49, 8869–8871. [Google Scholar] [CrossRef]
- Niedzielska, D.; Pazderski, L.; Wojtczak, A.; Kurzawa, M.; Scianowski, J.; Szlyk, E. Structural and spectroscopic studies of Au(III) chloride compounds with 7,8-benzoquinoline. Polyhedron 2018, 139, 155–171. [Google Scholar] [CrossRef]
- Serra, J.; Parella, T.; Ribas, X. Au(III)-aryl intermediates in oxidant-free C–N and C–O cross-coupling catalysis. Chem. Sci. 2017, 8, 946–952. [Google Scholar] [CrossRef] [PubMed] [Green Version]
- Serra, J.; Font, P.; Carrizo, E.D.S.; Mallet-Ladeira, S.; Massou, S.; Parella, T.; Miqueu, K.; Amgoune, A.; Ribas, X.; Bourissou, D. Cyclometalated gold(III) complexes: Noticeable differences between (N,C) and (P,C) ligands in migratory insertion. Chem. Sci. 2018, 9, 3932–3940. [Google Scholar] [CrossRef] [PubMed] [Green Version]
- Blons, C.; Mallet-Ladeira, S.; Amgoune, A.; Bourissou, D. (P,C) Cyclometalated Gold(III) Complexes: Highly Active Catalysts for the Hydroarylation of Alkynes. Angew. Chem. Int. Ed. 2018, 57, 11732–11736. [Google Scholar] [CrossRef]
- Bechu, D.; Petre, A.M.; Hosseini, M.W.; Baudron, S.A. Heterometallic coordination polymers based on homo- and heteroleptic Au(III) dithiolene complexes. CrystEngComm 2020, 22, 5760–5767. [Google Scholar] [CrossRef]
- Zhang, X.P.; Yang, G.; Wang, L.; Ng, S.W. Trichlorido(2-phenylpyridine-κN)-gold(III). Acta Cryst. E 2007, 63, m1582. [Google Scholar] [CrossRef]
- Mruk, J.; Pazderski, L.; Scianowski, J.; Wojtczak, A. Structural and NMR spectroscopic studies of 2-phenylsulfanylpyridine and its analogues or derivatives, and their Au(III) chloride complexes. Inorg. Chim. Acta 2020, 500, 119182. [Google Scholar] [CrossRef]
- Marek, R.; Lycka, A. 15N NMR Spectroscopy in Structural Analysis. Curr. Org. Chem. 2002, 6, 35–66. [Google Scholar] [CrossRef]
- Pazderski, L. 15N and 31P NMR coordination shifts in transition metal complexes with nitrogen- and phosphorus-containing heterocycles. Annu. Rep. NMR Spectrosc. 2013, 80, 33–180. [Google Scholar]
- Pazderski, L. 15N NMR coordination shifts in transition metal complexes and organometallics with heterocycles containing nitrogen—Update for 2012–2020. Annu. Rep. NMR Spectrosc. 2020, 101, 151–284. [Google Scholar]
Scheme 1.
Au(III)-2PPY* compounds (R1, R2—any substituents) with L1, L2 monodentate ligands (in particular—with X, Y halides) or L1L2 bidentate ligand.
Scheme 1.
Au(III)-2PPY* compounds (R1, R2—any substituents) with L1, L2 monodentate ligands (in particular—with X, Y halides) or L1L2 bidentate ligand.
Scheme 2.
Au(III)-2ArPY* compounds with 2ArPY* of the type A (Z = CH2 in 2-benzylpyridine*, CO in 2-benzoylpyridine*, O in 2-phenoxypyridine*, S in 2-phenylsulfanylpyridine*, NH in 2-anilinopyridine*; R1, R2—any substituents) with L1, L2 monodentate ligands (in particular—with X halides) or L1L2 bidentate ligand.
Scheme 2.
Au(III)-2ArPY* compounds with 2ArPY* of the type A (Z = CH2 in 2-benzylpyridine*, CO in 2-benzoylpyridine*, O in 2-phenoxypyridine*, S in 2-phenylsulfanylpyridine*, NH in 2-anilinopyridine*; R1, R2—any substituents) with L1, L2 monodentate ligands (in particular—with X halides) or L1L2 bidentate ligand.
Scheme 3.
Au(III)-2ArPY* compounds with 2ArPY* of the type B (2-(naphth-2-yl)pyridine*—(left), 2-(9,9-dialkylfluoren-2-yl)pyridines*—(middle), 2-(dibenzofuran-4-yl)pyridine*—(right) with L1, L2 monodentate ligands (in particular—with X halides) or L1L2 bidentate ligand.
Scheme 3.
Au(III)-2ArPY* compounds with 2ArPY* of the type B (2-(naphth-2-yl)pyridine*—(left), 2-(9,9-dialkylfluoren-2-yl)pyridines*—(middle), 2-(dibenzofuran-4-yl)pyridine*—(right) with L1, L2 monodentate ligands (in particular—with X halides) or L1L2 bidentate ligand.
Scheme 4.
Au(III)-ArPY#* compounds with 2-arylpyridines analogues: 2-phenylquinoline* (top left), 1-phenylisoquinoline* (top right), 3-phenylisoquinoline* (bottom left), 7,8-benzoquinoline* (bottom right) with L1, L2 monodentate ligands (in particular—with X halides) or L1L2 bidentate ligand (the latter case is omitted for clarity).
Scheme 4.
Au(III)-ArPY#* compounds with 2-arylpyridines analogues: 2-phenylquinoline* (top left), 1-phenylisoquinoline* (top right), 3-phenylisoquinoline* (bottom left), 7,8-benzoquinoline* (bottom right) with L1, L2 monodentate ligands (in particular—with X halides) or L1L2 bidentate ligand (the latter case is omitted for clarity).
Scheme 5.
Annual numbers of Au(III) compounds with 2ppy*, 2PPY*, 2ArPY*, and ArPY#*, for which the single crystal X-ray structures were published in the years 1995–2022.
Scheme 5.
Annual numbers of Au(III) compounds with 2ppy*, 2PPY*, 2ArPY*, and ArPY#*, for which the single crystal X-ray structures were published in the years 1995–2022.
Table 1.
NMR and/or X-ray studied [Au(2PPY*)XY] (in particular, [Au(2PPY*)X2]) dihalides (2PPY* = a-R1-2-(b-R2-phenyl)pyridine*, where R1 and R2 are substituents in the pyridine ring and the phenyl ring, respectively, a = 3–6, b = 2–5; X, Y = F, Cl, Br, I).
Table 1.
NMR and/or X-ray studied [Au(2PPY*)XY] (in particular, [Au(2PPY*)X2]) dihalides (2PPY* = a-R1-2-(b-R2-phenyl)pyridine*, where R1 and R2 are substituents in the pyridine ring and the phenyl ring, respectively, a = 3–6, b = 2–5; X, Y = F, Cl, Br, I).
| R1 | R2 | X | Y | NMR Solvent | X-ray (CCDC) | Activity $ |
|---|---|---|---|---|---|---|
| H | H | Cl | Cl | DMSO-d6 [1,2,3,4,5,6,7,8,9,10] | IJAQEP [3] | CAT [16,17] |
| 3-methyl | H | Cl | Cl | DMSO-d6 [10] | ||
| 4-n-propyl | H | Cl | Cl | DMSO-d6 [2] | ||
| 5-n-butyl | H | Cl | Cl | DMSO-d6 [11] | ||
| H | 2-methyl | Cl | Cl | DMSO-d6 [10] | ||
| H | 2-methyl | Br | Br | JOTQOA [12] a | ||
| H | 3-methyl | Cl | Cl | DMSO-d6 [10] | ||
| H | 4-methyl | Cl | Cl | DMSO-d6 [5,8,9,10,13] | CAT [17] | |
| H | 3-n-butyl | Cl | Cl | DMSO-d6 [11] | ||
| H | 4-tert-butyl | Cl | Cl | DMSO-d6 [10] | BIO1 [25,26] | |
| H | 2-fluoro | Cl | Cl | DMSO-d6 [10] | ||
| H | 4-fluoro | Cl | Cl | DMSO-d6 [10,14] | FOPBUJ [14] | |
| H | 2,4-difluoro | Cl | Cl | DMSO-d6 [15] | HOSHOO [16] | CAT [16] |
| H | 4-chloro | Cl | Cl | DMSO-d6 [17] | CAT [17] | |
| H | 3-trifluoromethyl | Cl | Cl | CD2Cl2 DMSO-d6 [10,18] | ||
| H | 4-trifluoromethyl | Cl | Cl | DMSO-d6 [10,18] | ||
| H | 3-methoxy | Cl | Cl | DMSO-d6 [10] | ||
| H | 4-methoxy | Cl | Cl | DMSO-d6 [17] | CAT [17] | |
| H | 4-n-butoxy | Cl | Cl | DMSO-d6 [11] | ||
| H | 3,5-dimethoxy | Cl | Cl | DMSO-d6 [10] | ||
| H | 2-trifluoromethoxy | Cl | Cl | CD2Cl2 [18] | MIYYUR [18] | |
| H | 4-trifluoromethoxy | Cl | Cl | DMSO-d6 [18] | ||
| H | 4-formyl | Cl | Cl | DMSO-d6 [8,9] | ||
| H | 2-phenyl | Cl | Cl | DMSO-d6 [10] | ||
| H | 3-phenyl | Cl | Cl | DMSO-d6 [10] | ||
| H | 4-phenyl | Cl | Cl | DMSO-d6 [10,19] | ||
| H | 4-(9-bromo-n-nonoxy) | Cl | Cl | CDCl3 [20] | ||
| H | 4-(9-trimethylammonio-n-nonoxy) 1 | Cl | Cl | CD3OD [20] | ||
| H | 4-(9-(4-methylphenylsulfonoxy)-n-nonoxy) | Cl | Cl | CD2Cl2 [20] | ||
| 3-methyl | 2-fluoro | F | F | CD2Cl2 [21] | DAJRAK [21] | |
| 3-methyl | 2-fluoro | Cl | Cl | CD2Cl2 [21] | DAJQOX [21] | |
| 3-methyl | 3,4,5-trimethoxy | F | F | CD2Cl2 [21] | DAJREO [21] | |
| 3-methyl | 3,4,5-trimethoxy | Cl | Cl | CD2Cl2 [21] | DAJQUD [21] | |
| 5-carboxy | 4-carboxy | Cl | Cl | DMSO-d6 [22,23] | GAKZUR [22] b | CAT [22] |
| 5-carboxy | 4-carboxy | Br | Br | DMSO-d6 [23] | VUVLAC [23] b | |
| 5-carboxy | 4-carboxy | I | I | DMSO-d6 [23] | VUVKUV [23] b | |
| 5-carboxy | 4-carboxy | Cl 2 | I 2 | DMSO-d6 DMF-d7 [23] | VUVKOP [23] b | |
| 5-carboxy | 4-carboxy | Br 2 | I 2 | DMSO-d6 DMF-d7 [23] | VUVLEG [23] b | |
| 5-ethoxycarbonyl | 4-ethoxycarbonyl | Cl | Cl | CDCl3 DMSO-d6 [22,23] | CAT [22] | |
| 5-ethoxycarbonyl | 4-ethoxycarbonyl | Br | Br | CD2Cl2 DMSO-d6 [23] | ||
| 5-ethoxycarbonyl | 4-ethoxycarbonyl | I | I | CD2Cl2 DMSO-d6 [23] | ||
| 4-dimethylamino | 2,3,4-trifluoro | Cl | Cl | CD2Cl2 [24] | ||
| 4-dimethylamino | 3-trifluoromethyl | Cl | Cl | CD2Cl2 [24] | ||
| 4-dimethylamino | 4-trifluoromethoxy | Cl | Cl | CD2Cl2 [24] |
$ Types of activity: BIO—biological (BIO1—anti-tumour, BIO2—anti-microbial, i.e., anti-bacterial and/or anti-fungal); CAT—catalytic; LUM—luminescence (LUM1—with t > 10 µs, LUM2—with t < 10 µs). 1 this substituent is positively charged at the trimethylammonium moiety, so the whole [Au(2PPY*)Cl2] compound is cationic (+1), appearing with the respective counterion (Br− or p-CH3C6H4SO3− anion) and forming the bromide or 4-methylphenylsulfonate (tosylate) salt. 2 these mixed chloride-iodide and bromide-iodide ([Au(2PPY*)ClI], [Au(2PPY*)BrI]) compounds have trans(I,N) geometry. a monohydrate. b dimethyl sulfoxide solvate.
Table 2.
NMR and/or X-ray studied [Au(2ppy*)L1L2] (in particular, [Au(2ppy*)L2]) and [Au(2ppy*)(L1L2)] (in particular, [Au(2ppy*)(LL)]) compounds (L1, L2, L—monodentate ligands other than F, Cl, Br, I; L1L2, LL—bidentate ligands).
Table 2.
NMR and/or X-ray studied [Au(2ppy*)L1L2] (in particular, [Au(2ppy*)L2]) and [Au(2ppy*)(L1L2)] (in particular, [Au(2ppy*)(LL)]) compounds (L1, L2, L—monodentate ligands other than F, Cl, Br, I; L1L2, LL—bidentate ligands).
| L1 | L2 | L1L2 | Counterion | NMR Solvent | X-ray (CCDC) | Geometry | Activity $ |
|---|---|---|---|---|---|---|---|
| CN | CN | DMSO-d6 [27] | DUZCOS [27] | LUM2 [27] | |||
| SCN | NCS | DMSO-d6 [28] | ILETOI [28] | trans(S,N) | BIO1 [28] | ||
| ethane-1,2-dithiolate | CDCl3 [2] | ||||||
| propan-1-ol-2,3-dithiolate | DMSO-d6 [28] | BIO1 [28] | |||||
| 1,4,7-trithiacyclononane-κ3-S,S,S | 2PF6− | CD3NO2 [5] | MOCFOB [5] | ||||
| propan-2-one-1-yl | Cl | BIGRAL [29] | trans(C,N) | ||||
| propan-2-one-1-yl | NO3 | DMSO-d6 [29] | BIGREP [29] | trans(C,N) | |||
| n-pentane-2,4-dione-3-yl | Cl | CDCl3 [30] | |||||
| acetate | acetate | CDCl3 DMSO-d6 [3,31] | IJAQIT [3] a DUNCAT [31] | BIO1 [3,31] | |||
| malonate | DMSO-d6 [3] | BIO1 [3] | |||||
| cyclobutane-1,1-dicarboxylate | DMSO-d6 [3] | IJAQUF [3] | BIO1 [3] | ||||
| 2-thiolatepropionate | DMSO-d6 [28] | BIO1 [28] | |||||
| 2,3-dithiolatesuccinic acid | DMSO-d6 [28] | BIO1 [28] | |||||
| ethane-1-amine-2-thiolate | B(C6H5)4− | DMSO-d6 [2] | |||||
| ethane-1,2-diamine | 2ClO4− | CD3OD [32] | |||||
| dimethylaminocarbodithioate | PF6− | DMSO-d6 [2] | |||||
| diethylaminocarbodithioate | B(C6H5)4− PF6− | DMSO-d6 [2,11] | MAXQOR [2] | BIO1 [11] | |||
| di(n-butyl)aminocarbodithioate | PF6− | DMSO-d6 [11] | BIO1 [11] | ||||
| 1,1-dimethylbiguanidate | Cl− PF6− | D2O DMSO-d6 [8,33] | REBLET [8] CEWGOE [33] b | BIO1 [8,33] | |||
| 2-amine-3-thiolatepropionate & 2-amine-3-thiolatepropionic acid 1A | NO3− | CD3OD [34] | LORCOM [34] c | trans(S,N) | |||
| 2-amine-3-methyl-3-thiolatebutyrate | CD3OD [34] | LORCEC [34] d | trans(S,N) | ||||
| 2-amine-3-methyl-3-thiolatebutyrate & 2-amine-3-methyl-3-thiolatebutyric acid 1B | NO3− | CD3OD [34] | LORCIG [34] e | trans(S,N) | |||
| trimethylphosphine | Cl | BF4− | CD3COCD3 [35] | QUNSIE [35] | trans(P,N) | ||
| tricyclohexylphosphine | Cl | BF4− | CD2Cl2 [36] | IVAYUB [36] f | trans(P,N) | ||
| trimethylsilylethynyl | trimethylsilylethynyl | CD2Cl2 [37] | LUM1 [37] | ||||
| triisopropylsilylethynyl | triisopropylsilylethynyl | CD2Cl2 [15] | IZOSUM [15] | LUM2 [15] | |||
| phenyl | phenyl | CDCl3 [38] | EWOJUW [38] f | LUM2 [38] | |||
| 1,1′-biphen-2,2′-diyl | CD2Cl2 [38] | EWOJOQ [38] | LUM2 [38] | ||||
| phenylethynyl | phenylethynyl | CDCl3 [15] | IZOSOG [15] | LUM2 [15] | |||
| 4-ethylphenylethynyl | 4-ethylphenylethynyl | CDCl3 [37] | LUM1 [37] | ||||
| 4-(phenylethynyl)phenylethynyl | 4-(phenylethynyl)phenylethynyl | CDCl3 [15] | LUM1 [15] | ||||
| bis(2-acetylidephenyl)acetylene | DMSO-d6 [39] | LUM1 [39] | |||||
| 4-fluorophenylethynyl | 4-fluorophenylethynyl | CD2Cl2 CD3CN [15,40] | IZOTIB [15] f | LUM2 [15] | |||
| pentafluorophenyl | pentafluorophenyl | CDCl3 [38] | LUM2 [38] | ||||
| 4-trifluoromethylphenyl | 4-trifluoromethylphenyl | CD2Cl2 [38] | EWOKAD [38] f | LUM2 [38] | |||
| 4-trifluoromethylphenylethynyl | 4-trifluoromethylphenylethynyl | CD2Cl2 [37] | LUM1 [37] | ||||
| 2,4,6-tris(trifluoromethyl)phenyl | Cl | CD2Cl2 [41] | GIVRIO [41] | trans(C,N) | LUM2 [41] | ||
| 2,4,6-tris(trifluoromethyl)phenyl | I | CD2Cl2 [41] | GIVSOV [41] | trans(C,N) | LUM2 [41] | ||
| 2,4,6-tris(trifluoromethyl)phenyl | CN | CD2Cl2 [41] | GIVSEL [41] | trans(Cphenyl,N) | LUM2 [41] | ||
| 2,4,6-tris(trifluoromethyl)phenyl | H2O | CF3SO3− | CD2Cl2 [42] | XOLCEI [42] | trans(C,N) | BIO1 [43] CAT [42] LUM1 [42] | |
| 2,4,6-tris(trifluoromethyl)phenyl | OH | CD2Cl2 [43] | FONDIX [43] | trans(C,N) | BIO1 [43] | ||
| 2,4,6-tris(trifluoromethyl)phenyl | trifluoroacetate | CD2Cl2 [43] | FONCIW [43] f | trans(C,N) | BIO1 [43] | ||
| 2,4,6-tris(trifluoromethyl)phenyl | 4-fluoroaniline | CF3SO3− | CD2Cl2 [42] | XOLCUY [42] f | trans(C,N2ppy) | CAT [42] LUM1 [42] | |
| 2,4,6-tris(trifluoromethyl)phenyl | 4-phenylpyridine | CF3SO3− | CD2Cl2 [42] | XOLCIM [42] | trans(C,N2ppy) | BIO1 [43] CAT [42] LUM1 [42] | |
| 2,4,6-tris(trifluoromethyl)phenyl | quinoline | CF3SO3− | CD2Cl2 [42] | XOLCOS [42] | trans(C,N2ppy) | BIO1 [43] CAT [42] LUM1 [42] | |
| 2,4,6-tris(trifluoromethyl)phenyl | phenylethynyl | CD2Cl2 [41] | GIVSUB [41] | trans(Cphenyl,N) | LUM2 [41] | ||
| 2,4,6-tris(trifluoromethyl)phenyl | 4-diphenylaminophenylethynyl | CD2Cl2 [41] | LUM2 [41] | ||||
| 2,4,6-tris(trifluoromethyl)phenyl | trimethyl phosphite | CF3SO3− | CD2Cl2 [42] | XOLDAF [42] g | trans(C,N) | CAT [42] LUM1 [42] | |
| 2,4,6-tris(trifluoromethyl)phenyl | triphenylphosphine | CF3SO3− | CD2Cl2 [42] | XOLDEJ [42] f | trans(C,N) | BIO1 [43] CAT [42] LUM1 [42] | |
| 4-methoxyphenylethynyl | 4-methoxyphenylethynyl | CDCl3 [37] | AJOWUS [37] | LUM1 [37] | |||
| 3,4,5-trimethoxyphenylethynyl | 3,4,5-trimethoxyphenylethynyl | CD2Cl2 [15] | IZOTOH [15] | ||||
| 1,1′-biphenyl-2,2′-diolate | CD2Cl2 [44] | ||||||
| 1,1′-binaphthyl-2-one-2′-olate-1-yl | CDCl3 [45] | R/S | |||||
| toluene-3,4-dithiolate | DMSO-d6 [46] | HIRZIR [46] | |||||
| benzoate | benzoate | DMSO-d6 [3] | IJAQOZ [3] h | BIO1 [3] | |||
| 2-thiolatebenzoate | DMSO-d6 [28] | ILETIC [28] i | trans(S,N) | BIO1 [28,51] | |||
| 1-phenylbiguanidate | Cl− | DMSO-d6 [8] | BIO1 [8] | ||||
| 1-(2-phenylethyl)biguanidate | PF6− | DMSO-d6 [33] | BIO1 [33] | ||||
| 4-aminophenylethynyl | 4-aminophenylethynyl | DMSO-d6 [37] | LUM1 [37] | ||||
| L-cysteinate | 1/2 Cl− 1/2 ClO4− | DMSO-d6 [28] | ILETEY [28] g | trans(S,N) | |||
| L-phenylalaninate | Cl− | CDCl3 [31] | BIO1 [31] | ||||
| L-methioninate | Cl− | CDCl3 [31] | BIO1 [31] | ||||
| N-acetyl-L-cysteinate | Cl | AZOKUY [30] | trans(S,N) | ||||
| 2,2′-bipyridine | 2Cl− | CD3OD [32] | |||||
| 2,3-bis(pyridin-2-yl)-6,7-dimethylquinoxaline | 2Cl− | CD3CN [32] | |||||
| thiophen-2-yl | thiophen-2-yl | CDCl3 [38] | EWOKEH [38] | LUM2 [38] | |||
| thiophen-2-ylethynyl | thiophen-2-ylethynyl | CDCl3 [15] | |||||
| 1,3-bis(2,6-diisopropylphenyl)imidazol-2-ylidene | Cl | Cl− BF4− | CDCl3 CD2Cl2 CD3COCD3 [7,36] | CAT [7] | |||
| 1,3-bis(2,6-diisopropylphenyl)imidazol-2-ylidene | H2O | 2BF4− | CD2Cl2 [7] | ||||
| 1,3-dicyclohexylimidazol-2-ylidene | Cl | BF4− | CD3COCD3 [36] | IVAZAI [36] | trans(C,N) | ||
| 1,3-bis(2,4,6-trimethylphenyl)imidazol-2-ylidene | Cl | BF4− | CD2Cl2 [36] | ||||
| 1,3-bis(2,4,6-trimethylphenyl)imidazolin-2-ylidene | Cl | BF4− | CD2Cl2 [36] | ||||
| methylenebis(3-methyl-1H-imidazol-1-yl-2-ylidene) | 2PF6− | CD3CN [19] | LUM1 [19] | ||||
| methylenebis(3-n-butyl-1H-imidazol-1-yl-2-ylidene) | 2PF6− | CD3CN [19] | LUM1 [19] | ||||
| methylenebis(3-(3-sulfonate-n-propyl)-1H-imidazol-1-yl-2-ylidene) | D2O [19] | LUM1 [19] | |||||
| 1,2-ethylenebis(3-n-butyl-1H-imidazol-1-yl-2-ylidene) | 2PF6− | CD3CN [19] | LUM1 [19] | ||||
| 1,3-propylenebis(3-n-butyl-1H-imidazol-1-yl-2-ylidene) | 2PF6− | CD3CN [19] | LUM1 [19] | ||||
| 3,3′-bis(trifluoromethyl)-5,5′-bipyrazolate | DMSO-d6 [6] | ||||||
| 1,1-dimethylmethylenebis(3-trifluoromethylpyrazol-5-ylate) | CD2Cl2 [6] | ||||||
| triphenylphosphine | Cl | CF3SO3− BF4− | CDCl3 CD3CN [7,36] | IVAYOV [36] | trans(P,N) | CAT [7] | |
| triphenylphosphine | FBF3 | BF4− | IVAZEM [36] f | trans(P,N) | |||
| triphenylphosphine | H2O | 2BF4− | CD2Cl2 [36] | ||||
| P(4-trifluoromethylphenyl)3 | Cl | BF4− | CD2Cl2 [36] | ||||
| P(4-methoxyphenyl)3 | Cl | BF4− | CD3CN [36] | ||||
| 1,2-bis(diphenylphosphino)benzene 2 | 2Cl− | CDCl3 [9] | BIO1 [9] | ||||
| benzene-1-(diphenylphosphine)-2-thiolate | B(C6H5)4− | DMSO-d6 [2] | MAXQIL [2] | trans(P,N) | |||
| oxybis(4-isopropoxyphenylborinate) | CDCl3 [47] | ||||||
| 2-((4,5-ethylenedithio)-1,3-dithiole-2-ylidene)-1,3-dithiole-4,5-dithiolate | DMSO-d6 [48] | TAFJEQ [48] j | |||||
| 2-((4,5-ethylenedithio)-1,3-dithiole-2-ylidene)-1,3-dithiole-4,5-dithiolate & 2-((4,5-ethylenedithio)-1,3-dithiole-2-ylidene)-1,3-dithiole-4-thione-5-thiolate 3A | PF6− AsF6− TaF6− | AMEXIZ [49] YEDPUT [50] k YEDQAA [50] k | |||||
| 2-((4,5-ethylenedioxy)-1,3-dithiole-2-ylidene)-1,3-dithiole-4,5-dithiolate | DMSO-d6 [50] | ||||||
| 2-((4,5-ethylenedioxy)-1,3-dithiole-2-ylidene)-1,3-dithiole-4,5-dithiolate & 2-((4,5-ethylenedioxy)-1,3-dithiole-2-ylidene)-1,3-dithiole-4-thione-5-thiolate 3B | BF4− | YEDPON [50] | |||||
| 2-(bis(n-decylthio)-1,3-dithiole-2-ylidene)-1,3-dithiole-4,5-dithiolate | CDCl3 [48] |
$ Types of activity: BIO—biological (BIO1—anti-tumour, BIO2—anti-microbial, i.e., anti-bacterial and/or anti-fungal); CAT—catalytic; LUM—luminescence (LUM1—with t > 10 µs, LUM2—with t < 10 µs). 1A–1B These compounds contain two types of [Au(2ppy*)(L1L2)] species: [Au(2ppy*)(2-amine-3-thiolatepropionate)] (1A) or [Au(2ppy*)(2-amine-3-methyl-3-thiolatebutyrate)] (1B) neutral molecule and [Au(2ppy*)(2-amine-3-thiolatepropionic acid)]+ (1A) or [Au(2ppy*)(2-amine-3-methyl-3-thiolatebutyric acid)]+ (1B) cation, together with NO3− anion. 2 It is unclear whether this compound should be regarded as [Au(2ppy*)(1,2-bis(diphenylphosphino)benzene)]Cl2 or rather [Au(2ppy$)(1,2-bis(diphenylphosphino)benzene)Cl]Cl (2ppy$ = monoanionic form of 2ppy, deprotonated and binding monodentately by C(2′)). 3A–3B These compounds contain two types of [Au(2ppy*)(L1L2)] species: [Au(2ppy*)(2-((4,5-ethylenedithio)-1,3-dithiole-2-ylidene)-1,3-dithiole-4,5-dithiolate)] (3A) or [Au(2ppy*)(2-((4,5-ethylenedioxy)-1,3-dithiole-2-ylidene)-1,3-dithiole-4,5-dithiolate)] (3B) neutral molecule and [Au(2ppy*)(2-((4,5-ethylenedithio)-1,3-dithiole-2-ylidene)-1,3-dithiole-4-thione-5-thiolate)]+ (3A) or [Au(2ppy*)(2-((4,5-ethylenedioxy)-1,3-dithiole-2-ylidene)-1,3-dithiole-4-thione-5-thiolate)]+ (3B) cation, together with PF6−, AsF6−, TaF6− (all 3A), or BF4− anion. a monohydrate. b methanol solvate. c trihydrate. d dihydrate. e methanol solvate dihydrate. f dichloromethane solvate. g hemihydrate. h diethyl ether solvate. i sesquihydrate j dimethylformamide solvate. k chlorobenzene solvate.
Table 7.
Au–N and Au–C bond lengths [Å], as well as N–Au–C bond angles [°] in Au(III)-2PPY* (including Au(III)-2ppy*), Au(III)-2ArPY*, and Au(III)-ArPY#* compounds.
Table 7.
Au–N and Au–C bond lengths [Å], as well as N–Au–C bond angles [°] in Au(III)-2PPY* (including Au(III)-2ppy*), Au(III)-2ArPY*, and Au(III)-ArPY#* compounds.
| X-ray (CCDC) | Au–N | Au–C | N–Au–C | Element Trans to N | Element Trans to C |
|---|---|---|---|---|---|
| [Au(2PPY*)XY] (2PPY* = a-R1-2-(b-R2-phenyl)pyridine*, a = 3–6, b = 2–5; X, Y = F, Cl, Br, I) | |||||
| IJAQEP [3] | 2.03(1) | 1.95(2) | 83.0(6) | Cl | Cl |
| JOTQOA [12] | 2.04(1) | 2.05(1) | 80.9(5) | Br | Br |
| FOPBUJ [14] | 2.037(6) | 2.026(5) | 81.8(2) | Cl | Cl |
| HOSHOO [16] | 2.015(8) | 2.02(1) | 82.0(4) | Cl | Cl |
| MIYYUR [18] | 2.034(5) | 2.020(5) | 81.3(2) | Cl | Cl |
| DAJRAK [21] | 1.975(5) | 1.967(5) | 81.6(2) | F | F |
| DAJQOX [21] | 2.036(3) | 2.021(4) | 80.8(1) | Cl | Cl |
| DAJREO [21] | 1.977(3) | 1.983(5) | 81.2(2) | F | F |
| DAJQUD [21] | 2.034(7) 2.031(8) | 2.02(1) 2.032(9) | 80.7(3) 81.0(3) | Cl | Cl |
| GAKZUR [22] | 2.041(2) | 2.025(2) | 81.63(7) | Cl | Cl |
| VUVLAC [23] | 2.066(3) | 2.045(3) | 81.6(1) | Br | Br |
| VUVKUV [23] | 2.069(7) | 2.05(1) | 80.0(4) | I | I |
| VUVKOP [23] | 2.08(2) | 2.04(2) | 82.8(6) | I | Cl |
| VUVLEG [23] | 2.084(3) | 2.028(4) | 80.9(1) | I | Br |
| [Au(2ppy*)L1L2] and [Au(2ppy*)(L1L2)] (L1, L2 ≠ F, Cl, Br, I) | |||||
| DUZCOS [27] | 2.051(4) | 2.042(5) | 81.4(2) | C | C |
| ILETOI [28] | 2.064(6) | 2.012(9) | 81.4(4) | S | N |
| MOCFOB [5] | 2.068(5) | 2.057(5) | 81.2(2) | S | S |
| BIGRAL [29] | 2.111(5) | 2.018(7) | 81.1(2) | C | Cl |
| BIGREP [29] | 2.114(3) | 2.004(4) | 81.8(2) | C | O |
| IJAQIT [3] | 2.028(8) | 2.005(8) | 81.6(3) | O | O |
| DUNCAT [31] | 2.014(5) | 1.998(5) | 81.4(2) | O | O |
| IJAQUF [3] | 2.002(4) | 1.999(4) | 81.3(2) | O | O |
| MAXQOR [2] | 2.06(1) | 2.04(2) | 82.2(5) | S | S |
| REBLET [8] | 2.042(4) 2.036(6) | 2.035(5) 2.032(7) | 81.3(2) 81.5(3) | N | N |
| CEWGOE [33] | 2.038(2) | 2.021(2) | 81.16(9) | N | N |
| LORCOM [34] | 2.053(6) 2.061(6) | 1.976(8) 2.022(6) | 81.9(3) 79.8(3) | S | N |
| LORCEC [34] | 2.074(4) | 2.029(5) | 81.6(2) | S | N |
| LORCIG [34] | 2.083(5) | 2.010(5) | 81.1(3) | S | N |
| QUNSIE [35] | 2.102(2) | 2.044(3) | 81.1(1) | P | Cl |
| IVAYUB [36] | 2.119(3) | 2.042(3) | 80.7(1) | P | Cl |
| IZOSUM [15] | 2.051(2) | 2.052(2) | 80.33(9) | C | C |
| EWOJUW [38] | 2.111(2) | 2.066(2) | 80.02(7) | C | C |
| EWOJOQ [38] | 2.125(2) | 2.089(3) | 79.4(1) | C | C |
| IZOSOG [15] | 2.060(2) | 2.038(2) | 81.33(8) | C | C |
| IZOTIB [15] | 2.059(2) 2.068(2) | 2.039(2) 2.043(2) | 80.95(9) 81.00(9) | C | C |
| EWOKAD [38] | 2.080(4) | 2.087(3) | 79.8(1) | C | C |
| GIVRIO [41] | 2.083(2) | 2.018(3) | 81.5(1) | C | Cl |
| GIVSOV [41] | 2.100(3) | 2.037(4) | 80.9(1) | C | I |
| GIVSEL [41] | 2.085(3) | 2.038(2) | 81.0(1) | C | C |
| XOLCEI [42] | 2.076(3) | 2.006(3) | 82.1(1) | C | O |
| FONDIX [43] | 2.067(3) | 2.015(3) | 81.6(1) | C | O |
| FONCIW [43] | 2.077(6) | 2.006(6) | 82.1(2) | C | O |
| XOLCUY [42] | 2.096(2) | 2.017(2) | 81.60(9) | C | N |
| XOLCIM [42] | 2.075(4) | 2.025(7) | 82.5(2) | C | N |
| XOLCOS [42] | 2.075(3) | 2.016(3) | 81.6(1) | C | N |
| GIVSUB [41] | 2.086(3) | 2.052(3) | 80.8(1) | C | C |
| XOLDAF [42] | 2.085(4) | 2.063(5) | 80.9(2) | C | P |
| XOLDEJ [42] | 2.102(3) | 2.051(3) | 81.0(1) | C | P |
| AJOWUS [37] | 2.13(3) 2.19(5) | 1.95(2) 1.87(8) | 82(1) 81(3) | C | C |
| IZOTOH [15] | 2.057(1) | 2.038(1) | 80.89(5) | C | C |
| HIRZIR [46] | 2.079(6) | 2.035(7) | 81.1(3) | S | S |
| IJAQOZ [3] | 2.007(8) | 2.001(9) | 81.8(4) | O | O |
| ILETIC [28] | 2.073(6) | 1.998(8) | 81.6(3) | S | O |
| ILETEY [28] | 2.087(6) 2.095(6) | 2.008(9) 2.020(9) | 80.4(3) 81.2(3) | S | N |
| AZOKUY [30] | 2.091(5) 2.088(5) | 2.035(7) 2.033(7) | 81.1(3) 81.1(3) | S | Cl |
| EWOKEH [38] | 2.097(3) 2.090(3) | 2.069(4) 2.051(3) | 80.8(1) 80.5(1) | C | C |
| IVAZAI [36] | 2.06(2) 2.07(2) | 2.05(1) 2.03(2) | 80.9(9) 82(1) | C | Cl |
| IVAYOV [36] | 2.100(2) | 2.045(2) | 80.83(7) | P | Cl |
| IVAZEM [36] | 2.092(5) | 2.044(6) | 82.0(2) | P | F |
| MAXQIL [2] | 2.08(2) 2.08(2) | 2.02(2) 2.04(2) | 79.9(9) 79.3(9) | P | S |
| TAFJEQ [48] | 2.063(2) | 2.042(5) | 80.6(2) | S | S |
| AMEXIZ [49] | 2.070(6) 2.066(7) | 2.053(7) 2.034(6) | 81.1(3) 80.4(2) | S | S |
| YEDPUT [50] | 2.08(1) 2.06(2) 1.98(2) 2.07(2) | 2.09(1) 2.08(1) 2.10(2) 2.07(1) | 82.0(6) 82.1(6) 79.8(7) 80.5(6) | S | S |
| YEDQAA [50] | 2.06(1) 2.10(1) 2.09(1) 2.048(9) | 2.08(1) 2.07(1) 2.08(1) 2.09(1) | 81.3(4) 81.4(5) 82.1(5) 81.0(4) | S | S |
| YEDPON [50] | 2.078(9) 2.076(9) | 2.064(9) 2.055(9) | 81.9(3) 80.2(3) | S | S |
| [Au(2PPY*)L1L2] and [Au(2PPY*)(L1L2)] (L1, L2 ≠ F, Cl, Br, I) | |||||
| MAXQEH [2] | 2.01(2) | 2.01(2) | 79.5(8) | N | O |
| JOTROB [12] | 2.12(1) | 2.021(7) | 80.5(3) | C | Br |
| QICNUN [52] | 2.130(3) | 2.062(3) | 80.0(1) | C | C |
| ROVXUY [55] | 2.12(2) | 2.04(2) | 80.9(7) | C | C |
| ROVYAF [55] | 2.11(3) | 2.02(4) | 82(1) | C | Br |
| LUWJUL [56] | 2.04 | 2.03 | 80.6 | C | C |
| MOCFIV [5] | 2.063(4) | 2.043(4) | 81.2(2) | S | S |
| IDAJII [54] | 2.117(2) | 2.001(2) | 81.36(8) | C | O |
| QICPAV [52] | 1.991(6) | 1.995(8) | 81.8(3) | O | O |
| YIDHIF [58] | 2.09(1) | 2.02(1) | 81.5(4) | C | O |
| QEFVUV [59] | 2.090(2) | 2.006(3) | 81.69(9) | C | O |
| YIDGIE [58] | 2.108(7) | 1.998(9) | 81.6(3) | C | O |
| YIDHEB [58] | 2.137(3) | 2.012(4) | 81.4(1) | C | O |
| YIDHAX [58] | 2.117(7) | 1.999(9) | 81.6(3) | C | O |
| YIDGOK [58] | 2.131(3) | 2.007(3) | 81.7(1) | C | O |
| YIDGAW [58] | 2.127(3) | 2.009(4) | 81.5(2) | C | O |
| YIDGUQ [58] | 2.126(2) 2.113(2) | 2.010(3) 2.002(2) | 81.45(9) 82.0(1) | C | O |
| YIDGEA [58] | 2.094(8) 2.105(6) | 2.014(8) 2.003(9) | 81.1(3) 81.3(3) | C | O |
| FUWXIG [57] | 2.098(2) | 1.992(4) | 81.8(1) | C | O |
| FUWXOM [57] | 2.107(4) | 2.006(4) | 81.5(2) | C | O |
| YIDFUP [58] | 2.110(4) | 2.013(4) | 81.6(2) | C | O |
| QEFWAC [59] | 2.07(1) 2.07(1) | 2.01(1) 2.01(1) | 82.7(4) 81.1(5) | C | O |
| IDAJOO [54] | 2.109(2) | 1.995(2) | 82.20(8) | C | O |
| IPISEH [60] | 2.127(2) | 2.019(3) | 80.6(1) | C | N |
| IPISAD [60] | 2.114 | 2.002 | 82.2 | C | N |
| LUWJEV [56] | 2.09(2) | 2.05(2) | 83(1) | C | C |
| LUWJIZ [56] | 2.069(6) | 2.040(7) | 81.5(2) | C | C |
| FONRIL [14] | 2.11(1) | 2.08(1) | 80.1(4) | C | C |
| LUWJOF [56] | 2.283 | 1.845 | 79.9 | C | C |
| LUWKAS [56] | 2.076(7) | 2.024(4) | 81.4(2) | C | Br |
| LUWKIA [56] | 2.072 | 2.07 | 81.2 | C | C |
| FONSAE [14] | 2.111(4) | 2.023(4) | 81.2(2) | C | Cl |
| FOPCAQ [14] | 2.124(6) 2.114(5) 2.112(4) 2.114(4) | 2.051(5) 2.065(5) 2.069(6) 2.069(6) | 80.6(2) 80.3(2) 80.2(2) 79.9(2) | C | C |
| FONRUX [14] | 2.116(3) | 2.023(4) | 81.1(1) | C | Cl |
| FOPCEU [14] | 2.112(8) | 2.05(1) | 79.9(4) | C | C |
| AJOXAZ [37] | 2.074(3) | 2.032(3) | 81.2(1) | C | C |
| FONROR [14] | 2.115(4) | 2.063(5) | 80.0(2) | C | C |
| FONSEI [14] | 2.134(4) | 2.057(5) | 79.6(3) | C | C |
| ICUMEY [51] | 2.068(3) | 2.010(3) | 81.4(1) | S | O |
| FOPCIY [14] | 2.112(3) | 2.056(4) | 80.4(1) | C | C |
| FONREH [14] | unknown | unknown | unknown | C | C |
| IDAJUU [54] | 2.146(2) | 2.051(2) | 80.68(7) | C | P |
| FUXGIQ [47] | 2.009(9) 2.020(9) | 1.95(2) 2.04(2) | 78.7(6) 85.0(6) | O | O |
| FUXGAI [47] | 2.020(5) | 1.993(7) | 82.1(2) | O | O |
| FUXGOW [47] | 2.020(3) | 2.004(4) | 81.7(1) | O | O |
| FUXGEM [47] | 2.022(3) | 1.994(5) | 81.5(1) | O | O |
| NIKHIB [26] | 2.061(2) 2.057(2) | 2.037(3) 2.029(3) | 80.6(1) 80.9(1) | S | S |
| KIGPEY [25] | 2.028(3) | 2.034(4) | 81.1(1) | N | O |
| KIGPIC [25] | 2.063(7) | 2.015(6) | 80.9(3) | N | N |
| WUCKUD [66] | 2.097(2) | 2.075(3) | 79.4(1) | C | C |
| JAZJED [53] | 2.000(2) | 2.022(2) | 81.83(8) | O | O |
| JAYZAO [53] | 2.003(3) | 2.004(5) | 81.9(1) | O | O |
| MIZHIP [18] | 2.078(2) | 2.041(2) | 81.11(8) | C | C |
| MIZHEL [18] | 2.043(2) | 2.045(2) | 81.1(1) | Cl | C |
| MIZJAJ [18] | 2.070(2) | 2.042(2) | 81.03(8) | C | C |
| MIYYAX [18] | 2.072(3) | 2.044(3) | 81.3(1) | C | C |
| JAZJAZ [53] | 2.007(2) | 1.991(2) | 81.82(9) | O | O |
| MIYYEB [18] | 2.070(2) | 2.049(2) | 80.9(1) | C | C |
| MIYXOK [18] | 2.024(3) 2.036(3) | 2.055(4) 2.050(4) | 81.1(1) 80.8(1) | Cl | C |
| MIZHOV [18] | 2.075(3) | 2.040(3) | 81.0(1) | C | C |
| MIYXUQ [18] | 2.040(3) | 2.049(4) | 81.1(1) | Cl | C |
| JAZJON [53] | 2.005(2) | 1.988(2) | 81.63(8) | O | O |
| JAZCOG [53] | 2.00(1) | 2.02(2) | 82.2(6) | O | O |
| PEZQUI [67] | 2.180(2) | 1.995(3) | 81.2(1) | C | O |
| FIDBUS [72] | 2.107(6) | 2.066(8) | 81.2(3) | S | S |
| KEKGEP [73] | 2.13(1) | 2.06(2) | 81.8(7) | C | O |
| QEZYAX [74] | 2.163(8) | 2.014(6) | 80.6(3) | C | O |
| DAJRUE [21] | 2.08(1) 2.083(9) | 1.99(1) 1.99(1) | 81.6(4) 81.7(4) | C | F |
| DAJSAL [21] | 2.076(4) | 2.044(3) | 81.0(2) | C | C |
| DAJROY [21] | 2.073(6) | 1.984(7) | 81.7(3) | C | F |
| DAJRIS [21] | 2.106(4) | 2.027(4) | 81.6(2) | C | Br |
| DAJSEP [21] | 2.092(4) | 2.058(4) | 80.5(1) | C | C |
| AJOXIH [37] | 2.065(3) | 2.038(4) | 81.2(1) | C | C |
| AJOXED [37] | 2.066(3) | 2.041(4) | 81.0(1) | C | C |
| JAZBOF [53] | 2.034(3) 2.033(3) | 1.994(4) 1.993(4) | 81.6(1) 81.7(1) | O | O |
| JAYZOC [53] | 2.013(4) 2.008(5) | 1.995(5) 2.001(5) | 82.0(2) 82.1(2) | O | O |
| WECYUB [75] | 2.060(4) 2.055(4) | 2.046(5) 2.041(5) | 80.8(2) 80.2(2) | C | C |
| JAZKAA [53] | 1.997(2) | 1.994(2) | 81.42(9) | O | O |
| JAYZIW [53] | 1.999(4) | 2.000(5) | 81.8(2) | O | O |
| JAYYOB [53] | 2.043(2) | 1.995(2) | 81.23(8) | O | O |
| GALBAA [22] | 2.008(2) | 1.991(3) | 81.9(1) | O | O |
| PUXGUN [76] | 2.033(2) | 2.027(2) | 81.03(8) | N | N |
| GALBEE [22] | 2.002(3) 2.007(3) | 1.993(3) 1.999(4) | 81.7(1) 81.7(1) | O | O |
| WASQOZ [24] | 2.054(2) | 2.047(2) | 80.45(8) | C | C |
| JAZBIZ [53] | 2.008(3) | 1.996(3) | 81.5(1) | O | O |
| [Au(2ArPY*)X2] (2ArPY* ≠ 2PPY*; X = F, Cl, Br, I) | |||||
| HOSHEE [16] | 2.06(1) | 2.04(2) | 87.2(6) | Cl | Cl |
| ZETYAY [77] | 2.040(3) | 2.021(5) | 85.7(1) | Cl | Cl |
| PUKYAV [85] | 2.035(5) | 2.033(8) | 89.6(3) | Cl | Cl |
| AZOKOS [30] | 2.08(2) 2.09(4) | 2.02(3) 2.01(3) | 88(1) 88(2) | Br | Br |
| FIJZIH [87] | 2.02(1) | 2.03(2) | 86.6(6) | Cl | Cl |
| KAGYIB [88] | 2.054(5) | 2.016(6) | 86.6(2) | Cl | Cl |
| IFUQUX [17] | 2.057(3) | 1.992(5) | 86.6(2) | Cl | Cl |
| FIKNOC [87] | 2.061(9) | 2.04(2) | 88.1(5) | Cl | Cl |
| PUGMAF [89] | 2.05(2) | 2.02(2) | 87.2(9) | Cl | Cl |
| [Au(2ArPY*)L1L2] and [Au(2ArPY*)(L1L2)] (2ArPY* ≠ 2PPY*; L1, L2 ≠ F, Cl, Br, I) | |||||
| TOFDUQ [92] | 2.031(5) 2.046(5) | 2.031(5) 2.020(6) | 88.7(2) 87.7(2) | N | N |
| TOFFAY [92] | 2.041(7) 2.028(7) | 2.025(8) 2.028(7) | 87.7(3) 87.1(3) | N | N |
| RADKOA [93] | 2.070(2) | 2.042(3) | 88.3(1) | S | S |
| RADLER [93] | 2.069(5) | 2.061(6) | 89.0(2) | S | S |
| RADLAN [93] | 2.065(3) | 2.042(3) | 89.2(1) | S | S |
| RADKUG [93] | 2.070(2) | 2.046(2) | 89.63(7) | S | S |
| OVIKOW [82] | 2.12(2) 2.11(2) | 2.03(2) 2.04(2) | 90.0(6) 89.9(7) | S | S |
| OVILAJ [82] | 2.067(4) | 2.061(6) | 88.5(2) | S | S |
| OVIKUC [82] | 2.072(4) | 2.054(3) | 88.2(1) | S | S |
| CEWGUK [33] | 2.036(2) | 2.028(3) | 87.9(1) | N | N |
| ECEGOM [95] ECEGOM 01 [95] | 2.074(2) 2.085(3) | 2.017(2) 2.022(3) | 88.85(8) 87.6(1) | C | Cl |
| MIYXIE [18] | 2.079(2) | 2.061(3) | 87.6(1) | C | C |
| BAZSEB [96] | 2.052(6) 2.041(7) | 2.005(7) 2.018(7) | 89.7(3) 87.7(3) | N | O |
| XEWBOR [63] | 2.058(3) | 2.031(3) | 88.1(1) | N | N |
| XEWBUX [63] | 2.053(2) | 2.012(2) | 87.43(9) | N | Cl |
| SEVDON [97] | 2.046(9) | 2.04(1) | 88.2(4) | N | N |
| SEVDUT [97] | 2.040(4) | 2.021(4) | 89.3(2) | N | N |
| DEFGUR [64] | 2.086(2) | 2.069(2) | 86.23(9) | C | C |
| ECEGAY [95] | 2.114(3) | 2.070(3) | 87.0(1) | C | C |
| FUJHUQ [99] | 2.090(5) | 2.043(7) | 87.1(3) | S | N |
| PUKYEZ [85] | 2.079(9) | 2.03(1) | 85.8(4) | P | Cl |
| USEDOO [9] 1 | 2.096(5) | 2.100(5) | 84.2(2) | P | P |
| QUMZIJ [79] | 2.096(2) 2.100(2) | 2.040(2) 2.041(2) | 87.39(8) 87.27(8) | P | Cl |
| AZOLAF [30] | 1.99(3) 1.98(4) | 2.10(4) 2.10(4) | 93(2) 89(2) | N | N |
| RADLIV [93] | 2.062(2) 2.054(2) | 2.042(2) 2.040(2) | 90.70(8) 90.15(7) | S | S |
| MIYXEA [18] | 2.072(3) | 2.066(3) | 88.5(1) | C | C |
| MIZHUB [18] | 2.088(2) | 2.068(2) | 91.04(8) | C | C |
| MIRLIK [101] | 2.071(2) | 2.019(4) | 89.5(1) | S | N |
| MIRLOQ [101] | 2.068(3) | 2.020(3) | 90.8(1) | S | N |
| FIKQAR [87] | 2.09(1) | 2.06(1) | 85.3(5) | P | Cl |
| MEDPOD [90] | 2.074 | 2.053 | 81.3 | C | C |
| QOCBES [6] | 2.029(2) 2.035(2) | 2.025(3) 2.018(3) | 80.8(1) 81.1(1) | N | N |
| MEDPIX [90] | 2.069(3) | 2.045(2) | 80.94(9) | C | C |
| MEDPAP [90] | 2.075(2) | 2.051(3) | 80.90(9) | C | C |
| QOCBUI [6] | 2.015(6) | 2.012(5) | 81.0(2) | N | N |
| MEDPET [90] | 2.077(3) | 2.039(3) | 81.1(1) | C | C |
| QOCBOC [6] | 2.035(2) | 2.032(2) | 81.3(1) | N | N |
| [Au(ArPY#*)L1L2] and [Au(ArPY#*)(L1L2)] (ArPY#* ≠ 2PPY*, 2ArPY*) | |||||
| ZINHUB [103] | 2.175(3) 2.171(3) | 2.045(4) 2.041(4) | 79.4(1) 78.9(1) | C | N |
| MAXQUX [2] | 2.223(9) | 2.03(1) | 81.0(4) | C | Cl |
| DUZDAF [27] DUZDAF 01 [27] DUZDAF 02 [27] | 2.045(2) 2.06(1) 2.04(1) 2.053(4) | 2.023(3) 2.036(6) 2.021(5) 2.021(5) | 81.0(1) 81.5(3) 80.7(3) 80.9(2) | C | C |
| AJOXON [37] | 2.063(2) | 2.034(3) | 80.6(1) | C | C |
| EWIWUE [105] | 2.113(8) | 2.055(7) | 81.5(3) | I | I |
| FIBRUG [106] | 2.141(2) | 2.024(3) | 82.4(1) | C | Cl |
| FIBROA [106] | 2.141(3) | 2.001(5) | 82.3(2) | C | O |
| IZOTAT [15] | 2.061(2) | 2.067(2) | 81.93(8) | C | C |
| GIVROU [41] | 2.090(3) | 2.004(3) | 83.2(1) | C | Cl |
| EWIXAL [105] | 2.068(7) | 2.02(1) | 82.8(3) | I | N |
| QUVXIR [108] | 2.074(3) | 2.070(3) | 81.6(1) | S | S |
1 In analogous USEDII, USEDEE, USEDUU molecules, the monodentate C(2′) coordination was observed (see Table 5).
Table 8.
Au–N bond lengths [Å] in analogous [Au(2PPY*)Cl2] or [Au(2ArPY*)Cl2] and [Au(2PPY)Cl3] or [Au(2ArPY)Cl3] compounds.
Table 8.
Au–N bond lengths [Å] in analogous [Au(2PPY*)Cl2] or [Au(2ArPY*)Cl2] and [Au(2PPY)Cl3] or [Au(2ArPY)Cl3] compounds.
| 2PPY or 2ArPY | [Au(2PPY*)Cl2] or [Au(2ArPY*)Cl2]: Au–N Bond Length | [Au(2PPY)Cl3] or [Au(2ArPY)Cl3]: Au–N Bond Length |
|---|---|---|
| 2-phenylpyridine | 2.03(1) IJAQEP [3] | 2.035(6) YIDMAA [109] |
| 2-(2,4-difluorophenyl)pyridine | 2.015(8) HOSHOO [16] | 2.047(4) HOSHUU [16] |
| 2-(2-trifluoromethoxyphenyl)pyridine | 2.034(5) MIYYUR [18] | 2.041(1) MIYZEC [18] |
| 2-benzylpyridine | 2.06(1) HOSHEE [16] | 2.046(3) HOSHII [16] |
| 2-benzoylpyridine | 2.035(5) PUKYAV [85] | 2.053(2) MIYZAY [18] |
| 2-phenylsulfanylpyridine | 2.061(9) FIKNOC [87] | 2.06(1) DUCYEI [110] |
Table 9.
15N chemical shifts (with respect to CH3NO2, in ppm—δ15N) and 15N coordination shifts (Δ15Ncoord) for [Au(2PPY*)L1L2], [Au(2PPY*)(L1L2)], [Au(2ArPY*)L1L2], [Au(2ArPY*)(L1L2)], [Au(ArPY#*)L1L2], [Au(ArPY#*)(L1L2)] compounds (L1, L2, L—monodentate ligands (including F, Cl, Br, I), LL—bidentate ligands; R1 and R2 are substituents in the pyridine (or pyridine-like) ring and the phenyl (aryl) ring, respectively.
Table 9.
15N chemical shifts (with respect to CH3NO2, in ppm—δ15N) and 15N coordination shifts (Δ15Ncoord) for [Au(2PPY*)L1L2], [Au(2PPY*)(L1L2)], [Au(2ArPY*)L1L2], [Au(2ArPY*)(L1L2)], [Au(ArPY#*)L1L2], [Au(ArPY#*)(L1L2)] compounds (L1, L2, L—monodentate ligands (including F, Cl, Br, I), LL—bidentate ligands; R1 and R2 are substituents in the pyridine (or pyridine-like) ring and the phenyl (aryl) ring, respectively.
| Parent Ring System | R1 | R2 | L1 | L2 | L1L2 | Counterion | NMR Solvent | 15N Chemical Shift | 15N Coordination Shift |
|---|---|---|---|---|---|---|---|---|---|
| 2-phenylpyridine* | Cl | Cl | DMSO-d6 | −148.9 [4] | −77.0 a | ||||
| 1,3-bis(2,6-diisopropylphenyl)imidazol-2-ylidene | Cl | Cl− | CD3COCD3 | −147.7 [7] | −75.8 a | ||||
| 4-methyl | methyl | methyl | CD2Cl2 | −131.0 [53] | −56.1 b | ||||
| 4-methyl | methyl | Br | CD2Cl2 | −121.6 [53] | −46.7 b | ||||
| 4-methyl | allyl | Br | CD2Cl2 | −122.6 [53] | −47.7 b | ||||
| 4-methyl | acetate | acetate | CD2Cl2 | −164.4 [53] | −89.5 b | ||||
| 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 | −165.6 [53] | −90.7 b | ||||
| 4-methyl | HNC(CH3)OCH2CH2 | CF3COO− | CD2Cl2 | −129.0 [60] | −54.1 b | ||||
| 4-methyl | phenyl | Br | CD2Cl2 | −127.9 [53] | −53.0 b | ||||
| 3,5-dimethyl | trifluoroacetate | trifluoroacetate | CD2Cl2 | −167.1 [53] | −94.5 c | ||||
| 3,5-bis(pentafluorophenyl) | trifluoroacetate | trifluoroacetate | CD2Cl2 | −167.7 [53] | −94.7 d | ||||
| 6-methyl | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 | −161.7 [53] | −88.2 e | |||
| 4-trifluoromethyl | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 | −160.4 [53] | −95.5 f | |||
| 3-methoxy | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 | −164.9 [53] | −101.0 g | |||
| 4-methoxy | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 | −187.1 [53] | −92.9 h | |||
| 6-methoxy | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 | −187.7 [53] | −66.2 i | |||
| 3-nitro | 4-methyl | trifluoroacetate | trifluoroacetate | CD2Cl2 | −163.9 [53] | −104.5 j | |||
| 2-benzylpyridine* | Cl | Cl | DMSO-d6 | −151.8 [78] −154.2 $ [80] | −90.9 k −93.3 k | ||||
| 2-benzoylpyridine* | Cl | Cl | DMSO-d6 | −165.0 [86] | −104.7 l | ||||
| 7,8-benzoquinoline* | Cl | Cl | DMSO-d6 | −143.3 [104] | −69.2 m |
$ original value (227.5 ppm) was referenced to liquid NH3 [80] and recalculated with respect to neat CH3NO2 by subtracting 381.7 ppm relative shift [111]. a vs. 2-phenylpyridine in DMSO-d6: −71.9 ppm [4]. b vs. 2-(4-methylphenyl)pyridine in CD2Cl2: −74.9 ppm [53]. c vs. 2-(3,5-dimethylphenyl)pyridine in CD2Cl2: −72.6 ppm [53]. d vs. 2-(3,5-bis(pentafluorophenyl)phenyl)pyridine in CD2Cl2: −73.0 ppm [53]. e vs. 6-methyl-2-(4-methylphenyl)pyridine in CD2Cl2: −73.5 ppm [53]. f vs. 4-trifluoromethyl-2-(4-methylphenyl)pyridine in CD2Cl2: −64.9 ppm [53]. g vs. 3-methoxy-2-(4-methylphenyl)pyridine in CD2Cl2: −63.9 ppm [53]. h vs. 4-methoxy-2-(4-methylphenyl)pyridine in CD2Cl2: −94.2 ppm [53]. i vs. 6-methoxy-2-(4-methylphenyl)pyridine in CD2Cl2: −121.5 ppm [53]. j vs. 3-nitro-2-(4-methylphenyl)pyridine in CD2Cl2: −59.4 ppm [53]. k vs. 2-benzylpyridine in DMSO-d6: −60.9 ppm [78]. l vs. 2-benzoylpyridine in DMSO-d6: −60.3 ppm [86]. m vs. 7,8-benzoquinoline in DMSO-d6: δ15Nlig = −74.1 ppm [104].
Table 10.
Summary of biological activity studies for the reviewed Au(III) compounds.
| Reference | General Formula | Auxiliary Ligand(s) | Cancer Cells | Non-Cancerous Cells |
|---|---|---|---|---|
| [3] | [Au(2ppy*)L2] [Au(2ppy*)(LL)] | L = acetate, benzoate; LL = malonate, cyclobutane-1,1-dicarboxylate | leukemia MOLT-4; C2Cl2 mouse tumour | |
| [8] | [Au(2PPY*)(LL)]+ (2PPY = 2-phenyl- and 2-(4-methylphenyl)pyridine) | LL = 1,1-dimethylbiguanidate, 1-phenylbiguanidate | breast MDA-MB 231, MDA-MB 468; lung H460 | |
| [9] | [Au(ArPY#*)(LL)]2+ (ArPY# = 2-phenyl-, 2-(4-methylphenyl)-, 2-(4-formylphenyl)-, 2-benzyl-, 2-benzoyl-, 2-phenoxy- and 2-anilinopyridine; 7,8-benzoquinoline) | LL = 1,2-bis(diphenylphosphino)benzene | breast MDA-MB 231; lung H460; ovarian A2780, OVCAR8 | |
| [11] | [Au(2PPY*)(LL)]+ (2PPY = 2-phenyl-, 5-n-butyl-2-phenyl-, 2-(3-n-butylphenyl)-, 2-(4-n-butylphenyl)-, 2-(4-trifluoromethylphenyl)- and 2-(4-n-butoxyphenyl)pyridine) | LL = diethylaminocarbodithioate, di-n-butylaminocarbodithioate | breast MCF-7; MDA-MB-231; cervix HeLa; liver HepG2; lung NCI-H460; glioblastoma U87; melanoma B16 | immortalized liver (MIHA) |
| [25] | [Au(2ArPY*)Cl2] [Au(2ArPY*)(LL)] (2ArPY = 2-(4-tert-butylphenyl)- and 2-benzylpyridine) | LL = benzene-1-olate-2-acetylazanide, benzene-1,2-bis(acetylazanide), benzene-1-olate-2-(N-(acridin-9-yl))azanide, benzene-1-azanide-2-(N-(acridin-9-yl)azanide | breast MCF-7; lung A549; leukemia HL60 | |
| [26] | [Au(2PPY*)(LL)] (2PPY = 2-(4-tert-butylphenyl)- and 2-(4-tert-butylphenyl)-5-tert-butylpyridine) | LL = dimethylaminocarbodithioate, diethylaminocarbodithioate, di(n-butyl)aminocarbodithioate, (n-but-1,4-diyl)aminocarbodithioate, N-(ethoxycarbonylmethyl)methylaminocarbodithioate | breast MCF-7, MDA-MB-231; colon HCT-116; lung A549; leukemia HL60 | umbilical vein endothelial cells HUVEC |
| [28] | [Au(2ppy*)L1L2] [Au(2ppy*)(LL)] | L1 = SCN, L2 = NCS; LL = propan-1-ol-2,3-dithiolate, 2-thiolatepropionate, 2,3-dithiolatesuccinic acid, 2-thiolatebenzoate | leukemia MOLT-4; C2Cl2 mouse tumour | |
| [30] | [Au(2-benzoylpyridine*)Cl2] | lung H358, H460; pancreas MiaPaCa | ||
| [31] | [Au(2ArPY*)L2] [Au(2ArPY*)(LL)]+ (2ArPY = 2-phenyl-, 2-(4-methylphenyl)- and 2-benzylpyridine) | L = acetate; LL = L-phenylalaninate, L-methioninate | colon caco-2/TC7 | |
| [33] | [Au(2ArPY*)Cl2] [Au(2ArPY*)(LL)]+ (2ArPY = 2-phenyl-, 2-benzyl- and 2-benzoylpyridine) | LL = 1,1-dimethylbiguanidate, 1-(2-phenylethyl)biguanidate | breast MDA-MB-231; ovarian A2780, A2780cis | murine hepatocytes TAMH, cardiomyocytes AC10 |
| [43] | [Au(2ppy*)L1L2]0/+ | L1 = 2,4,6-tris(trifluoromethyl)phenyl, L2 = H2O, OH, trifluoroacetate, 4-phenylpyridine, quinoline triphenylphosphine | cervix HeLa | lung fibroblasts MRC-5 |
| [51] | [Au(2ArPy*)(LL)] (2ArPy = 2-phenyl-, 2-(4-methylphenyl)-, 2-benzyl- and 2-anilinopyridine) | LL = 2-thiolatebenzoate | murine leukemia P388 | |
| [63] a | [Au(2ArPy*)(LL)] (2ArPy = 2-(4-methylphenyl)-, 2-benzyl- and 2-anilinopyridine) | LL = ethylene-1,2-bis(4-methylphenylsulfonylazanide), benzene-1,2-bis(acetylazanide), benzene-1,2-bis(4-methylphenylsulfonylazanide) | murine leukemia P388 | |
| [64] | [Au(2ArPy*)(LL)] (2ArPy = 2-(4-methylphenyl)-, 2-benzyl- and 2-anilinopyridine) | LL = sulfonebis(cyanomethyl), sulfonebis(benzoylmethyl), benzoylmethyl benzoyl(2-(tert-butylamino)ethyl) sulfone | murine leukemia P388 | |
| [79] | [Au(2-benzylpyridine*)Cl2] [Au(2-benzylpyridine*)LCl]+ [Au(2-benzylpyridine*)L2] | L = 1,3,5-triazaphosphaadamantane, 1,2,3,4-tetraacetyl-6-thioglucose-6-yl | colon HCT116; lung A549; mammary MCF-7; ovarian A2780 | embryonic kidney cells HEK-293T |
| [82] | [Au(2-benzylpyridine*)(LL)] | LL = 4-ethoxycarbonylazacyclohexane-1-carbodithioate, 4-aminocarbonylazacyclohexane-1-carbodithioate | cervix HeLa; bowel HT29; ovarian A2780 | |
| [83] | [Au(2ArPY*)Cl2] (2ArPY = 2-benzyl, 2-phenoxy-, 2-phenylsulfanyl- and 2-anilinopyridine) | breast MDA-MB-231; colon DLD-1, HCT-116, HT29; kidney A-498, ACHN; lung A549; prostate PC-3; uterus MES-SA | ||
| [92] | [Au(2-benzylpyridine*)(LL)]2+ | LL = 1R,2R-cyclohexane-1,2-diamine | breast MCF7; ovarian A2780, OVCAR-8 | retinal pigment epithelial cells engineered to overexpress MYC gene RPE MYC |
| [93] | [Au(2ArPY*)(LL)] (2ArPY = 2-benzyl- and 2-benzoylpyridine) | LL = dimethylaminocarbodithioate, diethylaminocarbodithioate, azacyclohexane-1-carbodithioate, 4-(4-bromophenyl)-1,4-diazacyclohexane-1-carbodithioate, 4-(4-methoxyphenyl)-1,4-diazacyclohexane-1-carbodithioate | breast MDA-MB-231, MDA-MB-175; ovarian A2780 | retinal pigment epithelial cells engineered to overexpress NEO gene RPE-NEO; diploid lung fibroblasts MRC5 |
| [96] a | [Au(2ArPy*)(LL)] (2ArPy = 2-benzyl- and 2-anilinopyridine) | LL = benzene-1,2-diolate, 3,5-di(tert-butyl)benzene-1,2-diolate, benzene-1-olate-2-acetylazanide, 2,5-bis(ethoxycarbonyl)thiophen-3,4-diolate | leukemia P388 | |
| [97] a | [Au(2-benzylpyridine)L2] | L = isatinate, phtalimidate, saccharinate | murine leukemia P388 | |
| [99] | [Au(2-benzylpyridine*)(LL)] | LL = 4-nitrophenyliminocarbo(pyrrol-5-yl-1-ate)thiolate | lung A549 | |
| [102] | [Au(3-(9,9-bis(2-hydroxyethyl)fluoren-2-yl)isoquinoline*)L2] b | L = phenylethynyl | colon HCT116; liver HepG2; lung A549; melanoma A375 |
a All compounds investigated in this paper, with respect to their anti-cancer activity, were additionally tested against some species of bacteria (Escherichia coli, Bacillus subtilis, Pseudomonas aeruginosa) and fungi (Candida albicans, Trichophyton mentagrophytes, Cladosporium resinae) [63,96,97]. b upon photo-activation (light irradiation).
Table 11.
Summary of catalytic activity studies for the reviewed Au(III) compounds.
| Reference | General Formula | Auxiliary Ligand(s) | Reactants | Products |
|---|---|---|---|---|
| [7] | [Au(2ppy*)LCl]+ | L = 1,3-bis(2,6-diisopropylphenyl)imidazol-2-ylidene, triphenylphosphine | alkynes + H2O | enoles |
| [16] | [Au(2ArPY*)Cl2] (2ArPY = 2-phenyl-, 2-(2,4-difluorophenyl)- and 2-benzylpyridine) | arylacetylenes + acyl chlorides + benzylimines | oxazoles | |
| [17] | [Au(2ArPY*)Cl2] (2ArPY = 2-phenyl-, 2-(4-methylphenyl)-, 2-(4-chlorophenyl)-, 2-(4-methoxyphenyl)-, 2-benzyl-, 2-(1-methylbenzyl)-, 2-(1-methoxybenzyl)-, 2-(1-benzoxyiminobenzyl)-, 2-benzoyl-, 2-phenoxy- and 2-(4-tert-butylphenoxy)pyridine) | terminal alkynes + aldehydes + amines | propargylic amines, allenes or oxazoles | |
| [22] | [Au(2PPY*)L2] (2PPY = 5-carboxy-2-(4-carboxyphenyl)- and 5-ethoxycarbonyl-2-(4-ethoxycarbonylphenyl)pyridine) | L = Cl, trifluoroacetate | propargyl esters + styrene | cyclopropane derivatives |
| [42] | [Au(2ppy*)L1L2]+ | L1 = 2,4,6-tris(trifluoromethyl)phenyl, L2 = H2O, 4-fluoroaniline, 4-phenylpyridine, quinoline, trimethyl phosphite, triphenylphosphine | benzylic amines + O2 (photooxidation) | benzylic imines |
| [65] | [Au(2-(4-methylphenyl)pyridine*)(LL)] | LL = oxybis(phenylborinate) | CO + O2 | CO2 |
| [103] | [Au(ArPY#*)2]+ (ArPY# = 2-phenylquinoline, 3-phenylisoquinoline) | (a) benzaldehyde + piperidine + phenylacetylene (b) methylethynylethanol + 1-methylindol | (a) 1-((phenylethynyl)(phenyl)methyl)piperidine (b) 3-substituted 1-methylindol | |
| [106] | [Au(7,8-benzoquinoline*)L2] | L = trifluoroacetate | diphenylacetylene + 1,3,5-trimethoxybenzene | styrene derivative |
Table 12.
Summary of luminescence studies for the reviewed Au(III) compounds.
| Reference | General Formula | Auxiliary Ligand(s) | Lifetime | Maximal Quantum Yield |
|---|---|---|---|---|
| [6] | [Au(2ArPY*)(LL)] (2ArPY = 2-(9,9-dimethylfluoren-2-yl)-, 4-dimethylamino-2-(9,9-dimethylfluoren-2-yl)-, 2-(dibenzofuran-4-yl)- and 4-dimethylamino-2-(dibenzofuran-4-yl)pyridine) | LL = 1,1-dimethylmethylenebis(3-trifluoromethylpyrazol-5-ylate) | >10 µs | 22% |
| [15] | [Au(ArPY#*)L2] (ArPY# = 2-phenyl- and 2-(2,4-difluorophenyl)pyridine; 7,8-benzoquinoline) | L = triisopropylsilylethynyl, phenylethynyl, 4-fluorophenylethynyl, 4-(phenylethynyl)phenylethynyl | >10 µs or <10 µs | 11% |
| [18] | [Au(2ArPY*)LCl] [Au(2ArPY*)L1L2] (2PPY = 2-(3-trifluoromethylphenyl)-, 2-(2-trifluoromethoxyphenyl)-, 2-(4-trifluoromethoxyphenyl)-, 2-benzyl-, 2-benzoyl- and 2-anilinopyridine) | L, L1, L2 = pentafluorophenyl, 4-fluorophenylethynyl, 4-bis(2,4,6-trimethylphenyl)boranylphenylethynyl) | <10 µs | 5% |
| [19] | [Au(ArPY#*)(LL)]2+ (ArPY# = 2-phenyl-, 2-(2,4-difluorophenyl)-, 2-(4-phenylphenyl)-, 2-(naphth-2-yl)- and 2-(9,9-di(n-butyl)fluoren-2-yl)pyridine; 1-(naphth-2-yl)isoquinoline) | LL = methylenebis(3-methyl-1H-imidazol-1-yl-2-ylidene, methylenebis(3-n-butyl-1H-imidazol-1-yl-2-ylidene, methylenebis(3-(3-sulfonate-n-propyl)-1H-imidazol-1-yl-2-ylidene), 1,2-ethylenebis(3-n-butyl-1H-imidazol-1-yl-2-ylidene), 1,3-propylenebis(3-n-butyl-1H-imidazol-1-yl-2-ylidene | >10 µs | 10% |
| [24] | [Au(2PPY*)L2] (2PPY = 4-dimethylamino-2-(2,3,4-trifluoro)phenyl)-, 4-dimethylamino-2-(3-trifluoromethyl)phenyl)- and 4-dimethylamino-2-(4-trifluoromethoxy)phenyl)pyridine) | L = pentafluorophenyl, 4-fluorophenylethynyl | <10 µs | 28% |
| [27] | [Au(ArPY#*)L2] (ArPY# = 2-phenyl- and 2-(4-methylphenyl)pyridine; 1-phenylisoquinoline) | L = CN | <10 µs | 26% |
| [37] | [Au(ArPY#*)L2] (ArPY# = 2-phenyl-, 2-(4-methylphenyl)-, 2-(4-tert-butylphenyl)-, 4-methyl-2-(4-methoxyphenyl)-, 5-methyl-2-(4-methoxyphenyl)- and 5-trifluoromethyl-2-(4-methoxyphenyl)pyridine; 1-phenyl- and 1-(4-methoxyphenyl)isoquinoline) | L = trimethylsilylethynyl, 4-ethylphenylethynyl, 4-n-butylphenylethynyl, 4-trifluoromethylphenylethynyl, 4-methoxyphenylethynyl, 4-aminophenylethynyl | >10 µs | 10% |
| [38] | [Au(2ppy*)L2] [Au(2ppy*)(LL)] | L = phenyl, pentafluorophenyl, 4-trifluoromethylphenyl, thiophen-2-yl; LL = 1,1′-biphen-2,2′-diyl | <10 µs | 2% |
| [39] | [Au(ArPY#*)(LL)] (ArPY# = 2-phenyl-, 2-(9,9-dimethylfluoren-2-yl)- and 2-(dibenzofuran-4-yl)pyridine; 1-phenylisoquinoline) | LL = bis(2-acetylidephenyl)acetylene | >10 µs | 75% |
| [41] | [Au(ArPY#*)L1L2] (ArPY# = 2-phenylpyridine; 7,8-benzoquinoline) | L1 = 2,4,6-tris(trifluoromethyl)phenyl, L2 = Cl, I, CN, phenylethynyl, 4-diphenylaminophenylethynyl | <10 µs | 39% |
| [42] | [Au(2ppy*)L1L2]+ | L1 = 2,4,6-tris(trifluoromethyl)phenyl, L2 = H2O, 4-fluoroaniline, 4-phenylpyridine, quinoline, trimethyl phosphite, triphenylphosphine | >10 µs | 18% |
| [75] | Au(ArPY#*)L2] (ArPY# = 5-trifluoromethyl-2-(2-diphenylamino)phenyl-, 5-methyl-2-(9,9-di(n-hexyl)fluoren-2-yl)-, 5-trifluoromethyl-2-(9,9-di(n-hexyl)fluoren-2-yl)-, 5-methyl-2-(7-(4-diphenylaminophenyl)-9,9-di(n-hexyl)fluoren-2-yl)-, 5-trifluoromethyl-2-(7-(4-diphenylaminophenyl)-9,9-di(n-hexyl)fluoren-2-yl)- and 5-trifluoromethyl-2-(9,9-(1,1′-biphenyl-2,2′-diyl)fluoren-2-yl)pyridine; 1-(7-(4-diphenylaminophenyl)- (9,9-di(n-hexyl)fluoren-2-yl))isoquinoline) | L = phenylethynyl, 3,5-bis(trifluoro)phenylethynyl) | >10 µs or <10 µs | 84% |
| [90] | [Au(2ArPY*)L2] (2ArPY = 2-(9,9-dimethylfluoren-2-yl)-, 4-methyl-2-(9,9-dimethylfluoren-2-yl)-, 4-methylamino-2-(9,9-dimethylfluoren-2-yl)- and 2-(7-trifluoromethyl-9,9-dimethylfluoren-2-yl)pyridine) | L = pentafluorophenyl | >10 µs | 17% |
Disclaimer/Publisher’s Note: The statements, opinions and data contained in all publications are solely those of the individual author(s) and contributor(s) and not of MDPI and/or the editor(s). MDPI and/or the editor(s) disclaim responsibility for any injury to people or property resulting from any ideas, methods, instructions or products referred to in the content. |
© 2023 by the authors. Licensee MDPI, Basel, Switzerland. This article is an open access article distributed under the terms and conditions of the Creative Commons Attribution (CC BY) license (https://creativecommons.org/licenses/by/4.0/).
Share and Cite
MDPI and ACS Style
Pazderski, L.; Abramov, P.A. Au(III) Cyclometallated Compounds with 2-Arylpyridines and Their Derivatives or Analogues: 34 Years (1989–2022) of NMR and Single Crystal X-ray Studies. Inorganics 2023, 11, 100. https://doi.org/10.3390/inorganics11030100
AMA Style
Pazderski L, Abramov PA. Au(III) Cyclometallated Compounds with 2-Arylpyridines and Their Derivatives or Analogues: 34 Years (1989–2022) of NMR and Single Crystal X-ray Studies. Inorganics. 2023; 11(3):100. https://doi.org/10.3390/inorganics11030100
Chicago/Turabian StylePazderski, Leszek, and Pavel A. Abramov. 2023. "Au(III) Cyclometallated Compounds with 2-Arylpyridines and Their Derivatives or Analogues: 34 Years (1989–2022) of NMR and Single Crystal X-ray Studies" Inorganics 11, no. 3: 100. https://doi.org/10.3390/inorganics11030100
Note that from the first issue of 2016, this journal uses article numbers instead of page numbers. See further details here.
